What is 927 divided by 9

Answers

Answer 1

Answer:103

Step-by-step explanation:

Answer 2
the answer for this question is 103

Related Questions

The figure on the left represents a scale drawing of the figure on the right. What is the scale?

Answers

Answer:

[tex]\frac{1}{90}[/tex]

Step-by-step explanation:

Before calculating the scale we require the dimensions to be in the same units.

Using the conversion

1 yard = 3 ft and

1 foot = 12 inches, then

5 yards = 5 × 3 × 12 = 180 inches

The scale is then

2 in : 180 in ← divide both quantities by 2

= 1 : 90

= [tex]\frac{1}{90}[/tex]

The scale of the drawing given is 1/90

Using the following conversion :

1 yard = 3 feets 1 feet = 12 inches

This means that ;

1 yard = 12 * 3 = 36 inches

Then ;

5 yards = 36 * 5 = 180 inches

Relating the expression :

2 inches = 180 inches

divide both sides by 2

1 inch : 90 inches

Hence, the scale is 1 /90

Learn more on scale drawing : https://brainly.com/question/810373

#SPJ2

In circle A, arc CD is congruent to arc BD. What is the measure of arc CD?


90
180
45

Answers

Check the picture below.

The measure of arc CD of circle A will be 90°. Then the correct option is A.

What is the arc length of the sector?

Let r be the radius of the sector and θ be the angle subtended by the sector at the center. Then the arc length of the sector of the circle will be

Arc = (θ/2π) 2πr

In circle A, arc CD is congruent to arc BD. And we know that the Line segment CAD is the diameter of the circle. Then the equation is given as,

arc CD = arc BD                           ....1

arc CD + arc BD = 180°                ....2

From equations 1 and 2, then we have

arc CD + arc CD = 180°

2 arc CD = 180°

arc CD = 90°

The measure of arc CD of circle A will be 90°. Then the correct option is A.

More about the arc length of the sector link is given below.

https://brainly.com/question/15955580

#SPJ2

Write equivalent fractions to 2.5

Answers

Answer:

5/2 or 2 1/2

Step-by-step explanation:

You can buy school uniforms though an online catalog.Boys can order either navy blue or khaki pants with a red,white,or blue shirt.How many uniform combinations are there online for boys ​

Answers

Answer:

6 combinations

Step-by-step explanation:

Pants options: Navy Blue, Khaki

Shirt options: Red, white, blue

Possible combinations:

Navy Blue with:       Khaki with:

Red                           Red

White                        White

Blue                           Blue

There are 6 outfit possibilities

Hope this helps and let me know if you have any questions about my answer :)

the answer to your question is 6

When Luis begins painting, he realizes it takes him 45 seconds to complete 1 square foot. The room he is painting has 272 square feet. How many seconds will it take Luis to complete the project? Now, convert this to minutes?

Answers

It will take Luis 12240 seconds to complete the project.

12240 seconds are 204 minutes when converted.

Step-by-step explanation:

Given,

Time taken to paint 1 square foot = 45 seconds

Time taken for 272 square feet = 45*272

Time taken for 272 square feet = 12240 seconds

We know that;

60 seconds = 1 minute

Therefore;

We will divide the total seconds by 60 to convert them into minutes.

12240 seconds = [tex]\frac{12240}{60} = 204\ minutes[/tex]

It will take Luis 12240 seconds to complete the project.

12240 seconds are 204 minutes when converted.

Keywords: conversion, multiplication

Learn more about multiplication at:

brainly.com/question/10546617brainly.com/question/10552347

#LearnwithBrainly

Steve gets $100 a week, plus 15% of sales. Which equation best represents his salary?

A.) y = 100x + 0.15

B.) y = 0.15x + 100

C.) y = -0.15 x + 100

D.) y = -100x +0.15

Answers

It would be b since the amount of sales he makes represents how much money he gets

Answer y = 0.15x + 100

Step-by-step explanation:

please help asap will give brainliest

Answers

1) a = 3189 b = 5
2) a = 53 b = -5

Answer:

1) a = 3189 b = 5

2) a = 53 b = -5

Step-by-step explanation:

Braden jumped
9 5/16 feet in the long jump. jordan jumped 8 7/8 feet. how much farther did braden jump than jordan?

the options were
A. 7/16 of a foot
B. 9/16 of a foot
C. 1 7/16 of a foot
D. 1 9/16

Answers

Option A: 7/16 of a foot is the right answer

Step-by-step explanation:

Given

Length of Braden's Jump = [tex]9\frac{5}{16} = \frac{149}{16}[/tex] feet

Length of Jordan's Jump = [tex]8\frac{7}{8} = \frac{71}{8}[/tex]

In order to find how much farther Braden jumped than Jordan

[tex]=\frac{149}{16} - \frac{71}{8}\\=\frac{149-142}{16}\\=\frac{7}{16}[/tex]

Braden jumped 7/16 feet farther than Jordan

Hence,

Option A: 7/16 of a foot is the right answer

Keywords: Fractions, measurements

Learn more about fractions at:

brainly.com/question/12980258brainly.com/question/12980528

#LearnwithBrainly

Final answer:

By converting Jordan's jump to sixteenths and subtracting it from Braden's, we determine that Braden jumped 9/16 of a foot farther than Jordan. The correct answer is option B.

Explanation:

The question involves finding out how much farther Braden jumped than Jordan. To solve this, we subtract Jordan's jump length from Braden's jump length. Braden jumped 9 5/16 feet, and Jordan jumped 8 7/8 feet.

First, we need to find a common denominator to subtract the fractions. The common denominator for 16 and 8 is 16. Convert Jordan's jump to sixteenths: 8 7/8 equals 8 14/16.

Now, subtract Jordan's jump from Braden's: 9 5/16 - 8 14/16 = 1 - 9/16. Braden jumped 9/16 of a foot farther than Jordan.

So the correct answer is option B. 9/16 of a foot.

6th grade math, assignment attached

Answers

1. B
2. A
3. B
4. D
5. A
6. C
7a. 9c+5=104
7b. $104 is about $105. Subtracting $5 from this gives you $100 gives you $100. 9 is about 10 and 100/10 is 10. So, Ticket price is ABOUT $10.
7c. $11

Mrs.Rome has 2/3 of a pan of lasagna left after dinner she wants to divide the leftover lasagna into 4 equal servings what fraction of the original pan does each serving represent

Answers

[tex]\frac{1}{6}[/tex] of the original pan represents each serving

Solution:

Given that,

Mrs.Rome has 2/3 of a pan of lasagna left after dinner

She wants to divide the leftover lasagna into 4 equal servings

2/3 is divided into 4 equal servings

Therefore,

[tex]1\ equal\ serving = \frac{\frac{2}{3}}{4}\\\\1\ equal\ serving = \frac{2}{12} = \frac{1}{6}[/tex]

Thus [tex]\frac{1}{6}[/tex] of the original pan represents each serving

Write the following sentence using mathematical symbols.
Twice the difference of x and 3 is greater than the reciprocal of 14.

Answers

Answer:

[tex]2(x - 3)\: >\: \frac{1}{14}[/tex]

Step-by-step explanation:

The difference of x and 3 is given as:

x-3

Twice the difference of x and 3 becomes:

2(x-3)

The reciprocal of 14 is

[tex] \frac{1}{14} [/tex]

Twice the difference of x and 3 is greater than the reciprocal of 14 then becomes

[tex]2(x - 3)\: >\: \frac{1}{14} [/tex]

The following data represent the number of people aged 25 to 64 years covered by health insurance (private or government) in 2018. Approximate the mean and standard deviation for age.
Age: 25-34. 35-44. 45-54. 55-64
Number 22.1. 31.5. 37.7. 25.3
(Millions)

Answers

The approximate mean age is [tex]\(45.15\)[/tex] years, and the approximate standard deviation for age is [tex]\(9.22\)[/tex] years, both rounded to two decimal places.

To approximate the mean and standard deviation for the age groups provided, we can calculate the weighted average based on the midpoint of each age group and use the formula for the standard deviation of a weighted dataset.

First, calculate the midpoints of the age groups:

- For 25-34 years: midpoint = (25 + 34) / 2 = 29.5

- For 35-44 years: midpoint = (35 + 44) / 2 = 39.5

- For 45-54 years: midpoint = (45 + 54) / 2 = 49.5

- For 55-64 years: midpoint = (55 + 64) / 2 = 59.5

Next, calculate the weighted mean using the formula:

[tex]\[ \text{Weighted Mean} = \frac{\sum (\text{Midpoint} \times \text{Number of People})}{\sum \text{Number of People}} \][/tex]

[tex]\[ \text{Weighted Mean} = \frac{(29.5 \times 22.1) + (39.5 \times 31.5) + (49.5 \times 37.7) + (59.5 \times 25.3)}{22.1 + 31.5 + 37.7 + 25.3} \][/tex]

[tex]\[ \text{Weighted Mean} \approx \frac{651.45 + 1244.25 + 1867.35 + 1503.35}{116.6} \][/tex]

[tex]\[ \text{Weighted Mean} \approx \frac{5266.4}{116.6} \][/tex]

[tex]\[ \text{Weighted Mean} \approx 45.15 \text{ years (approx)} \][/tex]

Now, calculate the standard deviation using the formula:

[tex]\[ \text{Weighted SD} = \sqrt{\frac{\sum (\text{Number of People} \times (\text{Midpoint} - \text{Weighted Mean})^2)}{\sum \text{Number of People}}} \][/tex]

[tex]\[ \text{Weighted SD} = \sqrt{\frac{(22.1 \times (29.5 - 45.15)^2) + (31.5 \times (39.5 - 45.15)^2) + (37.7 \times (49.5 - 45.15)^2) + (25.3 \times (59.5 - 45.15)^2)}{116.6}} \][/tex]

[tex]\[ \text{Weighted SD} \approx \sqrt{\frac{9919.575}{116.6}} \][/tex]

[tex]\[ \text{Weighted SD} \approx \sqrt{85.004} \][/tex]

[tex]\[ \text{Weighted SD} \approx 9.22 \text{ years (approx)} \][/tex]

For more such questions on approximate mean

https://brainly.com/question/29762639

#SPJ3

The difference of the square of a number and 4 is equal to 3 times that number. Find the negative solution.

Answers

Final answer:

The negative solution to the equation x² - 3x - 4 = 0 is x = -1.

Explanation:

The difference of the square of a number and 4 is equal to 3 times that number. To find the negative solution, let's represent the number as x.

The equation becomes x2 - 4 = 3x.

Rearranging the equation, we get x2 - 3x - 4 = 0.

To find the negative solution, we can use the quadratic formula: x = (-b - √(b2 - 4ac)) / (2a).

For our equation, a = 1, b = -3, and c = -4. Plugging these values into the quadratic formula, we get x = (-(-3) - √((-3)2 - 4(1)(-4))) / (2(1)).

Simplifying further, we get x = (3 - √(9 + 16)) / 2, which simplifies to x = (3 - √25) / 2.

The square root of 25 is 5, so x = (3 - 5) / 2, which equals -1.

Therefore, the negative solution to the equation is x = -1.

You might need:
Calculator
At an ice carving competition, each carver starts with a block of ice with the dimensions shown. The block is
wrapped in a special reflective material to keep it from melting before the competition starts.
3 ft
4 ft
How much reflective material is needed to cover the block completely, without any overlaps?
feet

Answers

Final answer:

The question cannot be fully answered as provided since only two dimensions of the ice block are given. To determine the amount of reflective material, all three dimensions (length, width, height) of the block are needed to calculate the total surface area. Without the third dimension, the exact surface area cannot be calculated.

Explanation:

The question asks how much reflective material would be needed to cover a block of ice with given dimensions completely for an ice carving competition. Since only two dimensions are provided, let's assume the block has a third dimension making it a rectangular prism. To find the surface area of the block (which is the amount of reflective material needed), we calculate the area of each face and sum them up. A rectangular prism has six faces: the front and back, the top and bottom, and the two sides. If we denote the dimensions of the block as length (l), width (w), and height (h), the areas of the respective faces are:

Front and back: l * h eachTop and bottom: l * w eachSides: w * h each

Assuming the dimensions provided are the length and height (l = 3 ft and h = 4 ft), and an unknown width (w), we cannot calculate the exact surface area without the third dimension. Ideally, the width would be provided to complete the calculation.

There are 25 students in the class. Ten students have sports practice after school. What is the ratio of students that do have practice, to those that do not?

Answers

Answer:

10/25 or 2/5

Step-by-step explanation:

since only 10 have sport as all the other students don't

what is the distance between -2/3 and 4/3 on a number line?

Answers

if from the negative to the positive side, count how many dots are in between and add together. So it is 6 units apart or 6 dots apart.

A number line can be defined as a horizontal line that can be extended and have numbers on it. The distance between -2/3 and 4/3 on a number line is 3 units.

What is a number line?

A number line can be defined as a horizontal line that can be extended in any direction indefinitely and has all the integers over it. As one walks from left to right on the number line, the numbers grow, and as one proceeds from right to left, the numbers decrease.

The distance between the two can be found by deducting -2/3  from 4/3. Therefore, the distance between the two can be written as,

[tex]\rm Distance = \dfrac{4}{3}-(- \dfrac{2}{3}) = \dfrac{4}{3}+\dfrac{2}{3} = \dfrac{4+2}{3} = \dfrac{6}{3} = 2[/tex]

Thus, the distance between -2/3 and 4/3 on a number line is 3 units.

Learn more about Number Line:

https://brainly.com/question/13189025

If 4 liters of motor oil cost 3.88 dollars, what is the price for one liter

Answers

Answer:

.97 cents

Step-by-step explanation:

3.88 divided by 4 = .97

Answer:

97¢

Step-by-step explanation:

If 4 liters cost $3.88, then divide 4 into 3.88

Write the equation of a line that passes through the point (-2, 1) and has a slope of 4.
2. All
OA. y=4x - 7
OB. y= 4x+1
OC. y= 4x+3
OD. y= 4x + 9
Question serial: 1154203447-dhwm78.2

Answers

Answer:

look at picture shown please

she wants the base length of this triangle to be 8 inches. the area of the pennant must be less than 36 square inches

Answers

Answer: The height/width has to be less than 9 for the area to be less than 36

Step-by-step explanation:

Pennant's are triangle.

Triangle area = bh(1/2)

the base is 8in

(8 * h)/2 = 36

*2

8 * h = 72

/8

h = 9

The height/width has to be less than 9

Name the restrictions on x then solve showing your steps. 2/(x-3)= 5/x

Answers

Answer:

Restrictions: x ≠ 0, 3

The value of x is equal to 5.

General Formulas and Concepts:

Pre-Algebra

Distributive Property

Algebra I

Equality Properties

Multiplication Property of EqualityDivision Property of EqualityAddition Property of EqualitySubtraction Property of Equality

Terms/Coefficients

Expanding/Factoring

Domain

Step-by-step explanation:

Step 1: Define

Identify given.

[tex]\displaystyle \frac{2}{x - 3} = \frac{5}{x}[/tex]

Step 2: Examine

Since we have an x - 3 and x in the denominator, we must make sure the denominator cannot equal 0, or that would get us an undefined answer. Therefore, our restrictions are that x ≠ 0, 3.

Step 3: Solve for x

[Multiplication Property of Equality] Cross-multiply:
[tex]\displaystyle 2x = 5(x - 3)[/tex][Distributive Property] Distribute 5:
[tex]\displaystyle 2x = 5x - 15[/tex][Subtraction Property of Equality] Subtract 5x on both sides:
[tex]\displaystyle -3x = -15[/tex][Division Property of Equality] Divide -3 on both sides:
[tex]\displaystyle x = 5[/tex]

Since 5 is not equal to 0 or 3, it can be our solution.

∴ we have found the value of x from the given rational function.

---

Topic: Algebra I

What is the answer 5(9 + p) = 125

Answers

Answer:

p=17

The drawing will help

Answer: p = 16

Step-by-step explanation: To solve for p in this equation, our first step is to simplify the left by distributing the 5 through both terms inside the parentheses.

When we do that,

we get 5 times 9 which is 45 and 5 times p which is 5p.

So we have 45 + 5p = 125.

Our next step is to isolate the p term by subtracting 45 from both sides of the equation. On the left side of the equation, 45 - 45 cancels and we're left with 5p.

On the right side of the equation, 125 - 45 simplifies to 80.

So we have 5p = 80.

We want to solve our equation for p so we want to get p by itself on the left side of the equation. Since p is being multiplied by 5, we need to divide both sides of the equation by 5. On the left side of the equation.notice that the 5 and 5 cancel each other out so we're just left with p and on the right side, 80 divided by 5 is 16 so we have p = 16.

Tamar travels 8/9 miles to the grocery store. Melkon travels 10 miles to the grocery store. Write the ratio of the distance Melkon travels to the distance Tamar travels as a fraction in simplest form. Write the ratio of the distance Tamar travels to the distance Melkon travels as a fraction in simplest form. PLZ I NEED URGENT HELP I NEED THE ANSWER

Answers

[tex]\frac{\text{Distance of melkon}}{\text{Distance of tamar}} = \frac{45}{4}\\\\\frac{\text{Distance of tamar}}{\text{Distance of melkon}} = \frac{4}{45}[/tex]

Solution:

Given that,

Tamar travels 8/9 miles to the grocery store

Melkon travels 10 miles to the grocery store

Therefore,

[tex]Tamar = \frac{8}{9}\ miles\\\\Melkon = 10\ miles[/tex]

Write the ratio of the distance Melkon travels to the distance Tamar travels

[tex]\text{ Distance of melkon : Distance of tamar } = 10 : \frac{8}{9}\\\\\text{ Distance of melkon : Distance of tamar } = \frac{10 \times 9}{1 \times 9} : \frac{8}{9}\\\\\text{ Distance of melkon : Distance of tamar } = \frac{90}{9} : \frac{8}{9}\\\\\text{ Distance of melkon : Distance of tamar } =90 : 8\\\\In\ fraction\ form\\\\\frac{\text{Distance of melkon}}{\text{Distance of tamar}} = \frac{90}{8}\\\\In\ simplest\ form\\\\\frac{\text{Distance of melkon}}{\text{Distance of tamar}} = \frac{45}{4}[/tex]

Write the ratio of the distance Tamar travels to the distance Melkon travels

[tex]\text{ Distance of tamar : Distance of melkon } = \frac{8}{9} : 10\\\\\text{ Distance of tamar : Distance of melkon } = \frac{8}{9} : \frac{10 \times 9}{1 \times 9}\\\\\text{ Distance of tamar : Distance of melkon } = \frac{8}{9} : \frac{90}{9}\\\\\text{ Distance of tamar : Distance of melkon } = 8 : 90\\\\In\ fraction\ form\\\\\frac{\text{Distance of tamar}}{\text{distance of melkon}} = \frac{8}{90}\\\\\frac{\text{Distance of tamar}}{\text{distance of melkon}} = \frac{4}{45}[/tex]

Thus the required are found

What is the relationship between cos(90°) and cos(-90°)?

Answers

Answer:

  they have the same value (0)

Step-by-step explanation:

Cosine is an even function, meaning that cos(x) = cos(-x). When x=90°, we have ...

  cos(90°) = cos(-90°)

Both values happen to be zero.

Final answer:

The relationship between cos(90°) and cos(-90°) is that they both equal 0.

Explanation:

The relationship between cos(90°) and cos(-90°) can be explained using the unit circle. In the unit circle, the cosine function represents the x-coordinate of the point on the circle corresponding to the given angle.

For cos(90°), the x-coordinate is 0, which means the cosine value is 0.

For cos(-90°), the x-coordinate is also 0, so the cosine value is also 0. Therefore, cos(90°) = cos(-90°) = 0.

if I work 2 days a week and get 8 dollars a day. How much will I make in 3 months

Answers

answer: you will make about 208 dollars in three months


If f(x)=4x 2 +5x+2, then what is the remainder when f ( x ) is divided by x + 7?

Answers

Answer:

Step-by-step explanation:

Final answer:

The remainder when the function f(x) = 4x² + 5x + 2 is divided by x + 7 is found using the remainder theorem, which gives us a result of 163.

Explanation:

To find the remainder when the function f(x) = 4x² + 5x + 2 is divided by x + 7, we can use the remainder theorem. The remainder theorem states that if a polynomial f(x) is divided by a linear divisor of the form x - r, the remainder is f(r). Here, our linear divisor is x + 7, which we can rewrite as x - (-7). So, we substitute x = -7 into the polynomial to get the remainder.

Substituting x = -7 into the function gives us:
f(-7) = 4(-7)² + 5(-7) + 2 = 4(49) - 35 + 2 = 196 - 35 + 2 = 163.

Therefore, the remainder when f(x) is divided by x + 7 is 163.

A small bottle of Dr.Pepper holds 31.2 cm^3 of the delicious drink. For a New Years Eve party, you need enough juice to fill 6 cone- shaped glasses that have a 4cm diameter and a 3 cm height. How many full bottles of Dr. Pepper do you need to buy to completely fill the 6 glasses you need?​

Answers

Approximately 3 bottles are needed to buy to completely fill the 6 glasses you need

Solution:

Given that,

A small bottle of Dr.Pepper holds 31.2 cm^3 of the delicious drink

Therefore,

[tex]Volume\ of\ small\ bottle\ of\ Dr.pepper = 31.2\ cm^3[/tex]

For a New Years Eve party, you need enough juice to fill 6 cone- shaped glasses that have a 4 cm diameter and a 3 cm height

Find the volume of cone

[tex]V = \frac{\pi r^2h}{3}[/tex]

Where, r is the radius and h is the height

Diameter = 4 cm

Radius = 4/2 = 2 cm

Height = 3 cm

Therefore,

[tex]V = \frac{3.14 \times 2^2 \times 3}{3}\\\\V = \frac{3.14 \times 12}{3}\\\\V = \frac{37.68}{3}\\\\V = 12.56[/tex]

Thus, for 6 cone shaped glasses:

Volume of 6 cone shaped galsses = 12.56 x 6 = 75.36 [tex]cm^3[/tex]

How many full bottles of Dr. Pepper do you need to buy to completely fill the 6 glasses you need?​

[tex]\text{Number of Dr.pepper bottles } = \frac{\text{Volume of 6 cone shaped galsses}}{\text{Volume of small bottle of dr pepper}}\\\\\text{Number of Dr.pepper bottles } = \frac{75.36}{31.2}\\\\\text{Number of Dr.pepper bottles } = 2.4153[/tex]

Thus approximately 3 bottles are needed to buy to completely fill the 6 glasses you need

Final answer:

To fill 6 cone-shaped glasses for a New Year's Eve party, you would need to buy 3 full bottles of Dr. Pepper. The volume of each glass is calculated using the formula for the volume of a cone, and then this volume is multiplied by 6 to find the total volume required for all glasses. The number of bottles needed is found by dividing this total volume by the volume of one bottle of Dr. Pepper.

Explanation:

To determine how many full bottles of Dr. Pepper you need to buy to fill 6 cone-shaped glasses with a 4cm diameter and a 3cm height, we need to calculate the volume of one glass and then multiply it by 6 to get the total volume required. The formula to calculate the volume of a cone is V = (1/3)πr^2h, where V is the volume, r is the radius of the base, and h is the height of the cone.

First, we find the radius of the glass by dividing the diameter by two, which yields 2cm. Plugging the values into the formula, we get:

V = (1/3)π(2^2)(3) = (1/3)π(4)(3) = 4π cm^3

Since π is approximately 3.14, we can simplify this to:

V = 4(3.14) cm^3 = 12.56 cm^3 per glass.

Now, multiplying the volume of one glass by 6 gives us the total volume needed:

Total volume = 12.56 cm^3/glass × 6 glasses = 75.36 cm^3.

To find out how many bottles of Dr. Pepper are needed, we divide the total volume by the volume of one bottle:

Number of bottles = 75.36 cm^3 / 31.2 cm^3/bottle ≈ 2.415 bottles.

Since you cannot buy a fraction of a bottle, you would need to purchase 3 full bottles of Dr. Pepper to ensure you have enough to fill all 6 glasses.

Solve for x: the quantity of x plus 16 all over 3 = 3x (1 point) x = −7 x = −13 x = 8 x = 2

Answers

The required value of x is equal to 2.

Step-by-step explanation:

We have,

[tex]\dfrac{x+16}{3}=3x[/tex]

To find, the value of x in the given equation = ?

∴ [tex]\dfrac{x+16}{3}=3x[/tex]

By crossmultiplication, we get

3(3x) = x + 16

⇒ 9x = x + 16

⇒  9x - x = 16

⇒  8x = 16

⇒  x = [tex]\dfrac{16}{8}[/tex]

⇒  x = 2

The value of x = 2

Thus, the required value of x is equal to 2.

Which of the following values are in the range of the function graphed below? Check all that apply.
A. 2
B. 1
C. 3
D. 5
E. -2

Answers

Answer:

1, 2, 3

Step-by-step explanation:

The range includes only the y-axis. On this graph, the line only passes by the 1,2, and 3 on the y-axis.

The sum of interior angles of a regular polygon is 1800
Find the measure of each interior angle of the polygon.

Answers

Answer:

The measure of each interior angle of the dodecagon is 150 degrees.

Step-by-step explanation:

(n - 2) x 180 = 1800       Use the equation to find the number of sides

n - 2 = 10                        Divide by 180 on both sides

  + 2  + 2                        Add 2 to both sides

n = 12

Take the sum of the interior angles divided by the number of sides to find the measure of each angle

1800/12 = 150 degrees for each angles of the dodecagon.

Which function has a domain of (-∞, ∞) and a range of (-3, ∞)?

Answers

Answer:

Step-by-step explanation:

The function that will have the domain [tex](\infty, \infty)[/tex] and a range of [tex](-3, \infty)[/tex] is the

function in option d.) [tex]f(x) = e^x - 3[/tex]

Other Questions
Do you guys now how to estimate 69.58. Which legal right is not given to people under age 18?A) right to an attorneyB) right to be tried as a juvenile regardless of the crimeC) right to cross examine witnessesD) right to remain silent During the 1990s worker productivity growth spiked as computers and the internet were introduced to many businesses for the first time. How did this affect the natural unemployment rate? Consider the following statement: "I examined the statistics for our basketball teams wins last year and found that, when the third team played more, the winning margin increased. If the coach played the third team more, we would win by a bigger margin." Evaluate this statement. which lands did the french imperialists claim in 1884 Which link is missing from this food chain?O decomposerO herbivoreo producerO consumer Mauricio, a project manager at a reputed firm, has been assigned to handle a new project that the firm has received. This project involves a lot of scheduling that has to be handled by Mauricio. Mauricio estimates that the first module of the project could be completed in as few as 15 days or could take as many as 25 days, but most likely will require 20 days. Determine the expected task duration. which of the following phrases would represent this expression x/3 3)A triangle has all integer side lengths and two of those sides have lengths 9 and 16. Consider the altitudes to the three sides. What is the largest possible value of the ratio of any two of those altitudes Express your answer as a balanced chemical equation. Identify all of the phases in your answer.1. Li(s)+N2(g)Li3N(s)2. TiCl4(l)+H2O(l)TiO2(s)+HCl(aq)3. NH4NO3(s)N2(g)+O2(g)+H2O(g)4. Ca3P2(s)+H2O(l)Ca(OH)2(aq)+PH3(g)5. Al(OH)3(s)+H2SO4(aq)Al2(SO4)3(aq)+H2O(l)6.AgNO3(aq)+Na2SO4(aq)Ag2SO4(s)+NaNO3(aq)7. C2H5NH2(g)+O2(g)CO2(g)+H2O(g)+N2(g) A single penny is 1.52 mm thick. The distance to the next nearest star other than our own (Alpha Centauri) is 4.22 light-years. If it were possible to stack one mole of pennies, how many times would the stack go between the earth and Alpha Centauri? Use the unit factoring method to determine the answer and show your work. You will need to find or look up the appropriate conversion factors to solve the problem. Your answer should be in scientific notation and have the correct number of significant figures in order to get full credit. (Please note that the text editing functions/buttons below for this essay question allows you to show exponents by using the button show as "x2"in the controls. To use it type the number followed by the exponent such as 104, highlight the 4 and hit the x2 button and you will end up with 104 as the result) Janelle ate 82% of the pie. What fraction of the pie remained On a public ballot, a state legislature places a question relating to legalization of marijuana for medicinal use. In addition, the legislature passes a law that bans corporations from advertising in favor of or opposing the ballot question. The basis for this ban is to ensure that corporations do not have too much influence on the voters. Is the ordinance constitutional?a.Yes, because commercial speech has only partial First Amendment protection.b.No, because it concerns a question on a public ballot.c.Yes, because the government is advancing a substantial government interest.d.No, because the ban includes advertising that may not be protected by the First Amendment.e.No, because the government has banned politically oriented commercial speech. Which of the following is true of both starch and cellulose? a. They are both polymers of glucose. b. They are geometric isomers of each other. c. They can both be digested by humans. d. They are both used for energy storage in plants. e. They are both structural components of the plant cell wall. Jennifer has been diagnosed with spinocerebellar degeneration. The first stage of the disease involves tremors and unsteady gate. In the later stages, she will be unable to stand, walk, and will be uncoordinated in her movements. This disease probably affects the __________ part of the brain.a) hippocampusb) amygdalac) cerebellumd) cerebral cortex How do the underlined words in the passage create meaning? A. They describe how Pau Amma plays. B. They describe how the animals play. C. They describe Pau Ammas impact on the sea and the animals. D. They describe the tasks the Eldest Magician gives to the animals. A paper company needs to ship paper to a large printing business. The paper will be shipped in small boxes and large boxes. Each small box of paper weighs 45 pounds and each large box of paper weighs 80 pounds. There were twice as many large boxes shipped as small boxes shipped and the total weight of all boxes was 1435 pounds. Determine the number of small boxes shipped and the number of large boxes shipped. Based on your understanding of Nectar in a Sieve, what fact would you not select as being accurate? 3x squared minus 7x minus 34 is less than or equal to -10x + 2 Ray Bond sells handcrafted yard decorations at county fairs. The variable cost to make these is $20 each, and he sells them for $50. The cost to rent a booth at the fair is $150. How many of these must Ray sell to break even