Mr Johnson, the store owner, ordered 48 boxes of jawbreakers. Each box contained 392 pieces of candy. How many lawbreakers did Mr. Johnson order?​

Answers

Answer 1

Answer:

Mr. Johnson would have ordered 18816 jaw breakers.

Step-by-step explanation:

Multiply 392 by 48

Answer 2

Mr. Johnson ordered a total of 18816 jawbreakers by multiplying the number of boxes (48) by the number of pieces of candy per box (392).

The question involves calculating the total number of jawbreakers Mr. Johnson ordered. To do this, we need to multiply the number of boxes ordered by the number of pieces of candy per box.

Step-by-step calculation:

Identify the number of boxes ordered: 48 boxes.

Identify the number of candies per box: 392 pieces.

Multiply the number of boxes by the number of candies per box to find the total: 48 boxes × 392 pieces/box = 18816 jawbreakers.

Therefore, Mr. Johnson ordered a total of 18816 jawbreakers.


Related Questions

If the hypotenuse of a 45°-45°-90° triangle is 13, what is the length of one of the legs?

Answers

Answer:

9.19

Step-by-step explanation:

Using Law of sines to find other two lengths:

a/sinA=b/sinB

let a be length of side unknown and b be hypotenuse then sinB=sin90 and sinA=sin45

a/sin45=13/sin90

a=13sin45

a=13(0.707)

  =9.19

As the given triangle is isosceles hence the length of other two legs will be same i.e 9.19 !

What are the solutions to the quadratic equation 6x2 + 24x = 0?
X = 0 and x = 4
x = 0 and x = -4
x = 6 and x = 4
x = 6 and x = -4

Answers

X=0 and x=-4 is the answer.

6(0)^2=0+24(0)=0

(6(-4)^2= 96) + (24(-4)=-96)=0.

Hope this helps and hope you have a great day and brainiest is always appreciated

Answer:

Solutions are x =0 and x= -4

Second option is correct.

Step-by-step explanation:

The given quadratic equation is [tex]6x^2+24x=0[/tex]

Factored out GCF

[tex]6x(x+4)=0[/tex]

Apply the Zero product property

[tex]6x=0,x+4=0[/tex]

Solve for x

[tex]x=0,x=-4[/tex]

Therefore, the solutions are x =0 and x= -4

Second option is correct.

there are two trianagles triangle a has a base of 8 cm and a height of 10 cm triangle b has a base of 5 cm and a height of 13 cm which triangle has a larger area

Answers

Answer:

Step-by-step explanation:

Since angle A is 36°, then angle B is 90° − 36° = 54°.

To find an unknown side, say a, proceed as follows:

1.   Make the unknown side the numerator of a fraction, and make the known side the denominator.

Unknown

Known  =   a

10

2.   Name that function of the angle.

Unknown

Known  =   a

10  = sin 36°

3.   Use the trigonometric Table to evaluate that function.

Unknown

Known  =   a

10  = sin 36° = .588

4.   Solve for the unknown side.

a = 10 × .588 cm = 5.88 cm

Answer:

Triangle a is larger than triangle b

Step-by-step explanation:

Triangle a

8x10=80

80 divided by 2=40

Triangle b

5x13=65

65 divided by 2=32.5

80 > 32.5

Can I pls have brainliest?

When planning her crops, Farmer Sue knows that her 15 acres can support apples and pecans. She wants to make $8,500 from her crops. She can make $1,050 per acre of apples (the variable a) and $2,500 per acre of pecans (the variable p). Which equation below would be a constraint in her system of equations? (1 point)

Answers

Answer:

A+P=15 or B

Step-by-step explanation:

Trust me u son of a gun. Alexa, play the one song with those guys in paris

Only number 10............

Answers

Answer: F. The Theoretical Probability is Greater than the Experimental Probability.

Step-by-step explanation: Theoretical probability gives you the odds of every outcome. With flipping a coin, the outcome odds of tails would always be 1/2. Experimental probability is the actual outcome that results from trials. During trials, tails was flipped 8 times. We can simplify 8/20 flips to find that tails was flipped 2/5 flips. In decimal form, 1/2 simbolizes .5 or 50%. 2/5 simbolizes .4 or 40%. The theoretical probability is greater than the experimental probability.

find the value of r in (4, r), (r, 2) so that the slope of the line containing them is -5/3

Answers

[tex]\bf (\stackrel{x_1}{4}~,~\stackrel{y_1}{r})\qquad (\stackrel{x_2}{r}~,~\stackrel{y_2}{2}) \\\\\\ slope = m\implies \cfrac{\stackrel{rise}{ y_2- y_1}}{\stackrel{run}{ x_2- x_1}}\implies \cfrac{2-r}{r-4}=\stackrel{\stackrel{given}{\downarrow }}{-\cfrac{5}{3}}\implies 3(2-r)=-5(r-4) \\\\\\ 6-3r=-5r+20\implies 6+2r=20\implies 2r=14\implies r=\cfrac{14}{2}\implies r=7[/tex]

Answer:

r = 7

Step-by-step explanation:

looking at the slope -5/3, -5 is the change in y and 3 is the change in x. so, we  have to start from the point ( 4 , r ) and get to the next point ( r , 2 ) by using the given slope. we would first add 3 to our x value in the first point since that's our change in x and we would get r = 7. then we can substitute that in the other point and it works perfectly.

i hope this helps :)

Need help please answer this question

Answers

Answer:

C

Step-by-step explanation:

Substitute the given values for x and y into the expression

5 × ([tex]\frac{60}{6(5)}[/tex]) - 1

= 5 × ([tex]\frac{60}{30}[/tex]) - 1

= (5 × 2)  - 1

= 10 - 1

= 9 → C

Mode is used to ascertain what the most repeated data is in the data set.
True or False

Answers

The mode is the most frequently occurring value in a data set and is used to find the most repeated data. A data set can be bimodal if it has two modes. So the statement is true.

The statement is true: the mode is used to ascertain the most repeated data in the data set. It is a measure of central tendency that represents the value that occurs most frequently within a set of numbers. If a data set has two modes, it is referred to as bimodal. The mode can be especially useful for understanding the distribution of qualitative or categorical data.

How do you factor this?
2z^2-12z+10=0

Answers

Answer:

This can't be factored right now! But if it is 2z^2+12z+10=0 than it will be factored like this:

2*(z+5)(z+1)

Step-by-step explanation:

2*(z^2+6z+5)=0

2*(z+5)(z+1)

[tex]2x^2-12z+10=0[/tex]

Common multiple is 2.

[tex]2(z^2-6z+5)=0[/tex]

Simplify inside parentheses.

[tex]2(z-5)(z-1)=0[/tex] is your answer

Find the total monthly cost for this plan to buy.

Loan Rate Insurance Repairs Gas Extra Miles Misc. Total Cost
$670.60 $200.00 warranty $82.00 $100.00 $62.50

Answers

Answer:

maybe this Total cost

=383.17+200+82+300+62.50

=1,027.67

Step-by-step explanation:

Answer:

$1115.10

Step-by-step explanation:

Total cost  will be the sum of all individual expenses i.e.

[tex]670.60 + 200.00 + 82.00 + 100.00 + 62.50 = 1115.10[/tex]

∴ The total cost will be $1115.10

Which of these functions is a linear function? y + x = 5 y + x2 = -2 y = 2x3 + 1 3x2 + y2 = -4

Answers

Answer: First Option

[tex]y + x = 5[/tex]

Step-by-step explanation:

The linear functions have the following form

[tex]ax ^ n + bx ^ m = c[/tex]

Where a and b are constants and are real numbers and the exponent n and m is always equal to 1.

[tex]m=n=1[/tex]

In other words, the linear equations have the form

[tex]ax + by = c[/tex]

Identify among the options the functions that have this form

[tex]y + x = 5[/tex] is a linear function with [tex]a = 1[/tex], [tex]b = 1[/tex], [tex]c = 5[/tex]  and  [tex]m=n=1[/tex]

[tex]y + x^2 = -2[/tex] is not a linear function because [tex]n\neq 1[/tex].

[tex]y = 2x^3 + 1[/tex] is not a linear function because [tex]n\neq 1[/tex]

[tex]3x^2 + y^2 = -4[/tex] is not a linear function because [tex]n\neq 1[/tex] and [tex]m\neq 1[/tex]

Answer:

y + x = 5

Step-by-step explanation:

The graph of [tex]y+x=5[/tex] is a straight line

The graph of [tex]y+x^2=-2[/tex] is a parabola.

The graph of [tex]y=2x^3+1[/tex] is a non-linear curve.

The graph of

[tex]3x^2+y^2=-4[/tex] is an ellipse.

A graph of a linear function  is a straight line.

Therefore y + x = 5 is the correct choice.

How much is one ninth of three eights

Answers

Answer:    3/72, but read the explanantion!

Step-by-step explanation: Since we are trying to find 1/9 of 3/8, which is division, we use the method K, C , F

KCF stands for keep, change, flip.

1/9     (keep)             =                1/9

divided by (change) =        multiplied by

3/8 (flip)                    =                8/3

You then proceed with simple multiplication.

1/9*3/8= 3/72

3/72= 4.1666......

Hope this helps!!

Answer:

1/24

Step-by-step explanation:

Multiply:

1     3       1

--- * --- = -----

9    8      24

Which value of x is in the solution set of 2x-3>11-5x

Answers

7x>14,x=2። is right answer i think

7x>14,x=2። is right answer i think

Answer:

Value of x > 2 is in the solution set of 2x-3>11-5x which means the value of x can be any value greater than 2.

Step-by-step explanation:

We need to find the value of x for the equation 2x-3>11-5x

2x-3>11-5x

Adding +5x on both sides:

2x+5x-3>11-5x+5x

7x-3>11

Adding +3 on both sides

7x-3+3>11+3

7x>14

Dividing by 7 on both sides:

7x/7>14/7

x>2

Value of x > 2 is in the solution set of 2x-3>11-5x which means the value of x can be any value greater than 2.

The least common denominator of 1/2, 1/8, and 1/10 is
A. 10.
B. 40.
C. 16.
D. 80.

Answers

the answer would be B

Answer: Option B.

Step-by-step explanation:

Descompose the denominator of each fraction into its corresponding prime factors. Then:

[tex]2=2*1\\8=2*2*2=2^3\\10=2*5[/tex]

Now you need to choose the commons a non-commons with the highest exponent. These are: 2³, 1 and 5.

Finally you need to multiply them to get that the Least common denominator of [tex]\frac{1}{2},\ \frac{1}{8}\ and\ \frac{1}{10}[/tex] is. Therefore, this is:

[tex]LCD=2^3*1*5\\LCD=40[/tex]

This matches with the option B.

find the third quartile using the box plot shown. A=42. B= 45 C=38. D=48

Answers

Answer:

The correct answer is B.

Find all solutions of the equation in the interval [0,2pi)

Tan theta -1=0

Write your answer in radians in terms of pi

Answers

Answer:

{π/4, 5π/4}

Step-by-step explanation:

Tan theta -1=0 could be rewritten as tan Ф = 1.  The tangent function is 1 at Ф = π/4.  As the period of the tangent function is π,

tan Ф = 1 will be true for Ф = π/4 + π, or (5/4)π.

The solution set is {π/4, 5π/4}.

The solutions of the given equation are -1, 0, -2, 0, -2 for the values of θ in the interval [0, 2π) respectively.

How the tangent ratio (tan) is defined?

A tangent of an angle is defined as the ratio of the sine of the angle to the cosine of the angle.

tan θ = (sin θ)/(cos θ)

Solving the given equation:

The given equation is

tan θ - 1 =0

solving for the values in between [0, 2π)

In this interval, the possible values for θ(in the case of tan) are 0, π/4, 3π/4, 5π/4, and 7π/4.

So, the solutions are:

for θ = 0,

⇒ tan (0) - 1 = -1

for θ = π/4,

⇒ tan(π/4) - 1 = 0

for θ = 3π/4,

⇒ tan(3π/4) - 1 = -2

for θ = 5π/4,

⇒ tan(5π/4) - 1 = 0

for θ = 7π/4,

⇒ tan(7π/4) - 1 = -2

Thus, the solution set for the given equation in the interval [0, 2π) is {-1, 0, -2, 0, -2}

Learn more about trigonometric ratios here:

https://brainly.com/question/8120556

#SPJ2

What is the slope of the line described by the equation below y = -6x + 3

Answers

Answer:

slope = - 6

Step-by-step explanation:

The equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

y = - 6x + 3 ← is in slope- intercept form

with slope m = - 6

Answer: -6

Step-by-step explanation:

Ap3x

The SI prefix hecto- is used to designate what value of any unit?

A. 10 × 102
B. 10–5
C. 102
D. 106

Answers

Answer:

optioc C [tex]10^{2}[/tex]

Step-by-step explanation:

we know that

Hecto (h) is a decimal unit prefix in the metric system denoting a factor of one hundred

so

[tex]h=100=10^{2}[/tex]

what is 8 times 5/6​

Answers

Answer:

it is 6.66

Step-by-step explanation:

Which function is represented by the graph below? (5 points) f(x) = 3x f(x) = 3x − 3 f(x) = 3x + 3 f(x) = 3(x + 3)

Answers

Answer:

The correct function should be  f(x) = 3^(x + 3).

A function assigns the values. The function that represents the graph below is f(x) = 3⁽ˣ⁺³⁾.

What is a Function?

A function assigns the value of each element of one set to the other specific element of another set.

The function that can represent the graph below can be found by plotting the function on the calculator.

f(x) = 3ˣ – 3  ⇒ Black

f(x) = 3⁽ˣ⁺³⁾  ⇒ Red

f(x) = 3ˣ  ⇒ Blue

f(x) = 3ˣ + 3  ⇒ Green

Hence, the function that represents the graph below is f(x) = 3⁽ˣ⁺³⁾.

Learn more about Function:

https://brainly.com/question/5245372

#SPJ2

Help Please!!!!!!!!!!

Answers

Answer:

The graph in the attached figure

Step-by-step explanation:

we have

[tex]x+3y\leq 6[/tex]

Isolate the variable y

[tex]3y\leq 6-x[/tex]

[tex]y\leq 2-(1/3)x[/tex]

The solution is the shaded area below the solid line

Is below because the symbol of the inequality is less

Is a solid line because the line is included in the solution

The equation of the solid line is [tex]y=2-(1/3)x[/tex]

To graph the solution find the intercepts

Find the x-intercept (value of x when the value of y is equal to zero)

For y=0, x=6 --------> point (6,0)

Find the y-intercept (value of y when the value of x is equal to zero)

For x=0, y=2 -------> point (0,2)

Graph the inequality

see the attached figure

Y=f(x)=16^x find f(x) when x=1/2

Answers

Answer:

4

Step-by-step explanation:

Using the rule of exponents

• [tex]a^{\frac{m}{n} }[/tex] ⇔ [tex]\sqrt[n]{a^{m} }[/tex]

f(x) = [tex]16^{\frac{1}{2} }[/tex] = [tex]\sqrt{16}[/tex] = 4

Answer:

f(1/2) = 4

Step-by-step explanation:

f(1/2) has the meaning of wherever you see x on the right hand side, you put in 1/2.

f(1/2) = 16^(1/2) = sqrt(16) [A power of 1/2 is a square root]

f(1/2) = 4

Answer: 4

Which of the following are true statements about a regular polygon? Check all that apply.

Answers

The correct statements about any regular polygon are:

A. It is convex.D. Its sides are line segments.E. All of its sides are congruent.F. All of its angles are congruent.

What is true about the regular polygon

A regular polygon is convex, meaning all its interior angles are less than 180 degrees.

Its sides are straight line segments.

In a regular polygon, all sides are of equal length (congruent).

Regular polygons have congruent interior angles, meaning all angles within the polygon are equal in measure.

B = 7, a + b = 8, a+7 = 8 is an example of which property?

Multiplication property of equality

Addition property of equality

Subtraction property of equality

Division property of equality

Reflexive

Substitution

Distributive

Symmetric

Transitive



Answers

the answer is the substitution property

Answer:

The answer on edge is

A. the addition property of equality

D. the substitution property of equality

Step-by-step explanation:

cause its the answer

help me thx if u help me

Answers

The last option is the answer. x> -4

because as we can see from the number line x is larger than -4 and the dot on the -4 is not filled in so that mean that -4 is not included.

hence the answer is x> -4

Katrina earns $9.25 per hour plus a 12% commission on any sales she makes. In one day, she worked for 11 hours, and she made $385 in sales. About how much money did Katrina earn that day?

Answers

Katrina earned approximately $147.95 that day.

To calculate how much money Katrina earned in one day, we need to take into account her hourly wage as well as her commission from sales. The first part is straightforward: She works 11 hours at an hourly rate of $9.25. To find this portion of her earnings, we multiply the number of hours by her hourly rate:

11 hours * $9.25 per hour = $101.75

Next, we calculate the commission from her sales. Katrina made $385 in sales and gets a 12% commission on these sales:

12% of $385 = 0.12 * $385 = $46.20

To find Katrina's total earnings for the day, we add her hourly earnings to her commission earnings:

$101.75 (hourly earnings) + $46.20 (commission) = $147.95

Therefore, Katrina earned approximately $147.95 that day

help me with this question please!

Answers

Answer:

I believe it is A. Truly sorry if I am incorrect.

Step-by-step explanation:

I used an online calculator.

The CORRECT answer is B

Express the square root of -80 in its simplest terms.

A- cannot be determined
B- 8i sqrt 10
C- 4i sqrt 5
D- 2i sqrt 20

Answers

Answer:

C

Step-by-step explanation:

noting that [tex]\sqrt{-1}[/tex] = i

Given

[tex]\sqrt{-80}[/tex]

= [tex]\sqrt{16(-1)(5)}[/tex]

= [tex]\sqrt{16}[/tex] × [tex]\sqrt{-1}[/tex] × [tex]\sqrt{5}[/tex]

= 4i[tex]\sqrt{5}[/tex] → C

The square root of -80, expressed in simplest terms, is 4i sqrt 5, where 'i' is the imaginary unit.So,option C is correct.

To express the square root of -80 in its simplest terms, we need to use the imaginary unit i, which is defined as the square root of -1. We can rewrite -80 as -1  imes 80, and thus the square root of -80 as the square root of -1 times the square root of 80. We know that the square root of -1 is i, and the square root of 80 can be simplified to the square root of 16 times the square root of 5, which is 4 times the square root of 5. Combining these, we get:
√-80 = √(-1 times 80)
      = √-1 times √80
      = i times 4√5
      = 4i√5.

The correct answer is C- 4i sqrt 5.

Help on this question. This is on Khan Academy ​

Answers

Answer:None of the above it would have to be that's what he pays in 9 months

Step-by-step explanation:

Answer:

A

Step-by-step explanation:

Akash is paying $79.99 each month for 3 months.  239.97 is the result of that, so there would be 239.97 less in his checking account.  

Find A U B. A){3,7}B){3,5,6,7}C){2,3,5,7,8,9,12}D){3,5,6,7,8,11,12}

Answers

Answer:

{3,5,6,7}

Step-by-step explanation:

We need only to pick numbers from 2 sums, A and B, together

The union of the two sets is:

A U B = {3, 5, 6, 7, 8, 11, 12}.

Option D is the correct answer.

What is a set?

A set is a collection of items where there are operations such as:

Union of sets, the intersection of sets, and the complement of sets.

We have,

The union of two sets A and B, denoted as A U B, is the set that contains all elements that are in either set A or set B or in both.

To find A U B, we combine the elements of both sets and remove any duplicates.

A = {3, 5, 6, 7}

B = {6, 7, 8, 11, 12}

To find A U B, we combine the elements of both sets:

A U B = {3, 5, 6, 7, 8, 11, 12}

Therefore,

A U B = {3, 5, 6, 7, 8, 11, 12}.

Learn more about sets here:

https://brainly.com/question/8053622

#SPJ3

The complete question.

A = {3, 5, 6, 7}
B = {6, 7, 8, 11, 12}

Other Questions
In the morning, the temperature starts out around 50 F. As the day goes on, the temperature rises first slowly, then more quickly. It stays constant for an hour before dropping slowly. Select the graph that best represents this description How did the British officers such as Lafayette aid America in the Revolutionary war What is the equation of a vertical line passing through the point (-4,7)? The volume of a cube is 1953.1 25 cm find the length of the side round your answer to the nearest 10th I NEED ANSWER BY TODAY1. (1) I stood offstage. (2) I felt nervous. (3) I was prepared for the audition. (4) Still, I felt nervous. (5) I always do. (6) It doesn't matter whether the part is large or small, whether I know the director or not, or whether I am having a good day or a bad one. (7) I always feel nervous before I go onstage. (8) Then I actually step onstage, and I relax. Which sentence in the paragraph uses parallel structure?a. sentence 1b. sentence 3c. sentence 5d. sentence 62. Use your understanding of the Latin root -aud- to choose the meaning of the phrase an audible sigh.a. a sigh that shows sad feelingsb. a sigh showing fear or anxietyc. an easily heard sighd. a sigh that hides other emotions3. udging from the meaning of the Latin root -script-, choose the place where you would most likely find a postscript.a. in the stage directions of the written version of a dramatic playb. at the end of a letter, after the body and signaturec. in a sidebar of warnings about how to operate heavy machineryd. as part of the instructions in a computer manual The perimeter of a basketball court is 84 meters and the length is 6 meters longer than twice the width. what are the length and width? Find the perimeter of a triangle with sides measuring 5 centimeters , 9 centimeter, and 11 centimeters Freddy does not know why his wife seems so angry and upset. he decides not to say anything to her, according to rebt, freddy express 45 minutes as a fraction of 1 hour Simplify dont show your work got it Which of the following is csc(-166) equal to?csc(14)-csc(14)-csc(-14)csc(166) What is the approximate measure of this angle? Why was the Tennis Court Oath a significant event of the French Revolution? In which way is biomass similar to fossil fuels? Which figure shows how a shape can be rotated about an axis to form a hemisphere? What is Wiesel's primary purpose in "The Perils of Indifference"?A. To tell the story of Wiesel's experiences in the concentration camps B. To thank the president for inviting Wiesel to speak at the White HouseC. To ask people to do something when they see human sufferingD. To ask people to remember what happened during the Holocaust how can personal biases and points of view influence historians when they are studying evidence What is the 6th value in the sequence with the explicit formula an= 2n14? If a media message shows favoritism it is considered to be Pacific Islanders today are working to improve their economies through all of the following areas except ___________.agriculturecomputer technologytourismfishing