need help :) i’m bad at math lol

Need Help :) Im Bad At Math Lol

Answers

Answer 1

Answer:

i think it is the last one

Step-by-step explanation:

-2/25^3x^3


Related Questions

*algebra* What is (f−g)(x)?

Answers

Answer:

x^3 -6x^2 +18x-10

Step-by-step explanation:

f-g (x) = f(x) -g(x)

f(x) = x^3 -2x^2 +12x-6

g(x)  =4x^2 -6x +4

f(x) -g(x) =x^3 -2x^2 +12x-6 - (4x^2 -6x +4)

Distribute the minus sign

            x^3 -2x^2 +12x-6 - 4x^2 +6x -4

Combine like terms

           x^3 -2x^2- 4x^2 +12x+6x-6  -4

            x^3 -6x^2 +18x-10

Which of the following points is a solution of the inequality y < -|x|?

A. (1,-2)

B. (1,-1)

C. (1,0 )

Answers

ANSWER

The correct choice is A

EXPLANATION

The given inequality is

y < -|x|

We substitute each point into the inequality to determine which one is a solution.

Option A

-2 < -|1|

-2 < -1.

This statement is true.

Hence (1,-2) is a solution.

Option B.

-1 < -|1|

-1 < -1.

This statement is false.

Option C

0 < -|1|

0 < -1.

This statement is also false.

An architect created the blueprints for the Chin's house. The scale factor is 1 inch: 40 inches. The length and width of the living room on the blueprint are 4 inches and 8 inches respectively. WHat is the area of the actual living room?

Answers

Step 1: Find the area of the living room on the blueprint with the formula Area = length x height

A = 4 x 8

A = 32

Step 2: We now know that the area of the living room on the blueprint is 32 inches, but we have to convert it into the actual answer. To do this multiply 32 by 40 (you have to do this because 1 inch is 40 inch in reality meaning that each inch in  the 32 inches is times 40 <<< Does that make sense?), so...

40 x 32 = 1,280

Hope this helped!

Answer:

The measurements for the actual room are, in inches, 160 x 320

Step-by-step explanation:

If you want the computed area, then multiply those numbers together since A=bh.  I assumed you were just looking for the measurements of the actual room.  Set up a ratio for the scale first, the model info in the numerator and the actual room info in the denominator:

[tex]\frac{m}{a}: \frac{1}{40}[/tex]

Here, the m is the model on paper and the a is the actual room.  So if the length of the room on paper is 4 inches, that will go on top with the model stuff and we will solve for the missing equivalent length of the actual room:

[tex]\frac{m}{a} :\frac{1}{40} =\frac{4}{x}[/tex]

Cross multiply to get that the length of the actual room is 160 inches long. Divide by 12 if you need that number in feet.

Doing the same with the width:

[tex]\frac{m}{a} :\frac{1}{40}=\frac{8}{y}[/tex]

Cross multiply to get that the width of the actual room is 320 inches.  Again, if you need that in feet, divide by 12.

the club's total number of members will grow exponentially each month. She uses the given expression to model the number of club members, in hundreds, after advertising for t months.

1.8(1.02)^12t

What does the value 1.8 represent?

Answers

Answer:

1.8 represents the initial number of the club members in hundreds.

Step-by-step explanation:

* Lets revise the exponential grows

- If a quantity grows by a fixed percent at regular intervals,

 the pattern can be depicted by this function.

- The function of the exponential growth is:

  y = a(1 + r)^x

# a = initial value (the amount before measuring growth)

# r = growth rate (most often represented as a percentage and

  expressed as a decimal)

# x = number of time intervals that have passed

* Now Lets study the problem to solve it

- The club's total number of members will grow exponentially

  each month

- The expression to model the number of club members, in

  hundreds, after advertising for t months is

  1.8(1.02)^12t

* Lets compare between this model and the function above

# a = 1.8 ⇒ initial number of members in hundreds

# r = 1.02 - 1 = 0.02 ⇒ growth rate

# x = 12t ⇒ number of time intervals

* 1.8 represents the initial number of the club members in hundreds.

What are the vertical and horizontal asymptotes for the function f(x)= x^2+x-6/x^3-1?

a) vertical asymptote: x = 1
horizontal asymptote: none

b) vertical asymptote: x = 1
horizontal asymptote: y = 0

c) vertical asymptote: x = –2, x = 3
horizontal asymptote: y = 0

d) vertical asymptote: x = –2, x = –3
horizontal asymptote: none

Answers

Answer:

Option B

Step-by-step explanation:

Given

f(x)=  (x^2+x-2)/(x^3-1)

For vertical asymptotes we have to put the denominator of the function equal to zero:

x^3-1=0

x^3=1

So,

x=1

As the degree of denominator is greater than the degree of numerator, there will be only horizontal asymptote which will be y=0 because all the y values will be dragged down to the x-axis.  

So the horizontal asymptote: y=0

And Vertical asymptote: x =1

Answer:

b

Step-by-step explanation:

Some states are running out of license plate numbers. Delaware currently uses six-digit numbers in its license plate numbering system. The state of Washington recently stated that it needs to explore options to replace their current system of three numerical digits followed by three letters. New Jersey currently uses a system of one letter, two numerical digits, then three letters. How many license plate numbers can Delaware assign under their system?

a. 100,000 plate numbers

b. 101,000 plate numbers

c. 1,000,000 plate numbers

d. 110, 000 plate numbers

Answers

Answer:

c. 1,000,000 plate numbers

Step-by-step explanation:

Each of the 6 digits of a Delaware plate can take on any of 10 values, so there are ...

10×10×10×10×10×10 = 1,000,000

possible plate numbers.

Delaware can assign 1,000,000 license plate numbers under its six-digit numbering system, as each of the six places can have any digit from 0 to 9 giving 10^6 or one million possible combinations.

The question asks how many license plate numbers Delaware can assign under their six-digit numbering system. To find the number of possible combinations for a six-digit number where each digit can be any number from 0 to 9, we need to calculate 10 possibilities for each position (including the leading zero) multiplied together.

Therefore, the calculation follows this pattern: 10  imes 10  imes 10  imes 10  imes 10  imes 10, which equals 1,000,000 possible combinations. This is because each of the six places in the license plate number can have any of the ten digits from 0 to 9. So the answer to how many license plate numbers Delaware can assign under their system is 1,000,000 plate numbers.

GEOMETRY!!! 15 PTSSSSS

Answers

Answer:

23) option c

    JL ≈ 9.3

25) option c

      y ≈ 9.6

Step-by-step explanation:

25)

Given in the question that,

cos(21°) = 9 / y

y = 9/cos(21°)

y = 9.64

y ≈ 9.6(nearest tenth)

23)

Given in the question that the hypotenuse of right angle triangle = 12

To find,

height of the right angle triangle

angle k = 39°

so by using trigonometry identity

cos(39) = opp/hypo

cos(39) = JL / KL

JL = cos(39)(12)

JL = 9.32

JL ≈ 9.3

Answer:

Q 23.  Last option 7.6

Q 25 Third option

Step-by-step explanation:

To solve Q 23

From the figure we can write,

Sin 39 = Opposite side/Adjacent side

 = JL/KL

 = JL/12

JL= 12 * Sin 39

 = 12 * 0.629  = 7.55

 = 7.6

To solve Q 25

Cos 21 = 9/y

y = 9/Cos 21 = 9/0.9335

= 9.64

 = 9.6

What is the point of maximum growth rate? Round to the nearest tenth.

Answers

Answer:

  (x, f(x)) ≈ (5.5, 4)

Step-by-step explanation:

You can go to the trouble to find the point where the second derivative is zero (the derivative has a maximum), or you can realize the function is symmetrical about y=4, which is where the point of inflection is. The x-value there is ...

  4 = 8/(1 +3e^(-0.2x))

  1 +3e^(-0.2x) = 8/4 = 2

  e^(-0.2x) = 1/3

  x = ln(1/3)/-0.2 = 5ln(3) ≈ 5.493 ≈ 5.5

We already know the value of f(x) is 4 there.

The point of maximum growth is about (5.5, 4).

a rectangle is 6 meters longer than it is wide. The area of the rectangle is 315 square meters. find the length

Answers

Answer:

The length is 21 meters

Step-by-step explanation:

* Lets use variable to represent the dimensions of the rectangle

- The length of the rectangle is 6 meters longer than its width

# Let the width of the rectangle = x meters

∴ The length of the rectangle = x + 6 meters

- The area of the rectangle = Length × width

∵ The area of the rectangle = 315 meters²

∵ The length of the rectangle = x + 6

∵ The width of the rectangle = x

∴ x(x + 6) = 315 ⇒ open the brackets to solve the equation

∴ x² + 6x = 315 ⇒ subtract 315 from both sides

∴ x² + 6x - 315 = 0

- Lets factorize the quadratic equation to find the value of x

∵ The last term of the quadratic is negative

∴ The brackets have different sign

# x² = x × x ⇒ 1st terms in the two brackets

# -315 = -15 × 21 ⇒ 2nd terms in the two brackets

# x × -15 = -15x ⇒ 1st term in the first bracket and 2nd term in

  the second bracket

# x × 21 = 21x ⇒ 1st term in the second bracket and 2nd term

  in the first bracket

# 21x - 15 x = 6x ⇒ the middle term of the quadratic equation

∴ The factoriz of x² + 6x - 315 = 0 is

  (x + 21)(x - 15) = 0

∴ x + 21 = 0 OR x - 15 = 0

# x + 21 = 0 ⇒ subtract 21 from both sides

∴ x = -21 ⇒ neglect this answer because there is no negative

  value for the dimensions

# x - 15 = 0 ⇒ add 15 to both sides

∴ x = 15

- The value of the width is x

∴ The width = 15 meters

- The value of the length is x + 6

∴ The length = 15 + 6 = 21 meters

Jessica has some markers. She has 5 more black markers than blue markers. She has 4 times as many red markers as black markers. She has 8 blue markers. How many markers does Jessica have altogether? asap 60 points

Answers

Answer:

73 markers

Step-by-step explanation:

let b = blue markers

black markers = b+5

red markers = 4* black markers

                     = 4 * (b+5)

                      = 4b+20

The total markers is blue + black + red

                           b + b+5 + 4b+20 = 6b+25

                                                       

We know she has 8 blue markers

black markers = b+5 = 8+5 = 13

red markers = 4b +20 = 4*8 +20 = 32+20 = 52

The total markers =6b+25= 6(8) + 25 = 48+25 = 73

what is the discriminant of the polynomial below 4x^2-20x +25

Answers

Answer:

The discriminant D=0

Step-by-step explanation:

For the duadratic polynomial [tex]ax^2+bx+c[/tex] the discriminant is

[tex]D=b^2-4ac.[/tex]

In your case, for the polynomial [tex]4x^2-20x+25,[/tex]

[tex]a=4;[/tex][tex]b=-20;[/tex][tex]c=25;[/tex][tex]D=(-20)^2-4\cdot 4\cdot 25=400-400=0.[/tex]

Answer:

The answer is 0 D

The municipal swimming pool in Chandler, Arizona has three different ways of paying for individual open swimming. Sam, Jane, and Suzy are trying to decide which way to pay.

• Early Pay: Pay $45.00 before Memorial Day; swim any number of days
• Deposit Plus: $12.00 deposit plus $4.00 per day
• Daily Pay: $6.00 per day



1. Write an equation for each method of payment. Write your equations in slope-intercept form so that x is the number of days and y is the cost.

a. Early Pay:
b. Deposit Plus:
c. Daily Pay:


2. If Sam goes swimming 4 times, what would he need to pay with each payment plan? Which is the best payment method for him?


3. If Sam goes swimming 8 times, what would he need to pay with each payment plan? Which is the best payment method for him?


4. If Sam goes swimming 12 times, what would he need to pay with each payment plan? Which is the best payment method for him?


5. Jane and Suzy decide to look at the different options available for individual open swimming. Jane enjoys swimming and would like to go to the pool on most days, but Suzy doesn’t know how many times she will go swimming this summer as she doesn’t really enjoy the summer heat and the pool atmosphere. Please explain in paragraph form which option would be best for Jane and which option would be best for Suzy. Explain your answer.


Any help would be greatly appreciated, I've been doing work all day and my mind is blank when I look at these questions. Thank you in advance.

Answers

1. a Early Pay: y = 45

 b. Deposit Plus: y = 12.00 + 4.00x

 c. Daily Pay: y = 6.00x

2.  Early pay = $25

   Deposit Plus = 12.00 + 4.00(4) =  12.00 + 16.00 = $28.00

 Daily Pay = 6.00(4) = $24.00

Daily Pay is the cheapest one.

3. Early Pay = $45

 Deposit Plus = 12.00 + 4.00(8) = 12.00 + 32.00 = $44.00

 Daily Pay = 6.00(8) = $48.00

Deposit Plus is the cheapest one.

4. Early Pay = $45

Deposit Plus = 12.00 + 4.00(12) = 12.00 + 48.00 = $60.00

Daily Pay = 6.00(12) = $72.00

Early Pay is the cheapest one.

5.  Since Jane likes to swim most days, it would be cheaper for her to do the Early pay option, because the price is a one time fee and she can swim every day.

Since Suzy doesn't really like to go swimming and might only go a couple times, it would be best for her to do the daily pay, that way she didn't spend any money up front if she doesn't swim at all.

Can someone help and explain this problem to me? I’m stuck

a. 2 units

b. 3 units

c. 8 units

d. 9 units

Answers

Answer:

  c.  8 units

Step-by-step explanation:

You are to find the y-intercepts of the two functions given, then report the difference between them. The y-intercept is the y-value when x=0.

For f(x), we have ...

  f(0) = 3·2^0 = 3·1 = 3

__

For the table, we can see that x=0 is halfway between x=-2 and x=2, so the y-intercept can be expected to be halfway between y=3 and y=-13. That value for y is ...

  g(0) = (3 + (-13))/2 = -10/2 = -5

That is, the y-intercept of g(x) is -5.

__

The difference between f(0) and g(0) is ...

  f(0) -g(0) = 3 -(-5) = 8 . . . . units

The prism is 7 cubes wide, 10 cubes high, and 4 cubes deep. Each cube is 0.5 inch wide. What is the volume of the prism in cubic inches?

Answers

35 cubic in.

7/2=3.5

10*4=20/2=10

10*3.5=35

Mrs. Robinson, an insurance agent, earns a salary of $4,800 per year plus a 3% commission on her sales. The average price of a policy she sells is $6,100.


Write an inequality to find how many policies Mrs. Robinson must sell to make an annual income of at least $8,000.

4800+183x<(line under the arrow)=8000
4800+183x=8000
4800+183x>=8000
4800+186>(ine under the arrow)=8000

Answers

Answer:

[tex]4800+183x\geq 8000[/tex]

She must sell at least 18 policies to make an annual income of at least $8,000

Step-by-step explanation:

Let [tex]x[/tex] be the number of policies Mrs. Robinson must sell

We know that Mrs. Robins makes 3% on commission for each policy sold. We also know that the average price of a policy is $6,100, so she makes 3% of $6,100 per policy sold. To find the 3% of $6,100 we just need to multiply 3% and $6,100; then dive the result by 100%:

[tex]\frac{3*6,100}{100} =183[/tex]

Now we know that she makes $183 per policy sold. Since [tex]x[/tex] is the number of policies sold, [tex]183x[/tex] is her total commission for selling [tex]x[/tex] policies.

We also know that She makes $4,800 per year, so her total annual income is her salary plus her commissions, in other words:

[tex]4800+183x[/tex]

Finally, we know that she wants to make at least $8,000, so her salary plus her commissions must be greater or equal than $8,000:

[tex]4800+183x\geq 8000[/tex]

Let's solve the inequality:

1. Subtract 4800 from both sides

[tex]4800-4800+183x\geq 8000-4800[/tex]

[tex]183x\geq 3200[/tex]

2. Divide both sides by 183

[tex]\frac{183x}{183} \geq \frac{3200}{183}[/tex]

[tex]x\geq 17.48[/tex]

Since she can't sell a fraction of a policy, we must round the result to the next integer:

[tex]x\geq 18[/tex]

We can conclude that she must sell 18 policies to make an annual income of at least $8,000.

Consider the function f(x) = sin(x) and the function g(x) shown below.

Answers

Answer:

C

Step-by-step explanation:

g(x) = f(x - π/3), so g(x) is f(x) shifted to the right π/3 units.

Answer C.

What is the length of the third side of the window frame below?

(Figure is not drawn to scale.)

A picture of a right triangular window frame is shown. The longest side has length labeled as 39 inches. The height of the frame is labeled as 36 inches.

15 inches
27 inches
25 inches
32 inches

Answers

Answer:

15 inches

Step-by-step explanation:

The longest side of the right triangular window frame is 39 inches

The height is 36 inches

Let the base of the window frame be x inches

So according to Pythagoras theorem,

x² + 36² = 39²

x² = 39² - 36² = 225

x = [tex]\sqrt{225}[/tex] = 15 inches

The third side of the window frame is therefore equal to 15 inches.

The length of the third side of the window frame will be 15 inches. Then the correct option is A.

What is a Pythagoras theorem?

The Pythagoras theorem states that the sum of two squares equals the squared of the longest side.

The Pythagoras theorem formula is given as

H² = P² + B²

The longest side has a length labeled as 39 inches. The height of the frame is labeled as 36 inches.

Let x be the length of the third side of the window frame. Then we have

39² = x² + 36²

 x² = 39² - 36²

 x² = 1521 - 1296

 x² = 225

  x = 15 inches

Then the correct option is A.

More about the Pythagoras theorem link is given below.

https://brainly.com/question/343682

#SPJ2

Decimal Calculations (Multiplication). An employee earns a salary of $380 for a 40-hour work week. If the employee worked 40 hours plus 14 hours of overtime at the overtime rate of 12.50 for each hour overtime worked, find her total income for the week.

Answers

Answer:

$ 555

Step-by-step explanation:

Salary for a 40-hour work week = $380

Total income for the week will be = Salary of regular 40 hours + Salary of 14 hours overtime

Salary per hour for the overtime work = $ 12.50

So,

The salary for 14 hours of overtime will be = $ 12.50 x 14 = $ 175

Therefore,

Total income for the week will be = $ 380 + $175 = $ 555

Thus, for a 40 hour work week and 14 hours of overtime the total income of the week will be $ 555

Find the equation of the line that is perpendicular to the line 4x + 2y = 1 and passes through the point (−4, 3).
A) y=2x+5
B) y=2x+2
C) y=1/2x+2
D) y=1/2x+5

Answers

Answer:

y=1/2x+5 or d

Step-by-step explanation:

Answer is D

Step-by-step explanation:

(5x^3-6-15x) / (10+5x)?
I need help please...

Answers

Answer:

  (x^2 -2x +1) -16/(5x+10)

Step-by-step explanation:

The quotient and remainder can be found by polynomial long division or by synthetic division.

___

For synthetic division, it is recommended to divide the dividend and divisor by the leading coefficient of the divisor (5), so the divisor coefficient is 1. This results in a divisor of (x+2) and a remainder of -16/5. The simplified remainder becomes ...

  (-16/5)/(x+2) = -16/(5x +10)

See the attachments for the various methods of computing the quotient.

Please help I've failed this many times

Answers

Answer:

x-intercept (9, 0)y-intercept (0, 17.5)

Step-by-step explanation:

You can compute the slope from two of the points, then write the point-slope form of the equation of the line.

  slope = (change in y)/(change in x)

  = (15 -20)/(3 -1) = -5/2

Then the equation of the line, using the first point) is ...

  y = m(x -h) +k . . . . . . for slope m through point (h, k)

  y = -5/2(x -1) +20

The x-intercept is the value of x where y=0:

  0 = -5/2(x -1) +20 . . .put 0 where y is in the equation, then solve for x

  0 = (x -1) -8 . . . . . . . . multiply by -2/5 (the inverse of the x-coefficient)

  9 = x . . . . . . . . . . . . . simplify, add 9

The x-intercept is (9, 0).

__

The y-intercept is the value of y where x=0:

  y = -5/2(0 -1) +20 . . . . . . put 0 where x is in the equation, then solve for y.

  y = -2.5 +20 = 17.5

The y-intercept is (0, 17.5).

_____

Comment on the problem

Your question page seems to offer both lesson and video help. Either or both may be better than the written solution here.

Which is not a correct way to name the angle?

Answers

Answer:

The third one (QRP)

Step-by-step explanation:

it indicates that the angle is at point R, which it isn't! The letter in the middle shows where the angle is

Option C is not a correct way to name the angle. This is obtained by understanding the correct ways of naming an angle.

What are the correct ways of naming an angle?

The correct ways of naming an angle are,

By its vertexBy three points (the middle point must be the vertex)By using numbers

In the given question,

Option A has three points and the middle point is the vertex.Option B is the vertex.Option C has three points but the middle point is not the vertex.

Hence option C is not a correct way to name the angle.

Learn more about naming a triangle here:

brainly.com/question/26038114

#SPJ2

if g(x)= 2x -1 then g(4)=​

Answers

g(4)=2×4_1

8-1

=9

hence the answer is 9

hope it helps you!!!!!!!!!

Answer:

g(4) = 7

Step-by-step explanation:

To evaluate g(4) substitute x = 4 into g(x), that is

g(4) = (2 × 4) - 1 = 8 - 1 = 7

98 POINTS!! PLS HELP!

2 Plain, 3 Cinnamon raisin, 4 Poppy seed, 2 French toast, 1 Wheat.


1. Whats the probability of (Not Cinnamon raisin) Explain.


1b. Probability of (Plain, Wheat, or Poppy) Explain how you got this answer.


Show work

Answers

1. 9/12 because all of them added together is 12 but cinnamon raisin is 3 so 12-3 gives u 9 and the total is 12 so 9/12

1b. Plain(2) wheat(1) poppy(4) 2+1+4=7. The total is again 12 so 7/12

What is the x-intercept and the y-intercept of the line in the graph

Answers

Answer:

x intercept= 3

y=-2

Step-by-step explanation:

the intercept is the point when the line crosses the axis

Find the solution set for the equation, given the replacement set.

5x + 2y = –3; {(–2, 9.5), (–3, 11.5), (–4, 8.5), (–5, 6.5)}
a.
{(–2, 9.5), (–3, 11.5)}
c.
{(–4, 8.5)}
b.
{(–3, 11.5)}
d.
{(–4, 8.5), (–5, 6.5)}

Answers

Answer:

   c.  {(–4, 8.5)}

Step-by-step explanation:

A plot of the equation and the offered points is attached.

__

It might be helpful to put the equation into slope-intercept form.

  2y = -5x -3

  y = -5/2x -3/2

This shows you that y will be an odd multiple of 1/2 only for even values of x. So, we only need to check the points (-2, 9.5) and (-4, 8.5).

At x=-2, y = -5/2(-2) -3/2 = 5 -3/2 < 9.5 . . . . . (-2, 9.5) is not a solution

At x=-4, y = -5/2(-4) -3/2 = 10 -3/2 = 8.5 . . . . (-4, 8.5) is a solution

Of the offered choices, the only one in the solution set is (-4, 8.5).

If the distance covered by an object in time t is given by s(t)=t^2+5t , where s(t) is in meters and t is in seconds, what is the distance covered in the interval between 1 second and 5 seconds?
A. 24 meters
B. 30 meters
C. 40 meters
D. 42 meters
E. 44 meters

Answers

Answer:

E. 44 meters

Step-by-step explanation:

The function that models the distance covered by the object is

[tex]s(t)=t^2+5t[/tex]

where s(t) is in meters and t is in seconds.

The distance covered by the object after 1 second is

[tex]s(1)=1^2+5(1)=6m[/tex]

The distance covered by the object after 1 second is

[tex]s(1)=5^2+5(5)=50m[/tex]

The distance covered between 1 second and 5 seconds is

50-6=44m

Answer:

person above is right

Step-by-step explanation:

right on plato

MATH GGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGG

Answers

Answer:

Option C is correct.

Step-by-step explanation:

The equation used to represent the slop-intercept form is

y= mx + b

where m is the slope

and b is the y-intercept.

So, in the given question y-intercept = (0,8)

b= 8 and

slope =m= 1/2

the equation will be:

y = mx + b

y= (1/2)x + 8

So, Option C is correct.

Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct

Answers

Answer:

According to the given question if one of the angle of the triangle is 75 degree and the other two sides are of length 2 and 3 units respectively then option C is correct. Only One triangle can be formed where Angle B will be 40 degree. You can figure it out from the steps mentioned below first of all draw an Arc with the length either 3cm or 2 cm that will be the base of a triangle and then from the ending point again cut an arc then after from the starting point that is the point draw  an angle of 75 degree with the help of protactor and extend it to meet the Arc finally you can get the 40 degree.

Hope this helps. Name me brainliest please

a home building contractor bought 4 2/8 acres for $165,000. What was the cost of each acre? (round to nearest dollar.)

Answers

Answer:

$ 38,824

Step-by-step explanation:

Total Area of land that was bought = [tex]4\frac{2}{8}[/tex] acres

Total Cost of this area = $ 165,000

We have to find the cost of 1 acre of land.

Cost of [tex]4\frac{2}{8}[/tex] acres of land = $ 165,000

Dividing both sides by [tex]4\frac{2}{8}[/tex], we get:

Cost of 1 acre of land = $ 165,000 ÷ [tex]4\frac{2}{8}[/tex]

= $ 38,824

Thus the cost of each acre of land  is $ 38,824 (rounded to nearest dollar)

Answer: $38,824

Step-by-step explanation:

Convert the mixed number [tex]4\ \frac{2}{8}[/tex] as a decimal number.

Divide the numerator by the denominator and add it to the whole number 4. Then:

[tex]4+0.25=4.25acres[/tex]

Then, knowing that 4.25 acres cost $165,000 , divide this amount by 4.25 acres to find the cost of each acre.

Therefore, you get that the cost of each acre rounded to nearest dollar is:

[tex]cost=\frac{\$165,000}{4.25}\\cost=\$38,824[/tex]

Other Questions
60 POINTS PLEASE HURRY!!Rashid solved a fraction division problem using the rule multiply by the reciprocal. His work is shown below.3/4 divided by 93/4 x 1/9 = 3/36 or1/2Which is the most accurate description of Rashids work?A. Rashid solved the problem correctly.B. Rashid multiplied the dividend by the divisor instead of finding the reciprocal.C. Rashid multiplied the denominators instead of finding a common denominator.D. Rashid multiplied with the reciprocal of the dividend instead of the reciprocal of the divisor. 1. A whole note is equal to a half rest(true or false)2. Taiko is a style of Japanese drumming(true or false) Tania took selfies with her 8 cousins. Each cousin is in exactly 2 or 3 pictures. There are 5 cousins in each picture. How many selfies did Tania take? What did the immigration act of 1965 reverse 1. What were the two causes of the "consensusculture?" In the filmAvengers: Infinity Warthe main villain, Thanos, wipes out half of the life in the universe. His rational for doing this is that without some sort of intervention ALL life would cease to exist. And, furthermore, that those left behind after he destroys/unmakes will see a more prosperous and peaceful life.Was Thanos right/justified in his actions? Why or Why not? If Social Security takes 6.2 percent, and Medicare takes 1.45 percent of your paycheck, how much would you have left on a $300 monthly salary?$277.05$227.05$277.55$227.55 After 700 BCE, a sense of equality developed in Greece among A. Soldiers on horse back B. Athenian Woman C. Aristocrats D. Foot soldiers What is the weight of a 45 kg box? N I don't understand this, someone please help me Express 16=2x as a logarithmic equation Julio thinks about which careers he would enjoy. He considers his personal skills and interests. He enjoys cooking and helping people. He always takes the time to make sure he understands what others say, which means he is a good listener. He speaks Spanish as well as English. Based on his skills and interests, which careers would Julio enjoy? Check all that apply. -professional football player -professional chef -auto mechanic -English/Spanish interpreter -guidance counselor -tour guide -housepainter Which list shows all the factors of 36? 1, 2, 3, 4, 6, 9, 12, 18, 36 1, 2, 3, 4, 8 , 9, 12, 18, 36 2, 3, 4, 6, 9, 12, 18 2, 4, 6, 8, 9, 12, 18 help fast what is the discriminant of the polynomial below 4x^2-20x +25 Folate is required for dna synthesis and cell division. True or False Which type of financial institution typically has membership requirements Surface areaMathHelp Each Thursday the 11 kindergarten students in Miss Goodson's class are each allowed one slice of pie, one cup of orange juice, and two doughnut holes. The leftovers will be given to the custodian on the night shift.How many slices of pie are left for the custodian? slices of pie How many cups of orange juice are left for the custodian? cups of orange juice How many doughnut holes are left for the custodian? donut holes Which type of weather technology makes use of differences in temperature?AvisiblelightsatellitesBdopplerradarCbarometerdetectorsDinfraredimagery Which shows the correct substitution of the values a,b, and c from the equation 0=-3x^2-2x+6 into the quadratic formula ?