The blood passes through our body in a sytem called the circulatory system. We have a double circulatory system. Why is it called this and what are the two pathways that blood takes?

Answers

Answer 1

Answer:

We call it

Double circulation bcoz their are 3 circulation exist between heart, lungs and body organs.

EXPLANATION :

Flow of blood is left to right

1. Pulmonary circulation

Right ventricle -pulmonary artry - lungs - pulmonary veins - left artria

2. Systemic circulation

Left ventricle - systemic artry - body organs - systemic veins- right artria


Related Questions

The timely removal of crops from the field is called

Answers

Answer:

harvesting or harvest

Explanation:

The term 'timely removal of crops' refers to harvesting, but the question seems to involve practices like slash-and-burn, known as swidden or shifting cultivation, and crop rotation. These practices help maintain soil fertility and prevent nutrient depletion in agricultural areas.

However, the description provided seems to reference a variety of agricultural practices that involve clearing land for farming. One such practice is slash-and-burn agriculture, also known as swidden or shifting cultivation, where land is cleared by cutting and burning vegetation. Crops are planted for several seasons, after which the plot is left to rejuvenate while the farmer moves on to a new area. This cycle allows the soil to recover and prevents the depletion of nutrients. Another related concept is crop rotation, where the crops are changed in a particular field to prevent exhausting the soil. Rotating crops contributes to soil health and helps manage pests and diseases.

Every night before studying, Sonya has a banana. One day, she has no bananas left, so she eats a cookie. Sonya notices that she has a hard time studying. The next night, Sonya has a banana again and does not have a hard time studying. What new question would be best for Sonya to ask based on her discovery? A. Do all students study at night? B. How often do I need to study to get good grades? C. Do all types of fruit help me study? D. What are my classmates' favorite foods? (its C)

Answers

Answer: C. Do all types of fruit help me study?

Explanation: One day, she has no bananas left, so she eats a cookie. Sonya notices that she has a hard time studying. The next night, Sonya has a banana again and does not have a hard time studying. (its C)

Approximately, when was the structure of DNA first described?
1900
1950
1800
1850

Answers

It was not until 1953 that James Watson, Francis Crick, Maurice Wilkins and Rosalind Franklin figured out the structure of DNA — a double helix — which they realized could carry biological information

Answer:

1950

Explanation:

Cardiac muscle cells have a higher concentration of mitochondria than
skeletal muscle cells. What does the difference in mitochondrial
concentration MOST likely indicate about cardiac muscle cells compared
with skeletal muscle cells? (Why do they have more mitochondria?)

Answers

cardiac muscle require lot of energy to perform while skeletal muscle are used in coordinate of bone moments so they require less energy since mitochondria is powerhouse cell so it is highly concentrated in cardiac muscle...

Jack is building a model to represent the behavior of atoms in a liquid.He uses beads for his model. Which of the following best describes how jack should use the beads to show the behavior of atoms in a liquid

Answers

Answer:

wb2wna

Explanation:

Answer:

The answer is

d.The beads should be able to slide past each other

Explanation:

Based on the energy pyramind seen here, which group of organisms is the primary consumer?


A) predator fish

B) birds and mammals

C) insects and zooplankton

Answers

It would be c) insects and zooplankton

the answer is c)insects and zooplankton

How do plants reproduce?

1. Sexually
2. Asexually

Answers

Plants produce sexually by generating pollen or spores which is carried onto other plants by animals.

Some plants may also reproduce asexually, in which case the offspring will be genetically same.

Answer

Both, sexual and asexual

When the north end of Earth’s axis is tilted toward the sun, North America will experience _____.


more direct rays and shorter days


more direct rays and longer days


more indirect rays and longer days


more indirect rays and shorter days

Answers

Answer:

B

Explanation:

If the North End is tilted towards the sun, North America gets more light. More light means longer days.

Answer:

The correct answer is more indirect rays and shorter days

A ______ usually develops in the late summer over tropical waters.

A) Drought

B) Hurricane

C) Flood

D) Tornado

Answers

That is a hurricane

Hope this helps :)

Why are most of Earth's deserts located in the subtropical zone?
A. These regions receive more sunlight than the equatorial region.
B. These regions receive less sunlight than the equatorial region.
C. These regions are very warm but less humid than other regions.
D. These regions are very warm but more humid than other regions.

Answers

Most Earth's deserts are located in the subtropical zone because of atmospheric high-pressure systems that inhibit cloud formation and precipitation, leading to very dry conditions with low humidity.

The reason most of Earth's deserts are located in the subtropical zone is because of atmospheric circulation patterns and the associated high-pressure systems that exist between 15° and 30° north and south latitude. These high-pressure areas are characterized by descending dry air, which inhibits the formation of clouds and precipitation, leading to dry conditions. Furthermore, the presence of mountain ranges often leads to the formation of a rain shadow on the lee side, where deserts like the Mohave and Sonoran can be found. These geographic factors contribute to making subtropical deserts very dry because they receive  low annual precipitation. High evaporation rates and variable and unpredictable rainfall define these deserts, such as the Sahara and the Namib.

Thus, the correct answer to the student's question is C: These regions are very warm but less humid than other regions.

answer please. I beg of you​

Answers

1. D. Displacement

2. N. Speed

3. L. Acceleration

4. H. Velocity

5. E. First Law of Motion

6. I. Balanced Forces

7. B. Force

8. K. Unbalanced Forces

9. P. Friction

10. O. Second Law of Motion

11. J. Thrid Law of Motion

12. Q. Air Resistance

13. C. Rolling Friction

14. G. Sliding Friction

15. A. Static Friction

16. S. Newton

17. R. Mass

18. M. Inertia

19. T. Weight

20. F. Newton's Laws of Motion

In the nineteenth century, what was known about atoms? 

      A. The atom determines the chemical property of an element.  B. The exact structure of all atoms  C. The half-life of all atoms  D. The number of atoms that exist in the world is increasing.​

Answers

Answer:

 A. The atom determines the chemical property of an element.

Explanation:

Answer:

     A. The atom determines the chemical property of an element.

Explanation:

An atom is made up protons, electrons and neutrons. The atoms valance electrons determine its chemical properties. For example, Na has 1 valance electron. Na just like all other alkali elements lose that one outermost electron to form a cation thus gaining an octet. Because of the one valance electron, alkali elements show metallic property and other chemical properties. If an atom has an unstable nucleus then it becomes radioactive.

Which statement is true of cancer?


Mutations in certain genes cause tumors.

Tumor cells lack growth factors and DNA.

DNA mutations are unrelated to cancer.

Cancer results when cells stop dividing.

Answers

Answer:

Mutations in certain genes cause tumors.

Explanation:

gradpoint

what percent of the earth's surface is island​

Answers

Answer: Water covers 70% of the earth, so land covers 30%.

Which of the following is the correct order from simplest to most complex for the levels of organization in the human body?

Answers

Could you list the options?  Without the options, I would say it goes atom, molecule/compound, organelle, cell, tissue, organ, organ systems, organism.

Answer:

Cells, tissues, organs, organ systems

Explanation:

A veterinarian diagnoses a dog with rabies. Rabies is a viral disease in which the virus spreads through the spinal cord and nerves of an animal. Which body system does rabies affect?
A.
nervous
B.
circulatory
C.
respiratory
D.
digestive
E.
endocrine

Answers

Answer: Nervous

Explanation:

The nervous system is made of the brain, nerves and spinal cords

The correct answer would be: A) Nervous.

Rabies affects the Nervous system, spreading through nerves and the spinal cord, which spreads to the brain.

I hope this helps! :)

Have a wonderful day!

-LizzyIsTheQueen

Describe major challenges to the green environment that are caused directly or indirectly by the built environment

Answers

Answer:

this may help

Explanation:

which led to population growth during the industrial revolution

Answers

The germ theory of disease.

The answer is the germ theory of disease

As energy moves through an ecosystem,

Answers

The amount of energy becomes weaker as it transfers between organisms. This “lost energy” is dissipated in the form of heat.

My cat ate my dog alive. What do I do?

Answers

Get a new dog....................

Get a new dog and sell the cat. You don’t want the same thing to happen again! Or just wait until the cat dies then get a dog so they all can have peace! :)

In the carbon cycle, the role of plants is to

A. convert nitrogen from the soil into carbon dioxide.
B. remove carbon dioxide from the atmosphere.
C. release carbon dioxide into the atmosphere.
D. break down dead organisms into usable matter.

Answers

Answer:

The answer is  B to remove carbn dioxide from the atmospehre your welcome and i hope your happy

Explanation:

Answer:

The correct answer is option B, that is, remove carbon dioxide from the atmosphere.

Explanation:

When one studies the carbon cycle taking place on the Earth, the plants are considered as a good starting point. The plants exhibit a procedure known as photosynthesis, which allows them to take carbon dioxide from the atmosphere. The plants captivate carbon dioxide, sunlight, and water to produce their own food, develop, and discharge oxygen via the process of photosynthesis.

Name at least two specific elements of the golden toad's cloud forest habitats

Answers

The forests soil, rocks, leaf litter, humidity, plant life, and seasonal pools of water.

I apologize if this is not what you meant.

The specific elements of the golden toad's cloud forest habitats are the local trees and the presence of ponds.

What is Habitat?

Habitat may be defined as a type of natural environment for which a particular species is best adapted due to natural selection. In other words, it is the area where the basic demands of an organism are fulfilled such as food, mating partner, space, shelter, etc.

The golden toads always surround themselves with local trees. They also require water for some metabolic as well as physiologic functions, so they utilize the area of the pond that is also one of the specific elements in their habitat.

Both of these specific elements give protection as well as a fundamental stage for the golden toads to perform their natural functions.

Therefore, the specific elements of the golden toad's cloud forest habitats are the local trees and the presence of ponds.

To learn more about Habitat, refer to the link:

https://brainly.com/question/18128291

#SPJ2

Subject: Science

Would you be able to see a quasar from earth?

Answers

Answer: no

Explanation: a quasar is in the middle of our galaxy you might be able to see one if you had a very very very good telescope that could see that far

HELPPPP I NEED HELP ASAP

Answers

32. warm water bodies

The hurricanes are one of the most devastating storms in the world. They develop over warm bodies of water and then quickly lift up, full of moisture, and move. As they move quickly, they encounter cold fronts, and the collision between the two results in extremely strong winds and enormous amounts of precipitation. The end result is usually lot of damage done to the nature and the human settlements, casualties are very common unfortunately, and there's large floods.

33. warm

The thunderstorms are forming along a warm front. This type of storms is not in the category of the most dangerous ones, but it is also not a one to be underestimated. The thunderstorms form along a warm front that has gathered a lot of moisture in it. It is a quick moving, warm, moist air mass, and it manage to produce short lasting, but very heavy rainfall, and lot of thunderstorms, with the thunderstorms being particularly dangerous.

34. snowstorms

The snowstorms are type of severe weather condition that occurs in winter. This type of storm may not sound as terrifying as hurricane or a tornado, but it can be equally dangerous, occasionally even more dangerous. The snowstorms bring in very cold winds, significant drop in the temperatures, and enormous amounts of snowfall. The snow can reach several meters in height, and supported by the ice, it is capable of destroying even houses because of its weight. The electrical lines are often destroyed as well, the roads are blocked, the movement in general is almost impossible, so almost always there are casualties because of it.

35. 74 mph

The hurricanes are one of the most dangerous storms, and one of the reasons for that is the strength of the wind they produce. In order for a storm to be classified as a hurricane, it has to have a wind speed of at least 74 mph. The hurricanes are classified in 5 categories according to the wind speeds, and even though the minimum is already a very high wind speed, the highest ones are capable of ripping of houses, large trees with their roots, and pretty much everything on their way.

36. falling and flying debris

The tornadoes are one of the most dangerous storms, and their epicenter are the United States. This type of storm is well know for its very elongated inverse cone shape, quick movement, and very strong winds. The wind speed of the tornadoes is one of the biggest concerns as it can kill easily, but it is not the only problem. The biggest problem, and the most casualties caused by the tornadoes are because of the falling and flying debris that the tornado has picked up along the way, and the debris may include anything from large rocks, to pieces of objects, and even large animals.

37. exercises

The hypothermia is one of the most common killers when it comes to people being exposed to low temperatures. While the best way to avoid hypothermia is to get out of the cold weather and go somewhere warm, that is not always possible, as mostly it is the people that are not able to get to warm place that suffer from it. The most commonly recommended thing to do is to do exercises like the jumping jacks or flapping the arms. These two exercises are recommended because they quickly manage to increase the blood flow, especially at the tips of the fingers and toes.

38. first aid kit, water, non-perishable food

In order for the people to be able to stand a chance to survive in case they are trapped for some time because of a hurricane, they should be well prepared. While there are numerous things that are recommended, there few that are on the top of the list and are necessary. The most important things to have are a first aid kit, as injuries are very common, water, around 1 gallon per person per day, and non-perishable food in order to have safe supplies of nutrition that will not spoil.

39. a. hurricane b. snowstorm c. tornado d. thunderstorm

There are numerous different types of storms, all of which have their own unique characteristics. They can all be dangerous in their own way. Some produce strong and devastating thunderstorms, some have very powerful winds, some cause intense rainfall and floods, some heavy snowfall and frost. Each can be devastating, and for each of them there are specific ways for protection, including having certain supplies, and having a good warning system that can warn the people in time about the danger.

40. southern and southeastern

The United States are the country in the world that has by far the most tornadoes. Not that the United States have the most tornadoes in the world, but they are also the strongest and largest ones as well. The parts of the country that are the most affected are the southern and southeastern part, where the tornadoes rage in certain parts of the year and cause enormous damage, and unfortunately casualties. The tornadoes manage to destroy pretty much everything on their way, and staying safe from them is very hard and there's no ways that provide total security.

How do cells in a multicellular organism become specialized?

Answers

Answer: Cell specialization or cell differentiation is a process of converting generic cells in the body into specialized cells. The specialized cells can perform a certain function within the body. The cell specialization occurs in two stages of a multicellular organism.

i hope this helps yu can probaly find more on https://pediaa.com/how-do-cells-become-specialized/ :)

Answer:

Cells becomes specialized through cell differentiation

Explanation:

Cell differentiation is the process by which the cell in a multi cellular organism gets differentiated.  

Basically the function of a cell is determined by DNA. During cell division identical cells are produced with varied genetic identity and this "variation in genetic identity" causes different cells to perform different function. The DNA of a cell with specific genetic area is expressed based on the functionality of the cell irrespective of the expression of  entire DNA areas.

When will a cell have a high degree of potency?

A. During cell specialization
B. Prior to cell specialization
C. After cell specialization
D. Adjacent to cell specialization

Answers

Answer:

B. Prior to cell specialization

Explanation:

Ability of a cell to differentiate into other cell types is called as its potency. A totipotent cell has can differentiate into whole individual as it has ability to give rise to all the parts of the multicellular organism. A cell has higher degree of potency before its differentiation. Once the cells are differentiated into specific cell types, they lose their potency.

Final answer:

A cell has a high degree of potency b) prior to cell specialization, as it can still differentiate into various cell types. During differentiation, cells specialize, resulting in the loss of some potency and lead to unique characteristics for each cell type.

Explanation:

A cell will have a high degree of potency prior to cell specialization. Potency refers to a cell's ability to differentiate into different types of cells. Before specialization, cells can become any type of cell within the organism, which is why they are considered to be highly potent. As cells undergo the process of differentiation, they become more specialized and lose some of their potency. This is a one-way process, meaning that once a cell has specialized, it typically cannot go back to being a potent stem cell.

The differentiation of cells is a key stage in development where cells become specialized in their size, shape, metabolic activity, and overall function. While all cells contain the same DNA, they only express certain genes that are necessary for their specific functions, akin to how different actors in a movie only read their parts of the script, resulting in unique characteristics for each cell type.

Therefore, the correct answer to the question, "When will a cell have a high degree of potency?" is B. Prior to cell specialization.

Complete this punnett square

Enter your answer in the space provided



Each Square is worth 1 point.

1.
2.
3.
4.

Answers

1. Tt

2. tt

3. Tt

4. tt

Answer:

1. Tt

2. tt

3. Tt

4. tt

Explanation:

The given punnett square shows cross between parent 1 with genotype "Tt" and parent 2 with genotype "tt". Parent 1 forms two types of gamete which are "T" and "t" while parent 2 forms all gamete with "t" only. Random crossing of these gametes gives the genotype ratio= 1 Tt  : 1 tt.

11. A red and a white snapdragon are crossed, and their offspring is pink. This is an example of

A. Mendel's law of independent assortment.
B. Mendel's law of dominance.
C. incomplete dominance.
D. codominance

12. ( Figure is the first picture: Refer to the figure showing a pedigree of a family affected by a sex-linked recessive disorder. If a female is a carrier for a sex-linked recessive disorder, is it possible for her sons to be unaffected by the disorder? Choose the best answer and explanation.

A. Yes, this is possible. Males receive an X chromosome from their mother. If their mother is a carrier, a male has a 50 percent chance of being affected by the disease and a 50 percent chance of being unaffected.
B. No, this isn't possible. If a mother is a carrier of an X-linked recessive disorder, her sons will be affected by the disease and her daughters will be carriers of the disease.
C. No, this isn't possible. X-linked recessive disorders can't "skip" generations like other genetic disorders.
D. Yes, this is possible. Males receive an X chromosome from their mother. If their mother is a carrier, the mutated X chromosome won't be passed on to sons and so they'll be unaffected.

13. What are the two main phases of the cell cycle?

A. Prophase and anaphase
B. Replication phase and recombination phase
C. Multiplication phase and division phase
D. Interphase and mitosis

14. What were the goals of the Human Genome Project?

A. The goals of the Human Genome Project were to sequence DNA from 50 different species, including humans, and to understand the gene that causes cancer.
B. The goals of the Human Genome Project were to sequence human DNA and to identify all genes present in human DNA.
C. The goals of the Human Genome Project were to sequence human DNA and to understand how it's damaged by exposure to toxins.
D. The goals of the Human Genome Project were to sequence human DNA and to identify the differences between human and chimpanzee DNA.

15. The rearrangement of genetic information so that offspring can inherit new genetic combinations is called

A. recombination.
B. gene editing.
C. replication.
D. gene expression.

16. The central dogma of molecular biology is that DNA is transcribed into mRNA, which is then _______ to protein.

A. transferred
B. translated
C. transduced
D. transformed

17. A three-letter sequence of mRNA that encodes for a specific amino acid is called a/an _______. A series of these links specific amino acids together to form a polypeptide.

A. encryption
B. codon
C. gene
D. DNA

18. Refer to the partially completed Punnett square. Purple flowers (P) are dominant to white flowers (w). What do you predict about the flower color of the offspring resulting from this cross?

A. About 25 percent of the offspring will have white flowers, and about 75 percent of the offspring will have purple flowers.
B. All of the offspring will have purple flowers.
C. About half of the offspring will have purple flowers, and about half of the offspring will have white flowers.
D. About 75 percent of the offspring will have purple flowers, and about 25 percent of the offspring will have white flowers.

19. Cells can interact with other cells

A. that are nearby or within the same tissue.
B. nearby or throughout the body, depending on the type of cell-cell interaction.
C. during specific stages of the cell cycle.
D. that originated from the same stem cells.

20. (SHOWN IN firstPICTURE) Refer to the figure showing a pedigree of a family affected by an X-linked recessive disorder. A female in generation 3 isn't a carrier of the disorder. How can this be?

A. Females receive X chromosomes from their fathers only, which are unaffected in this case.
B. Females don't have X chromosomes so aren't affected by gene disorders passed on the X chromosome.
C. Females receive an X chromosome from each parent. If a mother is a carrier of an X-linked recessive disorder, her daughters have a 50 percent chance of receiving her normal X chromosome and a 50 percent chance of receiving her mutated X chromosome.
D. Females receive an X chromosome from each parent, but in cases of recessive disorders, the mutated chromosome isn't passed on to daughters.

Answers

Answer:

11. D.

12. A.

13. D.

14. B.

15. A.

16. B.

17. B.

18. Refer to the explanation (I highlighted it so you can browse easier)

19. B.

20. C.

Explanation:

11. Codominance is a non-mendelian inheritance pattern. It is when two dominant traits are inherited and both are expressed in the organism. Because both are dominant, a blended expression of the trait results in the off-springs.

12. Look at the cross for this problem below:

XHXh and XHY

      XH        Y

XH XHXH  XHY

Xh XHXh   XhY

The mother is a carrier, so that means she is heterozygous for the trait hemophilia. Look at the sections with XY. We see that a son can inherit the recessive trait and the other does not.

13. The two main stages of the cell cycle would be interphase and mitosis. Interphase is the phase of the cell-cycle where the cell prepares for cell division. It is at interphase where DNA is duplicated and the cell grows. Mitosis is the actual phase where division takes place.

14. The Human Genome Project or HGP is a collaborative research program that aims to determine the COMPLETE sequence of the human DNA and to identify the locations of the genes in the sections of all chromosomes. It also aims to create maps that link inherited traits across generations.

15. Recombination is a genetic process where DNA is broken down and then recombined to poduce different traits in the off-springs. This can be done between different organisms to produce combined traits.

16. From mRNA, the sequence is translated by the tRNA or transfer RNA. The tRNA carry amino acids that code for specific sequences. These amino acids are the building blocks of proteins.

17. 3-letter sequences in mRNA code for a specific amino acid. These are collectively known as codons. These codons match up with anti-codons of tRNA which code for specific amino acids.

18. For this problem, you did not provide a Punnet but I can help you out by showing you the different possible crosses because the answer would depend on the cross. Look at the attached image.

If your problem is like CROSS 1 then the answer would be 75 percent would be Purple and 25 percent would be white.

If your problem is like CROSS 2 then the answer would be ALL will be purple.

If your problem is like CROSS 3 or CROSS 4, the answer would be half of the offspring will have purple and half would have white.

19. Cells interact with other cells nearby and throughout the body depending on what needs to be done. Cells can interact with nearby cells directly, or they can do this chemically or through other processes as well, especially when they are far apart.

20. Females receive X chromosomes from both parents. Females have a pair of X chromosomes. Going back to your problem, because the trait is recessive and the mother is only a carrier and the father is not a carrier, the chances of a female off-spring inheriting the trait would be 50%. You can look at the cross below:

XHXh and XHY

      XH        Y

XH XHXH  XHY

Xh XHXh    XhY

As you can see in the cross, one of the daughters did not receive the recessive trait XHXH.

What process can change igneous rock into sedimentary rock ?

Answers

Igneous rock can be transformed into sedimentary rock through weathering and erosion, which breaks down the rock into sediments.

Initially, igneous rocks on Earth's surface are exposed to weathering and erosion, which are processes that break down the rocks physically and chemically into smaller fragments. These fragments, once detached, are transported by agents like water, wind, or ice, a process called erosion.  Eventually, these sediments are deposited, accumulating in places often underwater. Over time, the accumulated sediments undergo compaction and cementation, which are the key stages in the transformation of loose sediments into solid sedimentary rock. Compaction occurs as the weight of overlying sediments compresses the deeper layers, squeezing out water and reducing the space between particles. During cementation, minerals precipitate from water and fill the spaces between sediment particles, effectively gluing them together. This results in the formation of sedimentary rock layers, characterized by their strata.

how does gaseous exchange tale place in amoeba

Answers

Answer:

Simple organisms, such as theamoeba and earthworm, have a moist, permeable external surface. Oxygencan pass into them through this surface by diffusion. A large surface area is needed for effective gas exchange - so larger, more complex, organisms have special organs such as gills and lungs.

Explanation:

Other Questions
What is the length of the third side of the window frame below?(Figure is not drawn to scale.)A picture of a right triangular window frame is shown. The longest side has length labeled as 39 inches. The height of the frame is labeled as 36 inches. 15 inches 27 inches 25 inches 32 inches What were the goals/policies of the Johnson administration and how did they impact the nation Which statements describe the use of gamma rays to treat cancer? Check all that apply.Gamma rays have low energy and a source must be placed in the body.Gamma rays are absorbed by only the cancer cells.High-energy gamma rays are directed at a tumor from outside of the body.Gamma rays kill cancer cells in a tumor.Gamma rays are applied to a large area of the body. Jane entered her artworks in a state competition. Her art scores from 7 judges are listed. 9,9,8,7,9,6,8 what is Janes mean score? A.6 B.7 C. 8 D.9 When you use the distance Formula you are building a right triangle whose ____ connects two given points.... I NEED HELP ASAP I WILL GIVE BRAINLIST !!!!!!!!!Assignment water and oceans graphic organizer exploration k12 1. Where does the energy that causes evaporation come from2. What role does gravity play in the water cycle?3. Describe the flow of one molecule of water through the water cycle, beginning in the ocean. suppose that one student is randomly selected during lunch time. what is the experimental probability if students the brought lunch from house is 55 and students that order school lunch is 45 Which two of these sentences are in passive voice if dy/dt=-10e^-t/2 and y(0)=20 what is the value of y(6) A land rush happened in Oklahoma in the 1890s thanks to the discovery of which mineral? A. gold B. gypsum C. lead D. zinc Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct What would the charge be on an ion of boron (B)? If Johnny has twice more bottles of dish soap than Carolyn, and Carolyn has 20 more bottles of dish soap than Mr. White, how many bottles of dish soap does Johnny have if Mr. White has 35 bottles of dish soap? Using the properties of exponents and logarithms, find the value of x in 19+2 in x=25 What are two reasons that the development of the Model T was important?It was the first car to be manufactured on a moving chassis assembly line.It was the first vehicle model to be manufactured in the United States. was the largest, fastest, and the most luxurious car of the twentieth century.It was affordable and enabled average Americans to own a car. Jimi Hendrixs version of the "Star Spangled Banner" is quite poignant because obviously he feels patriotic about his country, but there are some underlying themes if you listen carefully. The destructive explosions on the guitar are a protest to the war in Vietnam, and his sadness for innocent lives being lost is represented by the "taps" theme at 2:40. He also plays part of the melody in a minor key ("our flag was still there") to represent that although he loves his country, he recognizes that there are some things that need fixing and healing in order to move forward. The performance of this at Woodstock in 1969 must have been a very moving moment. Through all the craziness, guitar soloing and sounds of destruction, Hendrix makes the National Anthem still hold true. The question is Does Hendrix actually play the whole National Anthem (sing the lyrics in your head as he plays to find out)? In the field of health science, what characteristics are employers not looking for?diligenceintelligenceportabilityreliability For which triangle is the length of the hypotenuse an INTEGER? drama that are broken in smaller pieces are called The names and chemical formulae of some chemical compounds are written in the first two columns of the table below. Each compound is soluble in water.Imagine that a few tenths of a mole of each compound is dissolved in a liter of water. Then, write down in the third column of the table the chemical formula of the major chemical species that will be present in this solution. For example, you know water itself will be present, so you can begin each list with the chemical formula for water (H2O).Note: "major" chemical species are those present in concentrations greater than 10^-6 mol. major species present when dissolved in waterzinc iodide ZnI2 nitrous oxide N2Osodium nitrate NaNO2glucose C6H12O6nickel (II) Iodide NiL2