Answer:
form a nearly continuous belt
Explanation:
When the landmasses of the British Isles and Scandinavia are fitted together, mountain chains and rock types form a nearly continuous belt.
Answer:
form a nearly continuous belt
Explanation:
Secondary pollutants are more harmful than primary pollutants.
The statement is generally true: secondary pollutants are often more harmful than primary pollutants.
Primary pollutants are substances that are directly released into the environment from human activities or natural sources. These pollutants include emissions from vehicles, industrial processes, and natural events like volcanic eruptions. While primary pollutants can have detrimental effects on human health and the environment, they are usually present in relatively high concentrations near their sources and can be easier to identify and control.
On the other hand, secondary pollutants are not directly emitted but are formed through chemical reactions involving primary pollutants and other atmospheric components. These reactions occur in the atmosphere under specific conditions, such as sunlight, temperature, and the presence of other reactive substances. Examples of secondary pollutants include ground-level ozone (formed from the reaction of nitrogen oxides and volatile organic compounds), smog, and some forms of particulate matter.
Secondary pollutants are often more harmful than primary pollutants for several reasons. Firstly, they can be present in lower concentrations, making them harder to detect and control. Their formation is dependent on specific atmospheric conditions, which can vary spatially and temporally, leading to localized and unpredictable exposure. Secondly, secondary pollutants can have more adverse health effects due to their chemical properties. For example, ground-level ozone is a strong respiratory irritant and can contribute to respiratory problems and other health issues. Thirdly, secondary pollutants can persist in the atmosphere for longer periods, leading to the potential for long-range transport and widespread impacts.
While the general statement holds true, it is important to note that the harm caused by pollutants depends on various factors, including their concentration, duration of exposure, individual susceptibility, and the specific pollutant in question. Nevertheless, the formation and presence of secondary pollutants can contribute significantly to the overall environmental and health risks associated with air pollution.
To learn more about pollutants, here
https://brainly.com/question/29594757
#SPJ6
muscle fatigue causes
Answer:
Weakness/soreness in the muscles
Name any 3 methods of irrigation and briefly describe them.
Nutrients can also be provided through irrigation to the crops. The different sources of water for irrigation are wells, lakes, ponds, canals, tubewells and even dams.
What is irrigation?Irrigation is defined as the process of applying water to the crops artificially to realize their water requirements.
The three important methods of irrigation are sprinkler, surface, and drip/micro.
Water flows over the soil by gravitation force for surface irrigation. Sprinkler irrigation, also known as spray irrigation, is a means of dispensing water in a regulated manner, comparable to rainfall. Pumps, valves, pipes, and sprinklers may be used to disperse the water. Irrigation sprinklers can be used in a variety of settings, including residential, industrial, and agricultural.Drip irrigation entails laying tubing with emitters next to the plants on the ground. The emitters trickle water into the root zone of the soil slowly. Plant production and quality improve as moisture levels are maintained at an appropriate level.For more information regarding irrigation, visit:
https://brainly.com/question/903241
#SPJ2
some examples of lipids are cellulose and fiber. true or false
Answer:
Fast Facts: Lipids
A lipid is any biological molecule that is soluble in nonpolar solvents.Lipids include fats, waxes, fat-soluble vitamins, sterols, and glycerides.Biological functions of lipids include energy storage, cell membrane structural components, and signalingThere are many different types of lipids. Examples of common lipids include butter, vegetable oil, cholesterol and other steroids, waxes, phospholipids, and fat-soluble vitamins. The common characteristic of all of these compounds is that they are essentially insoluble in water yet soluble in one or more organic solvents.
False
Question 15 (5 points)
In____bonding positively charged metallic ions are surrounded by a cloud of electrons.
ionic
covalent
triple
metallic
Answer:
Metallic bonding
In metallic bonding positively charged metallic ions are surrounded by a cloud of electrons.
Which other technology would most directly help the survival of such an expanding population
Answer:
A system for growing food without using much land
Explanation:
Please mark brainliest and have a great day!
The given question is incomplete. The complete question is.
A country that has been relatively poor is starting to become wealthier. This has brought many people into the capital city, causing the population to grow very rapidly. Many new apartment buildings, as well as water and waste management systems, are being constructed to meet their living needs.
Which other technology would be a priority for the survival of such an expanding population?
A. Better communication systems
B. Structures for growing food in or near cities
C. Modern recreational facilities
D. New methods of public transportation
Answer: Option B
Explanation:
The technology that an help in the surviving of the expanding population is structure that can grow food in or near the cities.
The basic needs of the human beings is food, space and other necessary resources.
These resources cannot be avoided and needs to be fulfilled. The lack of space and other resources is completed excluding the food.
So, there is a need of structure which can grow food in the cities or somewhere else.
Which is a function of nucleic acids
Answer:
Nucleic acids are important because they make up genetic information in living things. There are two types of nucleic acid and they are DNA and RNA. DNA is the basic instructions for living things. It is passed down from parent to offspring and is found in the nucleus of the cell.
Explanation:
Answer:
store genetic information
Explanation:
Which sequence represents a cross section of the bilayer
A hydrophilic head, hydrophobic tail, hydrophobic tail, hydrophilic head
B hydrophobic tail, hydrophilic head, hydrophobic tail, hydrophilic head
c hydrophobic head, hydrophilic tail. hydrophilic tail, hydrophobic head
D hydrophilic tail, hydrophobic head, hydrophobic head, hydrophilic tail
The answer you are looking for is a
What is the most likely explanation for how speciation occurs
Answer:
when populations of a species that share the same habitat become reproductively isolated from each other.
Explanation:
Answer:
Natural selection is one explanation how speciation occurs.Explanation:
Natural selection is a key mechanism of evolution, in which survival and reproduction differences affects the evolution process.
It's important to say that Natural Selection is related with only phenotype's act, because it's due to environmental changes, adapting to those variables in order to survive.
Which statement about natural selection is true?
A.
Natural selection and evolution are two terms for the same phenomenon.
B.
Natural selection is an outdated theory to explain how evolution took place.
C.
Natural selection is the process by which organisms with more beneficial traits are more likely to survive and reproduce.
D.
Natural selection is the process by which organisms develop variation in traits, which gives them a better chance of survival.
The answer is C. Natural selection is about ones traits being better than another’s which allow it to survive in the wilds longer.
Answer:
C.
Natural selection is the process by which organisms with more beneficial traits are more likely to survive and reproduce
Explanation:
Natural selection is a driving force for evolution that operates of genetic variations. The individuals with beneficial genetic traits are able to survive and reproduce more as compared to the other individuals with no beneficial traits.
This differential reproductive and survival rate of organisms due to adaptive genetic traits is called natural selection.
Which two protists evolved from a symbiotic relationship of organisms, which resulted in eukaryotic organisms containing chloroplasts?
The protist which evolved from the endo-symbiotic relationship is Euglena and green algae.
Endosymbiosis is the phenomenon of engulfing one organism which can live in a symbiotic relationship within. it has deeply impacted the evolution of life.
The correct answer is Endosymbiosis and protist.
What is the endosymbiotic process?
The symbiotic relationship in which one organism lives with the other is called endosymbiosis. Primary endosymbiotic refers to the early internalization of prokaryotes by eukaryotic progenitor cells, leading to the formation of mitochondria and chloroplasts.
Belongs to diverse taxonomic groups, especially unicellular, sometimes colonial, or, more rarely, multicellular, usually protozoa, most algae, and often some fungi (such as slime). ), Which belongs to the kingdom of eukaryotes (protozoa, synonymous with Protoctista).
Learn more about Endosymbiosis here: https://brainly.com/question/1698852
#SPJ2
PLEASE HELP THIS IS URGENT!
Which chemical is most important in telling a plant when to flower?
phytochrome
nitrogen
carotenoid
chlorophyll
The chemical that is most important in telling a plant when to flower is phytochrome.
Which chemical is most important in telling a plant when to flower?Phytochrome is a blue-green pigment found in many plants, which regulates various developmental processes.Phytochrome is widely distributed in the plant kingdom. Although green leaves are the organs, which perceive daylight most effectively, their phytochrome content is very low. For this reason, most studies with phytochrome have used etiolated seedlings from which phytochrome has been obtained in highly purified form.The light receptors of plants are Phytochrome Red and Phytochrome Far Red. They are both color pigments found in leaves. They are chemically reactive and absorb red light at specific wavelengths. This chemical reaction tells the plant whether to continue vegetating or flowering.Hence, the phytochrome chemical is most important in telling a plant when to flower.
To learn more about phytochrome chemical, refer to: https://brainly.com/question/13048818
#SPJ2
Give examples of selective advantage of organism’s body part/organ
Answer:
The characteristic of an organism that enables it to survive and reproduce better than other organisms in a population in a given environment; the basis for evolution by natural selection.
Explanation:
Enzymes are proteins that speed up reactions by
providing an additional energy source
supplying additional molecules for the reaction
removing inhibitors that slow down reactions
lowering the amount of energy required
Answer,
D/Lowering the amount of energy required.
Which characteristics belong to a eukaryote
Seeds can grow into which of the following types of plants? A. Angiosperms and gymnosperms B. Angiosperms and ferns C. Gymnosperms and mosses D. Gymnosperms and liverwort
Angiosperms and gymnosperms that seed can grow.
Option: A
Explanation:
Angiosperms, that are also known as flowering plants, have “seeds” that are sealed off within an “ovary”, while gymnosperms do not have fruits or flowers and have uncovered seeds on the surface of leaves. Seeds of gymnosperms are often arranged as “cones”. The features and characteristics that distinguish angiosperms from gymnosperms are fruits, flowers, and “endosperm” in the seeds. Examples of “Angiosperms” are “monocots” like orchids, lilies, agaves, grasses and dicots like, peas, roses, sunflowers, maples and oaks. “Gymnosperm” examples include “non-flowering evergreen” trees like pine, fir and spruce.
A food web in a rain forest is shown below. Which of the following most likely occupies the location marked X in this food web?
A. decomposers
B. primary consumers
C. producers
D. secondary consumers
E. abiotic factors
When a human or animal consumes food, the carbon in that food is most likely to be converted into which of the following elements?
a. carbon remains carbon
b. nitrogen
c. oxygen
d. hydrogen
Answer:
The answer is A
Answer:
a. Carbon remains carbon
Explanation:
Halogens are destructive to ozone because they are highly reactive with oxygen. Please select the best answer from the choices provided T F
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Light sensitivity in euglena is provided by the _____.
Answer:
Light sensitivity in euglena is provided by the eyespot.
The study of DNA provides evidence that all living things are related through
evolution by showing that all species
Answer:
it's d has the same genes
The answer is option B - The study of DNA provides evidence that all living things are related through evolution by showing that all species read the genetic code in the same way.
All species read the genetic code in the same way, indicating a common ancestry and supporting the theory of evolution.
The study of DNA provides substantial evidence that all species are related through evolution by showing that all species read the genetic code in the same way. This is apparent from the universal use of the same set of genetic instructions across different forms of life, demonstrating a common ancestry. By comparing genetic sequences, scientists have mapped out the relationships among various species, constructing what is known as the "tree of life."
This tool illustrates the connections between organisms, with many sharing significant genetic traits and DNA sequences, such as humans and chimpanzees sharing about 98% of their genes, indicating a recent common ancestor.
What is a major drawback of using fossil fuels?
A. They warm the planet
B. They are flammable
C. they release oxygen when burned
D. They contain no greenhouse gases
Answer:
A, they warm the planet
The chemical reactions that cells use to acquire and use energy to live, grow an reproduce are called
Metabolism refers to all of the chemical reactions occurring within cells that allow them to acquire and use energy, categorized into catabolic and anabolic pathways. Catabolic reactions break down complex molecules, releasing energy, while anabolic reactions build complex molecules and require energy.
Explanation:The chemical reactions that cells use to acquire and use energy to live, grow, and reproduce are collectively called metabolism. Metabolism encompasses all of the biochemical processes that take place within cells, which can be broadly categorized into two main types: catabolic and anabolic pathways. Catabolic pathways are the metabolic reactions that break down complex molecules into simpler ones, releasing energy in the process. On the other hand, anabolic pathways construct complex molecules from simpler ones and require an input of energy. These metabolic pathways are part of a larger field known as bioenergetics, which is concerned with the flow of energy through biological systems. Overall, metabolism maintains the cell's energy balance through the interplay of catabolic and anabolic reactions.
Final answer:
Cellular metabolism refers to all the chemical reactions in cells that are essential for acquiring and utilizing energy needed for survival, growth, and reproduction. It includes both energy-releasing catabolic reactions and energy-consuming anabolic reactions, all of which are regulated by enzymes within the realm of bioenergetics.
Explanation:
Cellular metabolism is the term used to describe the collection of chemical reactions that occur within cells to acquire and use energy necessary for the cells to live, grow, and reproduce. This encompasses a wide array of processes that include both catabolic reactions, which break down molecules to release energy, and anabolic reactions, which build up complex molecules requiring energy. Under the umbrella of bioenergetics, these reactions are crucial for energy flow through living systems and are regulated by enzymes to ensure the cell can function properly.
Understanding cellular metabolism is essential because it is the biochemical basis of life for all organisms. Whether a cell is taking in nutrients, synthesizing new components, or mobilizing energy reserves, it is the metabolic reactions that make these life-sustaining activities possible. Overall, cellular metabolism is a dynamic network of interconnected chemical reactions that are fundamental to biological systems.
The inside of a membrane bilayer is
Answer:
hydrophobic
Explanation:
the hydrophobic ends which is "water fearing" faces inwards so that it does not interact with the water or liquid outside the membrane
Answer:
The correct answer will be- hydrophobic
Explanation:
The plasma membrane of a cell is composed of lipids commonly called phospholipids.
The phospholipid structure contains a hydrophilic head and a hydrophobic tail.The phospholipids in a plasma membrane are arranged in two layers called bilayer.
Bilayer contains the hydrophilic head faces the external environment whereas the hydrophobic tail composed of fatty acids is present inside and provide hydrophobic character to the layer.
Thus, inside the membrane is hydrophobic.
The land biomes are named for their
A. Large animals?
B. Predominant vegetation
C. Average climate
D. Physical location
Predominant vegetation
11. What's a recharge area?
A. The part of an aquifer where groundwater meets a lake or stream
B. The part of an aquifer where surface water reaches the water table
C. The part of an aquifer that's located between two aquicludes
D. The part of an aquifer that's located at a lower elevation
Answer:
B. The part of an aquifer where surface water reaches the water table
Explanation:
The recharge area of an aquifer, is the area where the aquifer comes in touch with the surface water. At this area, the aquifer is receiving new and fresh water reserves from the surface, thus replenishing the water that it has lost. Most of this water comes from the rainfall and runoff, though rivers and streams can also contribute to it. The recharging of the aquifer is crucial for its existence, as it constantly loses water, and the recharging in giving back water to it, thus balancing the lost and gained water in it.
Answer:
B
Explanation:
How do the chloroplasts help the sea slug
Answer:
It allows the slug to capture energy directly from light, just like a plant would do through photosynthesis. Also, if the slug does't have it's normal food supply, Chloroplast can help the Sea Slug to survive for months.
Explanation:
When a scientist is conducting research about all the plants and wildlife in the Mojave Desert as well as the desert’s resources, such as water and soil, the scientist is studying
Answer:
ecosystem
Explanation:
In this case, we have a situation where the scientist is describing an ecosystem. The ecosystem represents all the living organisms (flora and fauna), their environment, and the interactions that they all have between each other. In this case, we have the plants and animals being described, thus the flora and fauna, as well as the water and soil, thus their environment, so we have description of an ecosystem, or more specifically, the desert ecosystem of the Mohave Desert.
Answer:
an ecosystem
Explanation:
What state best describes natural selection
Answer:
Louisianna
Explanation:
Providing immunity by injecting the body with a weakened form a pathogen is known as
Answer:
vaccination
Explanation:
The vaccination has been one of the most revolutionary inventions in the medical field. This invention helped protect people from numerous diseases, some being totally neutralized, while some having only minor effects on the human body. The vaccination basically is a way of enhancing the immune system of the body by injecting in it a weakened form of the pathogen. In this way, the weakened form of the pathogen is not capable to harm the body, and the body is not fighting against it, but instead the pathogen becomes part of the body and its defense mechanism, so when the pathogen strikes, the body has a counter attack and defeats it.
Answer:
vaccination
Explanation: