I am hoping someone could kindly show the step by step instruction to solve this equation. I have tried to solve it many times but it is still not clear, could someone please show the steps 2(8r^2+r)-4r Thanks

Answers

Answer 1

Answer: 30r

Step-by-step explanation:

2(8r2+r)-4r

2(17r)-4r

34r-4r

30r

Answer 2

Answer:

16r^2-2r

Step-by-step explanation:

2(8r^2+r)-4r

(16r^2 +2r)-4r               Distribute the 2

16r^2+(2r-4r)                Regroup like terms

16r^2-2r

Hope this helps!


Related Questions

What is an equivalent form of the function f(x) = x^2 +8x+15 that reveals the zeros of the function? A. y= (x-3)^2-5 B. f(x) = (x-3)^2-5 C. f(x) = (x+3)(x+5)

Answers

ANSWER

C. f(x) = (x+3)(x+5)

EXPLANATION

The given function is

[tex]f(x) = x^2 +8x+15[/tex]

The factored form of the function reveals the zeros of the function.

From the factored form, we apply the zero product principle to get the zeros.

From the given options, the factored form of the polynomial is

[tex]f(x) = (x+3)(x+5)[/tex]

Let f(x) = -2x - 7 and g(x) = -4x + 6. Find (fog) (-5)

Answers

Answer:

[tex]\left(fog\right)\left(-5\right)=-59[/tex]

Step-by-step explanation:

Given functions are [tex]f\left(x\right)=-2x-7[/tex] and [tex]g\left(x\right)=-4x+6[/tex].

Using both functions we need to find about what is the value of [tex]\left(fog\right)\left(-5\right)[/tex]. That can be done as shown below:

[tex]\left(fog\right)\left(-5\right)[/tex]

[tex]=f\left(g\left(-5\right)\right)[/tex]

[tex]=f\left(-4\left(-5\right)+6\right)[/tex]

[tex]=f\left(20+6\right)[/tex]

[tex]=f\left(26\right)[/tex]

[tex]=-2\left(26\right)-7[/tex]

[tex]=-52-7[/tex]

[tex]=-59[/tex]

Hence final answer is [tex]\left(fog\right)\left(-5\right)=-59[/tex].

Please help me out with this

Answers

Answer:

81.75 ft²

Step-by-step explanation:

The area (A) of a trapezoid is calculated using the formula

A = [tex]\frac{1}{2}[/tex] h (a + b)

where a, b are the parallel bases and h is the perpendicular height

Calculate h using the right triangle and the sine ratio

sin30° = [tex]\frac{opposite }{hypotenuse}[/tex] = [tex]\frac{h}{10}[/tex]

Multiply both sides by 10

10 × sin30° = h, thus

h = 5

a = 12 and b = 8.7 + 12 = 20.7, hence

A = [tex]\frac{1}{2}[/tex] × 5 × (12 + 20.7)

   = 0.5 × 5 ×32.7

   = 81.75 ft²

Which of the following is an equation for the sine wave graphed below?

y = 8 sin (1/2x)

y = 8 sin (x)

y = 8 sin (2x)

y = 8 sin (4x)

Answers

Answer:

A [tex]y=8\sin \dfrac{1}{2}x[/tex]

Step-by-step explanation:

From the graph you can see that the period of the function is

[tex]720^{\circ}=4\pi[/tex]

Now the period of the function [tex]y=8\sin kx[/tex] is

[tex]T=\dfrac{2\pi}{k}[/tex]

Thus,

[tex]4\pi=\dfrac{2\pi}{k}\Rightarrow 4\pi k=2\pi\\ \\k=\dfrac{2\pi}{4\pi}=\dfrac{1}{2}[/tex]

and the expression for the function is

[tex]y=8\sin \dfrac{1}{2}x[/tex]

Find the area of the shaded sector (It is 45 degrees with a radius of 7) Help!!!

Answers

Answer:

Step-by-step explanation:

The formula for the area of a sector is

[tex]A_{s} =\frac{\theta }{360}*\pi r^2[/tex]

where theta is the angle given as 45 and r is the radius (7).  Plugging in we get

[tex]A_{s}=\frac{45}{360}*\pi  (7)^2[/tex]

Simplify a bit to get

[tex]A_{s}=\frac{1}{8}*49\pi[/tex]

which gives you, in terms of pi:

[tex]A_{s}=\frac{49\pi }{8}[/tex]

or if you need to use the decimal form, rounded to the hundredths position:

A = 19.24

It was 9/20 ..
A math class has 9 girls and 1 boy in the seventh grade and 2 girls and 2 boys in the eighth grade. The teacher randomly selects a seventh grader and an eighth grader from the class for a competition. What is the probability that the students she selects are both girls?

Write your fraction in simplest form.

Answers

Answer:

[tex]\frac{9}{20}[/tex]

Step-by-step explanation:

We want probability that 1st is girl AND 2nd is girl as well.

In probability "AND" means multiplication and "OR" means "addition".

We find the probabilities separately and multiply them together, since "AND".

P(girl from 7th grader) = number of girl 7th grader/total number of 7th grader

=9/10

P(girl from 8th grade) = number of girl in 8th grade/total number of 8th grader

=2/4

P(both girls) = 9/10 * 2/4 =9/20

Help Plz ASAP!!!!!



Arianna's register shows a deposit on 9/5 in the amount of $310.25 an ATM withdrawal on 9/8 in the amount of $60.00 and check #149 on 9/14 in the amount of $240.67. No other Transactions were made



What should the balance be in Arianna register? Use this bank statement


A.-$32.63

B.$448.72

C.$587.88

D.877.82

Answers

Answer:

Step-by-step explanation:

Observe in the attached image that the final balance in your account on 9/1 is $578.30.

Then:

*On 9/6 he makes a payment of $140.30

*On 9/8, he makes a withdrawal from an ATM of $120

This means that:

$140.30 + $120 = $260.30

Then:

*On 9/18 you receive a deposit of $356.22

This means that:

$356.22

So, we have:

Beginning Balance: $578.30.

Total Withdrawals: $260.30

Total Deposits: $356.22

Final Balance = Beginning balance + Total Deposits - Total Withdrawals

Final Balance= $578.30 + $356.22 - $260.30

Final balance= $674.22

Then:

Date     Description    Debits(-) Credits(+)    Balance

9/6        Auto Pay         140.30                       438.00

9/8         ATM               120.0                         318.00

9/18       Deposit                           356.22      674.22

The balance in Arianna's register after the transactions will be $587.88. Then the correct option is C.

What is a bank transaction?

A monetary transfer is a record of money entering and exiting your account and is known as a bank transaction.

Arianna's register shows a deposit on 9/5 in the amount of $310.25 an ATM withdrawal on 9/8 in the amount of $60.00 and checks #149 on 9/14 in the amount of $240.67.

No other Transactions were made.

Then the balance be in Arianna's register will be

→ $ 578.37 + $ 310.25 - $ 60 - $ 240.67

→ $ 587.88

More about the bank transaction link is given below.

https://brainly.com/question/13164233

#SPJ2

(05.06)
Which of the following points lie in the solution set to the following system of inequalities?

y ≤ x − 5
y ≥ −x − 4

A) (−5, 2)

B) (5, −2)

C) (−5, −2)

D) (5, 2)

Answers

the answer for this question is (B) 5,-2

The model represents an equation. What value of x makes the equation true?
A)
3
4
B)
9
2
C) −
3
4
D) −
9
2

Answers

Answer:

  B)  9/2

Step-by-step explanation:

Subtracting 5x+7 from both sides leaves 2x = 9.

Dividing the 9 into two parts, we find ...

  x = 9/2

Answer: 9/2 your welcome i got a 100% on the test by the way

Step-by-step explanation:

ANSWER PLEASE LORD ANSWER

Answers

Answer:

< 2.11, 4.53 >, < -3.03, -1.75 >, <2.93 cos 108.26, 2.93 sin 108.26 >

Step-by-step explanation:

First, let's decompose Bruce's velocity along the x- and y- direction. Bruce is moving 5 m/s at 25 degrees east of north, so its angle with respect to the positive x-direction is actually 90 - 25 = 65 degrees. So its components are

[tex]b_x = (5 m/s) cos 65^{\circ} =2.11 m/s\\b_y = (5 m/s) sin 65^{\circ} =4.53 m/s[/tex]

So, Bruce's vector is

< 2.11, 4.53 >

The current is moving 3.5 m/s at an angle 60 degrees west of south, which means an overall angle of 210 degrees, measured counterclockwise from the positive x-axis. So, the components of the current's velocity are

[tex]c_x = (3.5 m/s) cos 210^{\circ}=-3.03 m/s\\c_y = (3.5 m/s) sin 210^{\circ}=-1.75 m/s[/tex]

So, the current's vector is

< -3.03, -1.75 >

Finally, we can add the components of the two vectors to find Bruce's actual velocity:

[tex]v_x = b_x + c_x = 2.11 + (-3.03)=-0.92 m/s\\v_y = b_y + c_y = 4.53+(-1.75)=2.78 m/s[/tex]

So, Bruce's actual velocity is

< -0.92, 2.78 >

The magnitude is

[tex]v=\sqrt{(-0.92)^2+(2.78)^2}=2.93 m/s[/tex]

And the direction is

[tex]\theta=180^{\circ} - tan^{-1} (\frac{v_y}{v_x})=180^{\circ} - tan^{-1}(\frac{2.78}{-0.92})=180^{\circ}-71.7^{\circ}=108.3^{\circ}[/tex]

< 2.11, 4.53 >, < -3.03, -1.75 >, <2.93 cos 108.26, 2.93 sin 108.26 >

Given: ΔPSQ, PS = SQ

Perimeter of ΔPSQ = 50

SQ – PQ = 1

Find: Area of ΔPSQ

Answers

Answer:

To solve this problem we will use Heron's formula:

[tex]A=\sqrt{s(s-a)(s-b)(s-c)}[/tex]

Where [tex]a, \ b \ and \ c[/tex] are the side lengths of the triangle and [tex]s[/tex] is the semiperimeter (half the perimeter of the triangle). We know that:

[tex]Perimeter \ P=\triangle PSQ=PS+PQ+SQ: \\ \\ \triangle PSQ=P=50 \\ \\ Semiperimeter \ s: \\ \\ s=\frac{P}{2}=25[/tex]

Also:

[tex](I) \ PS=SQ \\ \\ (II) \ SQ-PQ = 1 \\ \\ (III) \ PS+PQ+SQ=50 \\ \\ \\ (I) \ into \ (III): \\ \\ SQ+PQ+SQ=50 \\ \\ \therefore (IV) \ 2SQ+PQ=50 \\ \\ From \ (II): \\ \\ PQ=SQ-1 \\ \\ (II) \ into \ (IV): \\ \\ 2SQ+(SQ-1)=50 \\ 3SQ-1=50 \\ 3SQ=51 \\ \\ \boxed{SQ=17} \\ \\ \boxed{PS=17} \\ \\ PQ=SQ-1=17-1 \therefore \boxed{PQ=16}[/tex]

Finally:

[tex]A=\sqrt{s(s-a)(s-b)(s-c)} \\ \\ A=\sqrt{s(s-PS)(s-SQ)(s-PQ)} \\ \\ A=\sqrt{s(s-17)(s-17)(s-16)} \\ \\ A=\sqrt{25(25-17)(25-17)(25-16)} \\ \\ \boxed{A=120}[/tex]

A fish tank is a cube. Its side length is 4 1/2 feet. The volume of water needed to completely fill the fish tank is ___ cubic feet.

Answers

The equation for the volume of a cube is V=s^3, where V is volume and s is side length.  Plug in and solve:

V=4.5^3

V=4.5*4.5*4.5

V=91.125ft^3

Hope this helps!!


Given the similarity statement ΔDEF ∼ ΔXYZ, which angle corresponds with ∠Z?



A. ∠F
B. ∠Y
C. ∠E
D. ∠D


Answers

Answer:

F

Step-by-step explanation:

In congruent triangles, or similar triangles, the letters in the same place will also be congruent

Answer:

the answer is A

Step-by-step explanation:


What's the area of a circle with radius 18 units?



A. 36π units2
B. 18π units2
C. 9π units2
D. 324π units2


Answers

option D is the answer.!!!!

Answer:

324π units²  (Answer D)

Step-by-step explanation:

The formula for the area of a circle of radius r is A = πr².

Here, the area is A = π(18 units)² = 324π units²  (Answer D)

The period of this function is



π / 4

8



π / 2

Answers

ANSWER

[tex]\frac{\pi}{2} [/tex]

EXPLANATION

The period refers to the interval over which the function completes one full cycle.

The given function completed four cycles in on the the interval.

[-π,π]

The period is

[tex] = \frac{\pi - - \pi}{4} [/tex]

[tex]= \frac{\pi + \pi}{4} [/tex]

Simplify;

[tex]= \frac{2 \pi}{4} [/tex]

[tex]= \frac{\pi}{2} [/tex]

The last choice is correct.

If a certain negative number is multiplied by six, the result is the same as 20 less than the original number. What is the value of the original number?

Answers

let the number be X 6X=X-20X+6X=20-5X=20X=-4

Final answer:

The original negative number in the problem is found by setting up the equation 6x = x - 20 and solving for x, which results in the original number being -4.

Explanation:

If a certain negative number is multiplied by six, the result is the same as 20 less than the original number. To solve for the original number, we can set up an equation based on the given condition. Let's assume the original number is x.

According to the problem, 6 times x equals x subtracted by 20:

6x = x - 20

To solve for x, we'll first move all terms involving x to one side of the equation by subtracting x from both sides:

6x - x = -20

This simplifies to:

5x = -20

Now, divide both sides by 5 to isolate x:

x = -20/5

x = -4

Therefore, the value of the original number is -4.

What is the degree of x 6 + 4x – 3?

Answers

Answer:

The degree of a polynomial is the highest degree of its monomials with non-zero coefficients

Step-by-step explanation:

not sure

The maximum power of the polynomial x⁶ + 4x - 3 that is degree will be 6.

What is a polynomial?

A polynomial expression is an algebraic expression with variables and coefficients. Unknown variables are what they're termed. We can use addition, subtraction, and other mathematical operations. However, a variable is not divisible.

A polynomial's degree is the greatest exponent of its variable term. The variable in this example is x, and the maximum exponent of x is 6, which is the degree of the polynomial. As a result, the polynomial x⁶ + 4x - 3 has a degree of 6.

More about the polynomial link is given below.

https://brainly.com/question/17822016

#SPJ3

The vertex form of the equation of a parabola is y= 3(x - 4)^2 -22. What is the standard form of the equation

Answers

Answer:

option A

Step-by-step explanation:

We can find the standard form by expanding the equation:

y = 3(x-4)^2 - 22

y = 3(x^2 - 8x + 16) - 22

y = 3x^2 - 24x + 48 - 22

y= 3x^2 - 24x + 26

So the correct option is option A

Answer:

option A) y= 3x²-24x+26 ~apex

Step-by-step explanation:

Someone please help??

Answers

Answer:

Not 100% sure but i will say (B)

Step-by-step explanation:

Answer:

It is not a real number.

Step-by-step explanation:

Let f(x)= cos(2x) +e^(-x). for what value of x on the interval (0,3) will f have the same instantaneous rate of change as the average rate of change of f over the interval?

Answers

[tex]f(x)[/tex] is continuous on [0, 3] and differentiable on (0, 3), so the mean value theorem applies here. It says that there is some [tex]c[/tex] in the open interval (0, 3) such that

[tex]f'(c)=\dfrac{f(3)-f(0)}{3-0}[/tex]

We have

[tex]f'(x)=-2\sin2x-e^{-x}[/tex]

so

[tex]-2\sin2c-e^{-c}=\dfrac{\cos6+e^{-3}-2}3\implies c\approx1.5418[/tex]

Which of the following conclusions can be made based on the scatterplot shown below?



A.) There is a positive correlation between plant growth and the time spent in light.
B.) There is a negative correlation between plant growth and the time spent in light.
C.) There is no correlation between plant growth and the time spent in light.

Answers

A) There is a positive correlation between plant growth and the time spent in light.

Hope this helps chu

Have a great day

The correlation coefficient helps us to know how strong is the relation between two variables. The correct option is A.

What is the correlation coefficient?

The correlation coefficient helps us to know how strong is the relation between two variables. Its value is always between +1 to -1, where, the numerical value shows how strong is the relation between them and, the '+' or '-' sign shows whether the relationship is positive or negative.

1 indicates a strong positive relationship.-1 indicates a strong negative relationship.A result of zero indicates no relationship at all, therefore, independent variable.

Since in the given scatterplot as the value of the percent of the time the plant is exposed to light is increased there is a simultaneous growth in the height of the plant in inches.

Therefore, For the given scatterplot the conclusion that can be made is that there is a positive correlation between plant growth and the time spent in light.

Learn more about Correlation Coefficients:

https://brainly.com/question/15353989

#SPJ2

Find the coefficient of the x3y5 term of the expansion (x + y)8.

Answers

By the binomial theorem,

[tex](x+y)^8=\displaystyle\sum_{n=0}^8\binom8nx^{8-n}y^n[/tex]

The [tex]x^3y^5[/tex] term occurs for [tex]n=5[/tex]; this gives the term

[tex]\dbinom85x^{8-5}y^5=\dfrac{8!}{5!(8-5)!}x^3y^5=56x^3y^5[/tex]

so the coefficient is 56.

Lines a and b are parallel and lines e and f are parallel.





What is the value of x?

Answers

Answer:

the answer is 82

Step-by-step explanation:

The answer would be 82

Find the number of ways to listen to 4 different CDs from a selection of 15 cds?
A. 1355

B. 2730

C. 360,360

D. 32,760

Answers

Answer: letter a should be the correct answer

Step-by-step explanation:

D is the answer for this question

40 points PLEASE HURRY!!!
Noya needs to determine the number of books that will fit into a box. If the box has a length of 18 inches and each book is 2/9 of an inch thick, which expression can be used to determine the number of books that will fit into the box?
A. 18 divided by 2/9
B. 18 x 2/9
C.2/9 divided by 18
D.9/2 divided by 18

Answers

Answer:

A. 18 divided by 2/9

Step-by-step explanation:

To determine the number of boos that will fit into a box that is 18 inches long, we divide the length of the box by the length of the books

18 inches  divided by 2/9 inches per book

This tells us how many books

copy dot flip

18 * 9/2

81 books

Find the period of the function. y=3 sin x/8

Answers

Answer:

The period of given function is  [tex]Period = 16\pi [/tex]

So, Option B is correct.

Step-by-step explanation:

In this question we need to find the period of the function y= 3 sin x/8

The formula used to find period of function is: [tex]\frac{2\pi }{b}[/tex]

We need to know the value of b.

To find the value of b we compare the standard equation with the equation of function given.

Standard Equation: y = a sin(bx - c) +d

Given Equation: y= 3 sin(x/8)

Comparing we get:

a= 3

b= 1/8

c= 0

d=0

So, we get the value of b i.e 1/8. Putting it in the formula to find period of given function.

[tex]Period = \frac{2\pi }{b}[/tex]

[tex]Period = \frac{2\pi }{\frac{1}{8}}[/tex]

Solving,

[tex]Period = 2\pi *8[/tex]

[tex]Period = 16\pi [/tex]

So, the period of given function is  [tex]Period = 16\pi [/tex]

shelby's monthly periodic rate is 1.95%. what is the APR?

Answers

Monthly periodic rate = 1.95%

The APR is the annual periodic rate

The annual periodic rate is the monthly rate multiplied by 12, because there are 12 months in a year

APR = monthly periodic rate X number of months in a year

= 1.95% X 12

= 23.4%

By using the concept of Annual Periodic rate and Monthly periodic rate,

Annual periodic rate of Shelby = 23.4%

What is Annual Periodic Rate and Monthly periodic rate?

At first it is important to know about Periodic rate.

Periodic rate is the rate that can be charged on loans for a certain period.

If the periodic rate is calculated over a month then it is called monthly periodic rate.

If the periodic rate is calculated over a year then it is called Annual periodic rate.

Here,

Monthly periodic rate of Shelby = 1.95%

Annual periodic rate of Shelby = [tex]1.95 \times 12[/tex]

                                                   = 23.4%

To learn more about Annual Periodic Rate and Monthly Periodic Rate, refer to the link-

https://brainly.com/question/1649879

#SPJ2

A square has a perimeter of 12 cm. What is its area?

a. 9 cm 2
b. 18 cm 2
c. 36 cm 2
d. 144 cm 2

Answers

a. 9 cm 2 because each side would be 3 and length x width would be 3 x 3 = 9

Answer:

hello : answer : a) 9 cm 2

Step-by-step explanation:

A square has a perimeter of 12 : p = 4×c.....c is the length

12 = 4c

c = 12/4

c = 3

the area  A= c²

   A= 3² = 9  cm 2

Chucky grabbed 121212 items in the grocery store that each had a different price and had a mean cost of about \$7.41$7.41dollar sign, 7, point, 41. One of the items was an entire wheel of cheese that cost \$39.99$39.99dollar sign, 39, point, 99. [Show data] \$1.29dollar sign, 1, point, 29 \$1.92dollar sign, 1, point, 92 \$3.19dollar sign, 3, point, 19 \$3.79dollar sign, 3, point, 79 \$3.99dollar sign, 3, point, 99 \$4.79dollar sign, 4, point, 79 \$5.19dollar sign, 5, point, 19 \$5.29dollar sign, 5, point, 29 \$5.49dollar sign, 5, point, 49 \$6.75dollar sign, 6, point, 75 \$7.19dollar sign, 7, point, 19 \$39.99dollar sign, 39, point, 99 Chucky then decided to put the wheel of cheese back and only buy the other 111111 items. How will removing the wheel of cheese affect the mean and median?

Answers

Answer:

Both the mean and median will decrease, but the mean will decrease more than the median.

Step-by-step explanation:

Removing the wheel of cheese will decrease the median a little bit, because the median shifts from between two data points to the lower of the two data points:

       With the wheel of cheese, the median is the middle number, but there's no middle number in this data set! So, to find the median we take the mean of the two middle numbers, $4.79 and $5.19 which is $4.99.

       Without the wheel of cheese,

Removing the wheel of cheese will decrease the mean significantly, because the total cost will decrease by $39.99, and the number of items decreases by only 1.

Answer: B

Step-by-step explanation:

Please help ASAP!
Answer, yes or no to state whether each data set is likely to be normally distributed.

1). the number of coupons used at a supermarket

2). the weights of the pumpkins that are delivered to a supermarket

3). the number of raisins in each 8-oz box of raisins at a supermarket

4). the amount of time customers spend waiting in the checkout line at a supermarket

Answers

The selection of "Yes" or "No" to state whether each data set is likely to be normally distributed is as follows: A) No. B) Yes. C) Yes. D) Yes

What is a normal distribution of data?

A normal distribution of data occurs when the majority of data points are relatively similar and the data set has a small range of values.

1. The number of coupons used at a supermarket is no.

2. The weights of the pumpkins that are delivered to a supermarket is yes.

3. The number of raisins in each 8-oz box of raisins at a supermarket is yes.

4. The amount of time customers spend waiting in the checkout line at a supermarket is yes.

Learn more about the normal distribution of data at brainly.com/question/26217425

#SPJ2

The selection of "Yes" or "No" to state whether each data set is likely to be normally distributed is as follows: A) No. B) Yes. C) Yes. D) No

1. The number of coupons used at a supermarket is likely to follow a discrete distribution rather than a normal distribution. Customers may use 0, 1, 2, or more coupons, but the number of coupons used is not continuous and typically has a lower bound of 0. The distribution may be skewed to the right with a large number of transactions involving no coupons and a decreasing frequency as the number of coupons increases.

2. The weights of pumpkins are likely to be normally distributed because they are a result of many different factors, such as genetics, soil quality, water intake, etc., which tend to produce a bell-shaped curve when combined. This is an example of a continuous measurement that can be modeled well with a normal distribution.

3. The number of raisins in each 8-oz box is likely to be normally distributed due to the central limit theorem. Although the distribution of raisins per box might be uniform or have some other distribution, when the sample size (number of raisins per box) is large, the distribution of the sample mean (total number of raisins in many boxes) will approach a normal distribution. Since an 8-oz box contains a large number of raisins, the count in each box should be approximately normal.

4. The amount of time customers spend waiting in the checkout line is likely not to be normally distributed. This is because the waiting time is bounded below by zero and may have an upper limit depending on the store's operating hours or customer patience. The distribution of waiting times is often skewed to the right, with many customers experiencing short waits and a few experiencing longer waits. This results in a distribution with a long tail on the right side, which is not characteristic of a normal distribution.

Other Questions
Brian is a truck driver who delivers products throughout Massachusetts. His friend Chris is a traffic planner for the same state. Which best explains how their careers might intersect?-Chris designs models to make traffic flow better, which enables Brian to get to his companys warehouse faster.-Brian delivers products to stores and elsewhere, which enables Chris to buy food and other items for his family.-Brian only uses low-traffic routes to deliver products from the maps Chris creates.-Chris creates models to make traffic flow better, which helps Brian deliver products to customers faster. What are intrinsic controls also called A)homozygous B)externalC)localD)none of the above plz help 5 star reating and a thanks if someone help What happens to an oxidizing agent during a redox reaction? Need help as soon as possible! The length of a rectangle is 4 times its width. The rectangle's width is 8 m. What is the area of the rectangle? Enter your answer in the box. _______m2 The scatter plot and table show the number of grapes and blueberries in 10 fruit baskets. When you use the two data points closest to the line, which is the equation of the regression line?A.y = 2/3x + 1/3 B.y = 2/3x - 8/3 C.y = 7/24x + 7/3 D.y=7/24x + 13/6 What is a benefit of a person borrowing money to start a business? Some1 help me out on this And if you cant just give me your best opinionWhen reading a text, which of the following is usually a sign that an object is a symbol?Characters pay a lot of attention to the object(s). The object is always mentioned in a song. The object is only mentioned once in passing. The object is never mentioned. What is the length of the third side of the window frame below?(Figure is not drawn to scale.)A picture of a right triangular window frame is shown. The longest side has length labeled as 39 inches. The height of the frame is labeled as 36 inches. 15 inches 27 inches 25 inches 32 inches What were the goals/policies of the Johnson administration and how did they impact the nation Which statements describe the use of gamma rays to treat cancer? Check all that apply.Gamma rays have low energy and a source must be placed in the body.Gamma rays are absorbed by only the cancer cells.High-energy gamma rays are directed at a tumor from outside of the body.Gamma rays kill cancer cells in a tumor.Gamma rays are applied to a large area of the body. Jane entered her artworks in a state competition. Her art scores from 7 judges are listed. 9,9,8,7,9,6,8 what is Janes mean score? A.6 B.7 C. 8 D.9 When you use the distance Formula you are building a right triangle whose ____ connects two given points.... I NEED HELP ASAP I WILL GIVE BRAINLIST !!!!!!!!!Assignment water and oceans graphic organizer exploration k12 1. Where does the energy that causes evaporation come from2. What role does gravity play in the water cycle?3. Describe the flow of one molecule of water through the water cycle, beginning in the ocean. suppose that one student is randomly selected during lunch time. what is the experimental probability if students the brought lunch from house is 55 and students that order school lunch is 45 Which two of these sentences are in passive voice if dy/dt=-10e^-t/2 and y(0)=20 what is the value of y(6) A land rush happened in Oklahoma in the 1890s thanks to the discovery of which mineral? A. gold B. gypsum C. lead D. zinc Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct