sodium an alkali metal and chlorine a halogen are both in period 3 of the periodic table which element has a higher ionization energy

Answers

Answer 1
Answer  

Chlorine has higher ionization energy

Explanation

Ionization energy is defined as the minimum amount of energy required to remove the most loosely bound electron, the valence electron, of an isolated neutral gaseous atom, molecule or ion. It is quantitatively expressed in symbols as

X + energy → X+ + e−

Where X is any atom, molecule or ion capable of being ionized, X+ is that atom or molecule with an electron removed, and e− is the removed electron. This is generally an endothermic process.

The ionization energy of Sodium (alkali metal) is 496KJ/mol whereas Chlorine's first ionization energy is 1251.1 KJ/mol.  

Alkali metals (IA group) have small ionization energies, especially when compared to halogens.  Because as we move across the period from left to right, in general, the ionization energy increases. The atoms become smaller which causes the nucleus to have greater attraction for the valence electrons. Therefore, the electrons are more difficult to remove.


Answer 2

[tex]\boxed{{\text{Chlorine}}}[/tex] has higher ionization energy than sodium.

Further Explanation:

Ionization energy:

It is the amount of energy that is required to remove the most loosely bound valence electrons from the isolated neutral gaseous atom. It is denoted by IE. The value of IE is related to the ease of removing the outermost valence electrons. If these electrons are removed so easily, small ionization energy is required and vice-versa. It is inversely proportional to the size of the atom.

Ionization energy trends in the periodic table:

1. Along the period, IE increases due to the decrease in the atomic size of the succeeding members. This results in the strong attraction of electrons and hence are difficult to remove.

2. Down the group, IE decreases due to the increase in the atomic size of the succeeding members. This results in the lesser attraction of electrons and hence are easy to remove.

Sodium and chlorine are present in period 3 of the periodic table. Sodium lies to the left region of the period while chlorine lies to the right.

The atomic number of sodium atom [tex]\left({{\text{Na}}}\right)[/tex] that lies in left region of the period 3 is 11 and its electronic configuration is [tex]{\mathbf{1}}{{\mathbf{s}}^{\mathbf{2}}}{\mathbf{2}}{{\mathbf{s}}^{\mathbf{2}}}{\mathbf{2}}{{\mathbf{p}}^{\mathbf{6}}}{\mathbf{3}}{{\mathbf{s}}^{\mathbf{1}}}[/tex] . The atomic number of chlorine is 17 and its electronic configuration is [tex]{\mathbf{1}}{{\mathbf{s}}^{\mathbf{2}}}{\mathbf{2}}{{\mathbf{s}}^{\mathbf{2}}}{\mathbf{2}}{{\mathbf{p}}^{\mathbf{6}}}{\mathbf{3}}{{\mathbf{s}}^{\mathbf{2}}}{\mathbf{3}}{{\mathbf{p}}^{\mathbf{5}}}[/tex] . Sodium has only one electron in its outermost valence shell that can be removed easily in order to achieve the nearest stable noble gas configuration of He, resulting in its low ionization energy. Chlorine is one electron short of noble gas so it can gain an electron easily, but its removal requires a large amount of energy. So the ionization energy of chlorine is higher than that of sodium.

Learn more:

1. Rank the elements according to first ionization energy: https://brainly.com/question/1550767

2. Write the chemical equation for the first ionization energy of lithium: https://brainly.com/question/5880605

Answer details:

Grade: Senior School

Subject: Chemistry

Chapter: Periodic classification of elements

Keywords: ionization energy, sodium, atomic number, electron, neutral, isolated, gaseous atom, IE, chlorine, group, period, higher.


Related Questions

4.05 kg + 567.95 g + 100.1 g add the correct value using the correct sig figs and or least precise degree of precision. When i did least degree of precision i got 4718.1g, do we need to convert the kg unit to grams before getting the least degree of precision? since i used 100.1 as dop and if i had converted first the dop of 4.05 or now 4050g the dop is now only to the tens place compared to being in the tenths place

Answers

To find the least degree of precision we swould model it after the kg amount or 4.05 kg or two decimal places. So that would add 0.56795 kg (0.57 kg) and then 0.1001 kg (0.1 kg) so that our answer would be 4.72 kg.

In the other hand, the greatest degree of precision would be to conver 4.05 kg to 4050 g so that 4050g + 567.95 + 100.1 g= 4718.05 grams or 4718 g.

Which of the following is the correct formula for barium (II) sulfate?

Answers

BaSO4 is the correct formula for barium (ll) sulfate
BaSO4 is the correct formula for barium (ll) sulfate

how do plate tectonics relate to the formation of crustal features on the earth

Answers

The Earth's outer crust (the lithosphere) is composed of a series of tectonic plates. These plates move on a hot flowing mantle layer called the asthenosphere.Deep trenches are often formed where tectonic plates are being subducted and earthquakes are common.
Plate tectonics relate to the formation of crustal features on the earth, because the plates are pretty much side by side.

Imagine 2 pieces of paper. When they crush together, the two sides that are pressed together goes upward. This is an example of 2 tectonics crushing together to become a mountain.

Now imagine 2 pieces of paper that are splitting apart from each other. This is how valleys are formed.

Now imagine 2 pieces of paper moving side by side, up and down. This is an example of earthquakes

hope this helps

Look up the first ionization energies of silver and manganese; which of these two elements would you call more metallic based on the way we define it in this book?

Answers

The ionization energies are related to metallic character. The elements which have low ionization energies tend to behave more metallic. The first ionization energy is the best indication of whether an element behaves as a metal or nonmetal. It can also be used to compare the metallic character of two metals. The ionization energy of manganese is 717 kJ/mol and that of silver is 731 kJ/mol. The ionization energy ionization energy of manganese is smaller than that of silver so it can easily lose electron and undergo chemical reaction. The ionization energy of silver is more therefore it will take time to lose electron and undergo oxidation. Hence, as per the book, manganese is more metallic than silver

What is the angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ( SCN− ) ion?

Answers

Answer:

Angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ion[tex]SCN^-[/tex] is 180°.

Explanation:

The hybridization of carbon atom is sp hybridized. The shape of the sp hybridized carbon is linear which means that angle between sulfur carbon a bond and carbon nitrogen bond is 180 °.

Where as [tex]sp^3[/tex] hybridized carbon has tetrahedral shape with an angle of 109.5°.

Where as [tex]sp^2[/tex] hybridized carbon has trigonal planar with an angle of 120°.

Give the structure corresponding to the name (s)−3−iodo−2−methylnonane.

Answers

The (s) in the chemical name of (s)-3-iodo-2-methylnonane indicates an S-configuration using the Cahn-Ingold-Prelog system of stereochemical nomenclature. The S-configuration means that an "imaginary" rotation from the highest priority substituent group to the lowest priority substituent group of the chiral center moves counterclockwise (to the left), provided that the lowest priority group is oriented "towards the back" (symbolized by dashed lines). 

The highest priority group (iodine in this case) is the one with the highest atomic number and the lowest priority (hydrogen in this case) is one with the lowest atomic number.

If the atoms directly beside the chiral center have the same atomic number (Carbon-2 and Carbon-4 in this case), the atoms next to them will be evaluated until a point of difference is found. Carbon-2 is connected to 2 other carbon atoms and 1 hydrogen atom, while Carbon-4 is connected to only 1 carbon atom and 2 hydrogen atoms. Thus, Carbon-2 has a higher priority, with the point of difference being the carbon atom of the methyl group attached to Carbon-2. Both Carbon-2 and Carbon-4 are connected to one carbon atom from the main nonane chain, but the other atoms connected to Carbon-4 are hydrogen atoms only. Carbon-2 has an extra carbon connected to it and carbon has a higher atomic number than hydrogen.

If there is no point of difference, the central atom is not chiral and cannot be named using the Cahn-Ingold-Prelog system. 

Thus, the structure of (s)-3-iodo-2-methylnonane is


Final answer:

The (s)−3−iodo−2−methylnonane belongs to organic compounds and consists of a nonane with an iodine atom attached to the third carbon and a methyl group attached to the second carbon.

Explanation:

The structure corresponding to the name (s)−3−iodo−2−methylnonane is achieved by following the nomenclature system for organic compounds. Nonane is a carbon backbone with nine carbon atoms. The '2-methyl' indicates that there is a methyl, or CH3 group, attached to the second carbon from the end. The '3-iodo' indicates that there is an iodine atom attached to the third carbon from the end. Therefore, starting from one end of the nonane, we have CH3-CH2-CH(I)-CH(CH3)-CH2-CH2-CH2-CH2-CH3.

Learn more about Organic Compound Structure here:

https://brainly.com/question/35316125

#SPJ3

What is the formula weight of magnesium nitrate, mg(no3)2? express your answer to four significant figures and include the appropriate units?

Answers

The formula weight of a compound is simply equal to the total molar mass.

The molar mass of each elements are:

Mg = 24.305 g/mol

N = 14.0067 g/mol

O = 15.999 g/mol

 

So the total molar mass is:

formula weight = 24.305 + 2 (14.0067) + 6 (15.999)

formula weight = 148.3 g/mol

Final answer:

The formula weight of magnesium nitrate, Mg(NO3)2, is 148.341 g/mol when calculated using the atomic weights of magnesium, nitrogen, and oxygen and summing them up according to the numbers of atoms in the compound.

Explanation:

The formula weight of magnesium nitrate, Mg(NO3)2, is calculated by adding together the atomic weights of all the atoms in the compound.

The atomic weight of magnesium (Mg) is 24.305 g/mol, nitrogen (N) is 14.007 g/mol, and oxygen (O) is 15.999 g/mol. Given that there are two nitrate groups, we multiply the weights of nitrogen and oxygen accordingly.

Multiply the atomic masses with the number of atoms: 1x24.305 g/mol Mg, 2x14.007 g/mol N, 6x15.999 g/mol O.Add all the numbers from step one:
     1x24.305 g/mol Mg + 2x14.007 g/mol N + 6x15.999 g/mol O = 148.341 g/mol Mg(NO3)2.

Therefore, the formula weight of magnesium nitrate is 148.341 g/mol, expressed to four significant figures with the appropriate units (g/mol).

what does an atomic number represent atom? 20 PIONTS TO WHO EVER ANSWERS PLS HELP
A)number of protons
B)number of electrons
C)number of neutrons
D)number of protons and neutrons

Answers

It is A. number of protons 
Its D)number of protons and neutrons 

A sample of a pure compound containing C, H, and N, weighing 1.00 g, yields 2.84 g of carbon dioxide and 0.677 g of water when it reacts with excess oxygen. What is the simplest formula of the compound?

Answers

I need to know the answer of the above question.

The ester below can be separated into phenol and an acetate salt, via saponification: heating the ester with a strong base, such as sodium hydroxide, will produce phenol and sodium acetate. the two chemicals can then be separated by heat and filtration.
a. calculate the unsaturation number of the ester above.
b. calculate the molecular weight of the ester above

Answers

I found a similar question online which will help me answer your incomplete question. To make it easier, show all the elements of the compound given. It is shown in the second picture attached.

a.) The formula for unsaturation number is shown in the 3rd picture attached. Following this, 
n = 8
m = 2(8) + 2 + 0 + 0 - 0 = 18
Thus,
x = Unsaturation number = (18 - 8)/2 = 5
The unsaturation number is 5.

b.) The molar mass of C is 12.01 g/mol; H is 1 g/mol; O is 16 g/mol. So, the molecular weight is:
Molecular weight = 12.01(8) + 8(1) + 2(16) = 136.08 g/mol
The molecular weight of the ester is 136.08 g/mol.

How many hydrogen atoms are in 2.80 mol of ammonium sulfide?

Answers

You can see each (NH4)2S has 
2 N atoms 
8 H atoms 
1 S atom 

So moles H atoms = 8 x moles (NH4)2S 
= 52.0 moles H 

1 mole anything = 6.022x10^23 units of that anything 

So number H atoms = moles H atoms x 6.022x10^23 atoms/mol 
= 52.0 x 6.022x10^23 atoms/mol 
= 3.13x10^25 atoms of H

Answer : The number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]

Explanation : Given,

Moles of hydrogen atoms = 2.80 mole

As we know that, the formula of ammonium sulfide is, [tex](NH_4)_2S[/tex]. In ammonium sulfide, there are 2 atoms of nitrogen, 8 atoms of hydrogen and 1 atom of sulfur.

Now we have to calculate the number of hydrogen atoms.

As, 1 mole of [tex](NH_4)_2S[/tex] contains [tex]8\times 6.022\times 10^{23}[/tex] number of hydrogen atoms.

So, 2.80 mole of [tex](NH_4)_2S[/tex] contains [tex]2.80\times 8\times \times 6.022\times 10^{23}=134.89\times 10^{23}[/tex] number of hydrogen atoms.

Therefore, the number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]

Volatile liquids with lower boiling points often give better results than those with higher boiling points. suggest a reason for this.

Answers

Ans. : Volatile liquids with lower boiling points often gives better result than those with higher boiling points because for the liquid for the higher boiling might evaporate before it boils because of its volatility. For the one with higher boiling point it would take longer to boil than the one with a lower boiling point therefore it has a longer time for the liquid to evaporate before it boils.

A teacher did an experiment to show the movement of particles in solids, liquids, and gases. The experimental set-up is shown below: An inverted glass jar is shown. Small circles representing foam balls are shown inside the jar. A stretched balloon is shown tied at the mouth of the jar. A string is shown drawn out from the middle of the stretched balloon. A hand is shown pulling the drawn out string. The teacher pulled the string attached to the stretched balloon, first slowly, then fast, and finally vigorously. Which of the following is most likely correct about the pulling of the string and the corresponding state of matter being represented? Gas is represented when pulled fast, solid when pulled slowly, liquid when pulled vigorously. Gas is represented when pulled slowly, liquid when pulled fast, solid when pulled vigorously. Solid is represented when pulled slowly, liquid when pulled fast, gas when pulled vigorously. Solid is represented when pulled vigorously, liquid when pulled fast, gas when pulled slowly.

Answers

Answer is: Solid is represented when pulled slowly, liquid when pulled fast, gas when pulled vigorously.

For example, nitrogen molecules have weakest intermolecular bonds in gas phase and move fast and without order.

Cooling is change from liquids to solids. In solid state (for example ice) movement of molecules is more slow than movement of molecules in liquids (for example water).

In solid, molecules are closely packed, stiff and do not changes of shape or volume. Solid object (for example iron) does not take on the shape of its container.  

Liquids have definite volume, but no fixed shape.  

Gases (for example nitrogen and neon) not have definite volume and fixed shape, it depends on its container.

Answer:

Solid is represented when pulled slowly, liquid when pulled fast, gas when pulled vigorously.

Explanation:

Hello,

The three states of matter could be distinguished via their molecular both arrangement and movement, in such a way, solids have an organized assembly of molecules that slightly and slowly move with respect to their equilibrium position, that is why the solid is represented when the string is pulled slowly, besides of their well-defined shape.

Secondly, liquids have a widespread longer distance between molecules and faster molecular movements which cause the liquid to have an indefinite shape, thus, the liquid is represented when the string is pulled fast.

Finally, the molecular arrangement in gases is "messy" as long as the molecules are in constant rapid motion causing both the crashing to each other and the indefiniteness of their shape. In such a way the gas is represented when the string is pulled vigorously.

Best regards.

Which element has three unpaired electrons in its p orbital?

Answers

The correct answer is iridium.

which state of matter undergoes changes in volume most easily?

Answers

The state of matter that undergoes changes in volume most easily is gas.
Final answer:

Gas is the state of matter that can most easily undergo changes in volume. The freely moving particles of gas adapt to take up the entire volume and shape of any container it is kept in.

Explanation:

The state of matter that undergoes changes in volume most easily is gas. This is because gaseous substances have the most dispersed particles among the three fundamental states of matter (solids, liquids, and gases). These particles move freely, occupying the complete shape and volume of the container in which they are kept. Thus, any change in the container's size will in-turn affect the volume of the gas. For instance, if we inflate a balloon with gas and then deflate it, the gas volume adjusts in line with the balloon's volume changes.

Learn more about State of Matter

https://brainly.com/question/31659891

#SPJ6

Which of the following reactions shows that the rate of the appearance of D is twice the disappearance of A and one third the disappearance of B?

Answers

First, we are discussing reversible reactions here, since the reaction is proceeded in both directions forming both reactants and products.

The reaction is symbolized as:
A + B <.........> C + D

The first given is:
The rate of appearance of D is twice the disappearance of A
This means that the coefficient of D in the reaction is twice the coefficient of A

The second given is:
The rate of appearance of D is one third the disappearance of B.
This means that the coefficient of D in the reaction is 1/3 that of B. This also means that the coefficient of B is 3 times that of D.

Combining these two pieces of information, we will find that the best equation that resembles this scenario is:
A + 6 B <.........> C + 2 D 

~Hey guys, can somebody answer this for me, thanks :) ~

The average distance between Earth and Mars is about 2.08*10^8 km. How long would it take to transmit television pictures from Mars to Earth?

Answers

I think it's 11.56 minutes

The time required by an electromagnetic wave having a speed equal to that of light to travel a distance of 2.08 × 10⁸ km is 693. 3 seconds.

What is transmission of waves?

Transmission of wave is the movement of waves from one medium to the other. Waves are the propagation of energy or matter. Waves are associated with certain wavelength and frequency.

The speed of an electromagnetic wave is equal to the speed of light, that is 3 × 10⁵ m/s. The time taken by a wave to cover a distance is dependant on the distance and air resistance.

It is given that the distance between moon and earth is 2.08 × 10⁸ km. The speed of light energy is 3 × 10⁵ m/s. Thus the time to cover this distance is calculated as follows:

Time = distance / speed

        = 2.08 × 10⁸ km / 3 × 10⁵ m/s

        = 693.3 seconds.

Hence, the television pictures from mars will take 693.3 seconds to reach earth.

To find more about electromagnetic waves, refer the link below:

https://brainly.com/question/3101711

#SPJ2

True or false the si in sih4 does not follow the octet rule because hydrogen is in an unusual oxidation stat

Answers

Final answer:

The claim that Si in SiH₄ does not follow the octet rule due to an unusual oxidation state of hydrogen is false; both silicon and hydrogen follow their expected oxidation states and the octet rule is satisfied for silicon.

Explanation:

The statement “The Si in SiH₄ does not follow the octet rule because hydrogen is in an unusual oxidation state” is false. In the molecule SiH₄, silicon follows the octet rule as it is surrounded by four hydrogen atoms (each providing one electron for bonding), resulting in silicon having eight electrons in its valence shell.

The oxidation state of hydrogen in this compound is +1, which is the usual oxidation state for hydrogen when it is bonded to nonmetals. Hence, the silicon atom in silane (SiH₄) completes its octet by forming four single bonds with four hydrogen atoms, with no need for lone pairs on the hydrogen atoms since hydrogen's valence shell is full with just two electrons.

In summary, SiH₄ is a molecule where both silicon and hydrogen atoms follow common oxidation states of +4 and +1, respectively, and the octet rule is satisfied for the silicon atom.

how many protons are in Uranium -242?

Answers

Your answer is 92 because that's the Atomic Number.

Which of these statements about enzymes is true?
a.) enzymes increase the rate of a reaction by decreasing the gibbs free energy change of the reaction.
b.) enzymes decrease the rate of a reaction by increasing the gibbs free energy change of the reaction.
c.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction.
d.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction and the gibbs free energy change of the reaction.
e.) enzymes do not change the rate of a reaction?

Answers

enzymes are organic catalysts
and catalysts generally increase rate of reaction by lowering activation energy
C is the answer

Enzymes increase the rate of a reaction by decreasing the activation energy required for the reaction but do not change the Gibbs free energy change of the reaction. Option C is correct.

Among the statements about enzymes, the true one is that enzymes increase the rate of a reaction by decreasing the activation energy of the reaction. Enzymes are biological catalysts that specifically bind to substrates and help convert them to products more efficiently by lowering the energetic barrier, which is the activation energy required for the reaction to proceed.

However, it is important to note that while enzymes do lower the activation energy, they do not alter the Gibbs free energy change (AG) of the reaction. The Gibbs free energy change is a thermodynamic property that determines the spontaneity of a reaction and remains unchanged regardless of whether enzymes are present.

Hence, C. is the correct option.

If acetic acid is the only acid that vinegar contains (ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. express your answer using two significant figures.

Answers

Ethanoic (Acetic) acid is a weak acid and do not dissociate fully. Therefore its equilibrium state has to be considered here.

[tex]CH_{3}COOH \ \textless \ ---\ \textgreater \ H^{+} + CH_{3}COO^{-} [/tex]

In this case pH value of the solution is necessary to calculate the concentration but it's not given here so pH = 2.88 (looked it up)

pH = 2.88 ==> [tex][H^{+}][/tex]  = [tex]10^{-2.88}[/tex] =  0.001 [tex]moldm^{-3}[/tex]

The change in Concentration Δ [tex][CH_{3}COOH][/tex]= 0.001 [tex]moldm^{-3}[/tex]


                                  CH3COOH          H+           CH3COOH    
Initial  [tex]moldm^{-3}[/tex]                      [tex]x[/tex]           0                     0
                                                                                                                       
Change [tex]moldm^{-3}[/tex]        -0.001            +0.001           +0.001
                                                                                                       
Equilibrium [tex]moldm^{-3}[/tex]      [tex]x[/tex]- 0.001      0.001             0.001
                                                                              

Since the [tex] k_{a} [/tex] value is so small, the assumption 
[tex][CH_{3}COOH]_{initial} = [CH_{3}COOH]_{equilibrium}[/tex] can be made.

[tex] k_{a} = [tex]= 1.8*10^{-5} = \frac{[H^{+}][CH_{3}COO^{-}]}{[CH_{3}COOH]} = \frac{0.001^{2}}{x} [/tex]

Solve for x to get the required concentration.

note: 1.)Since you need the answer in 2SF don&t round up values in the middle of the calculation like I've done here.

         2.) The ICE (Initial, Change, Equilibrium) table may come in handy if you are new to problems of this kind

Hope this helps! 



A gas mixture is made by combining 8.2 g each of ar, ne, and an unknown diatomic gas. at stp, the mixture occupies a volume of 19.44 l.what is the molar mass of the unknown gas

Answers

34 g/mol if using the post 1981 definition of STP 32 g/mol if using the pre 1982 definition of STP One minor complication is that the definition of STP changed in 1982 and some text books still use the old definition. So for this problem, I'll be giving two answers, but showing the work for only one of the results. Pre 1982, STP was defined as 273.15 K at exactly 1 atmosphere (101325. Pascals) Post 1981, STP was defined as 273.15 K at exactly 100 kPa (100000 Pascals) The result of this difference is that the volume of 1 mole of a gas at STP differs. Pre 1982, 1 mole of gas at STP has a volume of 22.414 liters. Post 1981, 1 mole of gas at STP has a volume of 22.71098 liters. First, determine the number of moles of gas molecules we have. 19.44 l / 22.71098 l/mol = 0.85597363 mol Now determine how many moles of Ar, and Ne we have. Look up the atomic weights. Atomic weight Argon = 39.948 Atomic weight Neon = 20.1797 Moles Argon = 8.2 / 39.948 = 0.205266847 mol Moles Neon = 8.2 / 20.1797 = 0.406348955 mol Calculate the number of moles of unknown gas by subtracting the number of moles of argon and neon we have from the number of moles of gas in total. So 0.85597363 mol - 0.205266847 mol - 0.406348955 mol = 0.244357829 mol Now that we know how many moles of the unknown gas we have, we can simply divide the mass by the number of moles, so 8.2 g / 0.244357829 mol = 33.55734514 g/mol Rounding to 2 significant figures gives a molar mass of 34 g/mol and since there isn't any element with a atomic weight of 17, I suspect that the textbook you're using is using the pre-1982 definition of STP. So repeating the calculations above with a volume of 22.414 liters per mole (pre-1982 definition of STP), the newly calculated molar mass becomes 32 g/mol which is a nice match for the unknown gas being oxygen. The differences using the older standard are: 19.44 l / 22.414 l/mol = 0.867315071 mol ; Number of moles in the volume of 19.44 l 0.867315071 mol - 0.205266847 mol - 0.406348955 mol = 0.255699269 mol ; moles of unknown gas. 8.2 g / 0.255699269 mol = 32.06892229 g/mol ; Molar mass of unknown gas.

Scoring scheme: 3-3-2-1 using the ion concentration values in cells #3 & #5 in the expression, ecell#5 - ecell#3 = -(0.0257/2)ln{([fe2+(cell#5)]2[fe3+(cell#3)]2)/([fe3+(cell #5)]2[fe2+(cell#3)]2)}, calculate the theoretical cell voltage difference between cells #5 and #3.

Answers

I made a fake account and everything but still no answer. Brainly done got me f@cked up
Final answer:

Inside the framework of electrochemistry, the Nernst equation is used to calculate the theoretical cell voltage difference. The Nernst equation shows the variation of cell potential from its standard state and uses the ion concentration values of cell #5 and cell #3.

Explanation:

The calculation of the theoretical cell voltage difference between cells #5 and #3 can be understood within the context of electrochemistry where the Nernst equation becomes a cornerstone.

The Nernst equation, written as Ecell = Ecell - (0.0257/n)*logQ, explains the variations in redox potentials (cell potentials) from the standard state values, where n denotes the number of electrons transferred, and Q represents the reaction quotient. This equation is used in practice to calculate Ecell, the potential of a redox system, which differs from its standard state value.

First, you'll need to know the ion concentration values for cells #3 and #5. Then, input those values into the expression. After computing, the resulting value represents the theoretical cell voltage difference between cells #5 and #3.

Learn more about Cell Potential here:

https://brainly.com/question/31975412

#SPJ2

A child goes to the kitchen sink to rinse the glass from which he just drank grape juice. as the water runs into the glass, the juice residue turns from ppurple to light blue what is happening

Answers

the moore water is run I the glass the color lightens up

If the formula for a compound is represented by X2Y3 and the charge on the Y ion is -2, what is the charge in the X ion?

Answers

If the charge on the Y ion is -2, then the charge on the X ION WILL BE +2.
When two elements combine together to form a compound, they usually engage in chemical bonding in order to attain the octet form. Depending on the type of elements in the reaction, different chemical bondings are possible. In the question given above, a sign of -2 on the Y ion indicates that it has accepted 2 electrons from X, therefore, a sign of +2 will be on X because it has given two electrons to Y.

How many dots would a lewis dot structure for neon have?

Answers

Eight, since it has eight valence electrons.

At which stage does a gas form in a gas formation reaction?

the reactants stage
the product stage
the liquid stage
the solid stage

Answers

B, the product stage. I just took this test and got this answer right. Happy to help!

Answer: b

Explanation:

A chemist dissolves of pure barium hydroxide in enough water to make up of solution. calculate the ph of the solution. (the temperature of the solution is .) be sure your answer has the correct number of significant digits.

Answers

Barium Hydroxide is a strong base, so it would completely dissociate to Ba²⁺ and OH⁻. But it is crucial to know the concentration of the Ba(OH)₂ solution. For example, if you dissolve 1 g in 1 L of solution, then the concentration would be:

C = (1 g)(1 mol Ba(OH)₂/171.34 g)/ 1 L = 5.84×10⁻³ M
So, the concentration of [OH⁻] is
[OH⁻] = 5.84×10⁻³*2 = 0.0117 M

pH = 14 - -log(0.0117)
pH = 12.07
Final answer:

The pH of a 4.5 × 10^-4 M Ba(OH)2 solution is calculated by first determining the hydroxide ion concentration, which is doubled due to the two hydroxide ions provided by Ba(OH)2, and then calculating the pOH followed by subtracting from 14 to get the pH value of approximately 10.95.

Explanation:

Calculating the pH of Barium Hydroxide Solution

For the calculation of the pH of a 4.5 × 10-4 M barium hydroxide (Ba(OH)2) solution, it is crucial to consider that barium hydroxide is a strong base which dissociates fully in water. As Ba(OH)2 provides two moles of hydroxide ions for each mole of the substance dissolved, the hydroxide ion concentration will be twice the concentration of Ba(OH)2, which is 9 × 10-4 M (2 × 4.5 × 10-4 M).

To find the pOH of the solution, we take the negative logarithm of the hydroxide ion concentration: pOH = -log (9 × 10-4) = 3.045757491. To find the pH, subtract the pOH from 14: pH = 14 - 3.045757491, which simplifies to approximately pH = 10.95. This is a basic solution, as expected from barium hydroxide.

In laboratory settings, remember to use proper safety precautions, the correct form of chemicals, accurate measuring tools, and the appropriate methods to adjust the pH of solutions, such as adding acid or base. Moreover, for precise results, correctly label solutions and calibrate equipment such as pH meters as necessary.

While heating copper in the final step, the bright copper color changes to dull brown. Will percent recovery be too high, too low, or unaffected? Explain your answer

Answers

Copper is an element in the periodic table with the chemical symbol Cu and atomic number which is equal to 29. This is a metallic element that is soft, ductile, and malleable. Also, this has very high electrical and thermal conductivity. 

This metal, when freshly exposed is a reddish-orange color. The situation given above, it is described that copper has already reacted with oxygen, as described by the change of color. This means that the percent recovery of the metal will be less since portion of it has already reacted. 

Determine the density of a 23.4g block that when placed in 25.00mL of water causes the water to rise to a level of 28.70mL?

Answers

The Density will be 3.7 mL
Other Questions
What is another name for carbohydrates? a atp b fats c glucose (sugar)? During a recent conversation with martha, george is determining which information is useful and accurate and which conclusions are more valid and which information is less useful and which conclusions are less valid. george, in this case, is performing What is the greatest common factor of 12 and 42 What is volume? What are the units for volume? What is the degree of 12x-8x+4x-3A)12B)4C)3D)8 Construction crews are constantly annoyed at the way people, mostly teenage boys, steal orange cones and flashing pylons that mark construction zones. according to jack katz, why does this sort of deviance happen? if you contagious illness by coming in contact with infected blood this would be considered contraction through direct contact What is meant by "you can't manage what you don't measure." what are the key differences between "big data" and "analystics"? what did the airline do to improve etas? what did sears do to improve personalized promotions? what is a hippo? what must executives who want to lead a big data transition do? what are the five management challenges? BIOLOGY HELP PLEASEWater is the most abundant molecule found in living organisms. Most mammals, in fact, are approximately 70% water by weight. About two-thirds of this water is present inside cells. The other one-third is present outside cells (e.g., in blood plasma or other body fluids). Why is water so important to cells?Question 18 options:Water is stored in cells to be used when the organism gets thirsty.Almost all chemical reactions in life process occur in solutions with water.The main structural component found in plasma membranes and cell walls is water. What is the value of x?x25=7Enter your answer in the box in simplest form.x = What impact did the Byzantine empire have on the development of early Russian culture?Support your answer with at least two examples What is your average speed if you walk 2 kilometers in 20 minutes? the time a cake must bake is between 25 minutes and 30 minutes, inclusive Please some more French help? Then there is one more question! 10) Si on dit qu'un est francophone, qu'est-ce que ca veut dire? On a beaucoup de telephones C'est un pays ou en general, les gens parlent francais Ca ne veut rien dire thanks! (01.03) A box has dimensions of 14 inches long, 1.5 feet wide, and 7 inches high. What is the volume of the box how is the sentence "9 is less than x is -1" written as an equation A. 9 - x = -1B. x - 9 = -1C. x - 9 = 1D. x - 1 = 9 What is another name for lines of latitude What is the true about scientific idea Will make Brainliest/#HelpAsap #MathHelp #Math(2 questions)!You want to find out how many baseball cards Ryan had to begin with. Which situation about his card collection best represents the equation x/2-1=24A. Half of his cards were ruined after they got wet, and then he lost 1 card. After that, he had 24 cards left. B. He lost 1 card, and then half of his cards were ruined after they got wet. After that, he had 24 cards left. C. Half of his cards were ruined after they got wet, and then he bought 1 more card. After that, he had 24 cards left. D. He bought 1 card, and then half of his cards were ruined after they got wet. After that, he had 24 cards left. Which situation about Connors commission best represents the inequality 40 + 10x 100?A.Connor earns $10 per day plus a $40 commission on each item he sells. How much will he earn if he sells 100 items? B.Connor earns $40 per day plus a $10 commission on each item he sells. How much will he earn if he sells 100 items? C.Connor earns $40 per day plus a $10 commission on each item he sells. How many items must he sell to earn at least $100? D.Connor earns $40 per day plus a $10 commission on each item he sells. How many items must he sell to earn no more than $100? You are outside on a clear night. You see the moon, but the face of the moon is all dark; no reflected light seen. This is most likely a _________ moon. Steam Workshop Downloader