look at the map below. which is the distance between kensington and greenwich?​

Look At The Map Below. Which Is The Distance Between Kensington And Greenwich?

Answers

Answer 1

Answer:

choice c is believe is the answer

Step-by-step explanation:

Answer 2

Applying the Pythagorean theorem, the distance between kensington and greenwich is: b. 20√5 mi.

What is the Pythagorean Theorem?

To solve a right triangle, where a and b are the legs and c is the longest side (hypotenuse), the Pythagorean theorem states that, c = √(a² + b²).

Apply the Pythagorean theorem to find the distance:

Distance between kensington and greenwich = √(40² + 20²)

= √(1,600 + 400)

= √2,000

= 20√5 mi.

Learn more about the Pythagorean Theorem on:

https://brainly.com/question/654982

#SPJ2


Related Questions

g(r)=−(r+11)(r+14)

1) What are the zeros of the function?

Write the smaller r first, and the larger r second.

smaller r____

larger r_____

2) What is the vertex of the parabola

(___,____)

Answers

1) What are the zeros of the function?

smaller r: -11, larger r: -14

2) What is the vertex of the parabola

Vertex: (-12.5, 3)

1. Zeros:

The zeros of the function occur when G(r) = 0. So we need to solve the equation:

-(r + 11)(r + 14) = 0

Since the product of two factors is zero when one or both factors are zero, we can set each factor equal to zero and solve for r:

r + 11 = 0 --> r = -11 (smaller r)

r + 14 = 0 --> r = -14 (larger r)

2. Vertex:

The function is given in factored form, which makes finding the vertex a bit easier. The vertex of a parabola in factored form is exactly between the two zeros.

Therefore, the x-coordinate of the vertex is:

(smaller r + larger r) / 2 = (-11 - 14) / 2 = -12.5

To find the y-coordinate (i.e., the function's value at the vertex), we can plug the x-coordinate of the vertex back into the function (G(r)). However, since the function is multiplied by -1, it might be easier to use one of the original zeros (say, r = -11).

G(-11) = -(-11 + 11)(-11 + 14) = 3 (notice how the negative sign cancels out)

Percent Increase



Example 1: Ann works in a supermarket for $10.00 per hour. If her pay is increased to $12.00, then what is her percent increase in pay?


Analysis: When finding the percent increase, we take the absolute value of the difference and divide it by the original value. The resulting decimal is then converted to a percent.

Answers

Answer:

20% increase

Step-by-step explanation:

Percent increase = (difference) / original *100 percent

                             = (12-10)/10 * 100percent

                             = 2/10 *100 percent

                             = 1/5 * 100 percent

                              =.2 * 100 percent

                              = 20%

Is (1, 2) a solution of the system y > 2x and x+y<3?
Select one:

a. Yes, because (1, 2) is a solution to both inequalities.

b. Yes, because (1, 2) is the point of intersection of the two boundary lines of
this system.

c. No, because (1, 2) is a solution to only one of these inequalities.

d. No, because (1, 2) is not a solution to either inequality.

Answers

Answer:

d

Step-by-step explanation:

To determine if (1, 2) is a solution to the system

Substitute x = 1, y = 2 into the inequalities and check their validity.

y > 2x → 2 > 2 ← incorrect statement

x + y < 3

1 + 2 < 3 → 3 < 3 ← incorrect statement

(1, 2) is not a solution to either inequality → d

NEED HELP ASAP!!
20 POINTS and please explain if you can.

Answers

Answer:

x = 12 or A

Step-by-step explanation:

Tangents from an exterior point to the circumference of a circle are equal

Since one of the tangents = 17, the other one must as well

x + 5 = 17            Subtract 5 from both sides.

x + 5-5 = 17-5

x = 12

The answer is A

15. Divide the polynomial x^3 + x^2 - 2x + 3 by (x - 1).​

Answers

Answer:

x² + 2x + [3\x - 1]

Step-by-step explanation:

Since the divisor is in the form of x - c, use what is called Synthetic Division. Remember, in this formula, -c gives you the OPPOSITE terms of what they really are, so do not forget it. Anyway, here is how it is done:

1| 1 1 -2 3

↓ 1 2 0

------------------

1 2 0 3 → x² + 2x + [3\x - 1]

You start by placing the c in the top left corner, then list all the coefficients of your dividend [x² + 5x - 36]. You bring down the original term closest to c then begin your multiplication. Now depending on what symbol your result is tells you whether the next step is to subtract or add, then you continue this process starting with multiplication all the way up until you reach the end. Now, when the last term is 0, that means you have no remainder, which in this case is a 3, so what you is set the divisor underneath the remainder of 3. Finally, your quotient is one degree less than your dividend, so that 1 in your quotient can be an x², 2 becomes 2x, and the remainder of 3 is set over the divisor, giving you the other factor of x² + 2x + [3\x - 1].

If you are ever in need of assistance, do not hesitate to let me know by subscribing to my channel [USERNAME: MATHEMATICS WIZARD], and as always, I am joyous to assist anyone at any time.

Ashley use 3 yards of ribbon to wrap these presents how many feet and rub it did actually how many inches did she​

Answers

Answer:

108 inches

Step-by-step explanation:

one yard = 36 inches

multiply 36 by 3

Answer:1 yd= 3 ft

12 inches= 1 ft

Set up a proportion:

1/3=3/x

1×3=3, so 3×3= 9 ft in 3 yds.

9/3=x/12

9×12= 108

9 ft and 108 inches

Each person in the vale family drinks 481/2 ounces of water a day how much water will each person drink in 7 days

Answers

Each person in the Vale family will drink a total of 339.5 ounces of water over the course of 7 days.

The student is asking how much water in ounces each person in the Vale family will drink over the span of 7 days if each person drinks 48.5 ounces of water daily.

To find the total amount of water consumed by one person in 7 days, we multiply the daily intake by the number of days:

48.5 ounces/day imes 7 days = 339.5 ounces

So, each person will drink a total of 339.5 ounces of water in 7 days.

dwight is 3 years older than twice his sisters age . how old is dwight (write the expression)​

Answers

Answer:

Step-by-step explanation:

let dwight represent x nd his sister represent y

y+3x2=x

Answer:

I did not know that Dwight Schrute has a sisterrrrr

Step-by-step explanation:

Um just the other dude brainliest

The length of a rectangular garden is represented by 3X -4 and the width is represented by 2X -5. Which of the following represents the total area of the garden

Answers

Answer:

6x^2 - 23x + 20

Step-by-step explanation:

Next time, please share all of the possible answer choices.

Here, A = (3x - 4)(2x - 5) = 6x^2 - 15x - 8x + 20, or

6x^2 - 23x + 20

Find the mean for each set of data. Round to the nearest tenth if necessary.
5, 10, 10, 20, 20, 5, 20, 20, 15, 15​

Answers

Answer:

14

Step-by-step explanation:

Mean = (5+10+10+20+20+5+20+20+15+15)÷10

= 140÷10

= 14

Drag the values to order them from least to greatest, with the least at the top.

Answers

Answer:

√143 = 11.958

√79+√63 = 16.825

4π = 12.66

Im pretty sure this is correct since I used a calculator. Hope it helps

what is the midpoint of the segment shown below? (2,3) (10,3)

Answers

Answer:

6,3 hope I helped. :) :)

The coordinates of the midpoint of the line segment that has endpoints (2,3) and (10,3) are (6,3).

What are the coordinates of the midpoint of the line segment AB?

Suppose we've two endpoints of a line segment as A(p,q), and B(m,n), then let the midpoint be M(x,y) on that line segment. Then, its coordinates are x =(p+m)/2 and y = (q+n)/2.

Given the endpoints of the line segment are A(-3,4) and B(-6,-1), then the coordinates of the midpoint will be,

x = (2+10)/2 = 12/2 = 6

y = (3+3)/2 = 6/2 = 3

Hence, the coordinates of the midpoint of the line segment that has endpoints (2,3) and (10,3) are (6,3).

Learn more about Midpoint:

https://brainly.com/question/5127660

#SPJ2

Convert 67,000 pounds to tons. Choose the words and numbers to complete the statements.

Answers

Answer: 33.5 tons

Direct conversion formula: 1 Tons (metric) / 2204.5855379189 = 1 Pounds

Opposite conversion: 67000 Pounds to Tons (metric)

Need help with this question in the image

Answers

Answer:

s     a

6    3

22  1

30  0

Step-by-step explanation:

Download song .50

Download album = 4

Let s = number of songs

a = number of albums

She can spend 15 dollars

.5s +4a =15

If she downloads 6 songs, let s=6

.5(6) +4a = 15

3+4a = 15

Subtract 3 from each side

3-3+4a = 15-3

4a = 12

Divide by 4

4a/4 =12/4

a=3

She can buy 3 albums

If she downloads 1 album, let a=1

.5(s) +4(1) = 15

.5s +4=15

Subtract 4 from each side

.5s +4-4=15-4

.5s = 11

Divide by .5

.5s/.5 = 11/.5

s = 22

She can download 22 songs

If she downloads 30 songs, let s=30

.5(30) +4a = 15

15+4a= 15

Subtract 15 from each side

15-15 +4a = 15-15

4a=0

a=0

Simplify the rational expression x^2-4/x^2+5x+6. State any restrictions on the variable.

Answers

Answer:

The correct answer is option B.

Step-by-step explanation:

The given rational expression is:

[tex]\frac{x^2-4}{x^2+5x+6}[/tex]

Factor the numerator and the denominator:

[tex]\frac{x^2-2^2}{x^2+2x+3x+6}[/tex]

Factor the numerator using difference of two squares and the denominator using factorization by grouping.

[tex]\frac{(x-2)}{x(x+2)+3(x+2)}[/tex]

[tex]\frac{(x-2)(x+2)}{(x+2)(x+3)}[/tex]

This function is defined if and only if the denominator is not zero.

That is: (x+3)(x+2)≠0.

x≠-2,x≠-3

We simplify now to obtain:

[tex]\frac{x-2}{x+3}[/tex]

The correct choice is the second option.

Option B is correct.

I just took the semester review.

The lions little league team drinks a gallon of Gatorade each game. Every player gets a cup as a serving. 1 cup =1/16 gallon. The last game, The lions only used 1/2 gallon of Gatorade. How many cups of Gatorade were served to the players during the last game?

Answers

Answer:

8 cups

Step-by-step explanation:

8/16 equals 1/2 gallon

The number of cups of Gatorade served to the players during the last game was 8 cups.

To solve the problem, we need to determine how many cups are in half a gallon, given that 1 cup is equal to 1/16 of a gallon.

First, we establish the conversion factor between cups and gallons:

1 cup = 1/16 gallon

Now, we need to find out how many cups are in 1/2 gallon. To do this, we multiply the amount of Gatorade used in the last game by the conversion factor:

Cups served = (1/2 gallon) * (16 cups / 1 gallon)

Performing the multiplication:

Cups served = 1/2 * 16

Cups served = 8 cups

Therefore, 8 cups of Gatorade were served to the players during the last game.

MARKING BRAINLEST HELP ASAP :))))))) SHOW WORK !!
The rectangle shown has a length of 3x+1 and a width of 2x.  Show your work. (3 points)

Find the perimeter.

Find the area.  

Find the perimeter and area if x=5.

Answers

Answer:

perimeter = 10x + 2

area = 6x^2 + 2x

perimeter = 52

area = 160

Step-by-step explanation:

perimeter = 2 * length + 2 * width

perimeter = 2(3x + 1) + 2(2x)

perimeter = 6x + 2 + 4x

perimeter = 10x + 2

area = length * width

area = (3x + 1)(2x)

area = (2x)(3x + 1)

area = 6x^2 + 2x

For x = 5:

perimeter = 10x + 2 = 10(5) + 2 = 50 + 2 = 52

area = 6x^2 + 2x = 6(5^2) + 2(5) = 6(25) + 10 = 150 + 10 = 160

An elevator in a hotel moves at 20 feet per second. leaving from the ground floor, its height in feet after t seconds is given by the formula h(t)=20t. A bolt comes loose in the elevator shaft above, and its height in feet after falling for t seconds is given by h(t)=-16t^2+200. At what time and at what height does the bolt hit the elevator?

Answers

Answer:

After 7.5 seconds and a height of 0

Step-by-step explanation:

The time taken for the bolt to hit the elevator is 3 seconds, at a height of 60 feet.

Given that the elevator height is h(t)=20t while the bolt height is given by h(t)=-16t² + 200.

At the point when the bolt hit the elevator, they would be at the same height, hence:

-16t² + 200 = 20t

16t² + 20t - 200 = 0

t = -4.2 or t = 3

Therefore the time taken for the bolt to hit the elevator is 3 seconds, the height is:

h(3) = 20(3) = 60 feet

The time taken for the bolt to hit the elevator is 3 seconds, at a height of 60 feet.

Find out more at: https://brainly.com/question/11600459

Find two fractions with a sum of 2/3 but with neither denominator equal to 3.

Answers

answer: 2/6 +2/6= 4/6 and 4/6 reduced down is 2/3 :)

The two fractions with a sum of 2/3 but with neither denominator equal to 3 is,  2/6 +2/6= 4/6 and 4/6 reduced down is 2/3.

What is fraction?

A fraction represents a part of a whole or, more generally, any number of equal parts. When spoken in everyday English, a fraction describes how many parts of a certain size there are, for example, one-half, eight-fifths, three-quarters.

here, we have,

2/3

= 4/6

=2/6 +2/6

Hence, The two fractions with a sum of 2/3 but with neither denominator equal to 3 is,  2/6 +2/6= 4/6 and 4/6 reduced down is 2/3.

To learn more on fraction click:

brainly.com/question/10354322

#SPJ2

A bag contains an orange tile, a yellow tile, and a purple tile. Two tiles are drawn randomly without replacement. If the first tile is yellow, find the probability of drawing a second tile that is orange.


PLEASE HELP ASAP IM TRYING TO GO TO RECESS LOL

Answers

Answer:

It's a 50% chance

Step-by-step explanation:

Answer:

1/3 most likely

Step-by-step explanation:

because you take out one tile and it only has one of each color so there are only three left so 1/3


Which statements are true about finding the volume of the soup cans? Check all that apply.
A) The diameter is squared to find the area of the base of a cylinder.
B) The volume is the area of the base times the height.
C) Given the radius or the diameter, you can calculate the area of the base of a cylinder.
D) The height of a cylinder is the distance between the 2 parallel bases.
E) The radius is half the distance of the height.

Answers

Answer:

the answers are B, C, and D.

Answer:

The given item soup can is a cylinder.

The volume of the cylinder is given as :

[tex]V=\pi r^{2} h[/tex]

Here 'h' is the height and 'r' is the radius.

So, the true statements are:

B) The volume is the area of the base times the height - The base of the cylinder is circular and the area of the circle is [tex]\pi r^{2}[/tex], so the volume is the area of base multiplied by height.

C) Given the radius or the diameter, you can calculate the area of the base of a cylinder - Yes as the area is [tex]\pi r^{2}[/tex] where 'r' is the radius.

D) The height of a cylinder is the distance between the 2 parallel bases. Yes this is right.

Jennifer's bill for 6 cans of grape juice and 4 cans of apple juice was $13.10. When she got home she found out that she should have bought 4 cans of grape juice and 6 cans of apple juice. Although she mixed up the order, she did save 60 cents. What is the cost per can of apple and grape juice
Solve the system using substitution and elimination.
Convert your equations to slope intercept form and identify the variables for your x and y axes. Then graph.
SHOW ALL WORK

Answers

Answer:

Part 1) The system is solved using elimination

The cost  per can of grape juice is [tex]\$1.19[/tex] and the cost per can of apple juice is [tex]\$1.49[/tex]

Part 2) The system is solved using substitution

The cost  per can of grape juice is [tex]\$1.19[/tex] and the cost per can of apple juice is [tex]\$1.49[/tex]

Part 3) The system is solved by graphing

The graph in the attached figure

Step-by-step explanation:

Part 1) Solve the system by elimination

Let

x----> the cost per can of grape juice

y----> the cost per can of apple juice

we know that

[tex]6x+4y=13.10[/tex] -----> equation A

[tex]4x+6y=13.10+0.60[/tex]

[tex]4x+6y=13.70[/tex]  -----> equation B

Solve the system by elimination

Multiply the equation A by -6 both sides

[tex]-36x-24y=-78.6[/tex] -------> equation C

Multiply the equation B by 4 both sides

[tex]16x+24y=54.8[/tex] -------> equation D

Adds equation C and equation D

[tex]-36x-24y=-78.6\\16x+24y=54.8\\----------\\-36x+16x=-78.6+54.5\\-20x=-23.8\\x=1.19[/tex]

Substitute the value of x in the equation A

[tex]6(1.19)+4y=13.10[/tex]

[tex]4y=5.96[/tex]

[tex]y=1.49[/tex]

therefore

The cost  per can of grape juice is [tex]\$1.19[/tex]

The cost per can of apple juice is [tex]\$1.49[/tex]

Part 2) Solve the system by substitution

Let

x----> the cost per can of grape juice

y----> the cost per can of apple juice

we know that

[tex]6x+4y=13.10[/tex]    

[tex]4y=-6x+13.10[/tex]

[tex]y=-1.5x+3.275[/tex] -----> equation A

[tex]4x+6y=13.10+0.60[/tex]

[tex]4x+6y=13.70[/tex]  

[tex]6y=-4x+13.70[/tex]

[tex]y=-(4/6)x+13.70/6[/tex]

[tex]y=--0.67x+2.28[/tex] -----> equation B

Substitute equation B in equation A and solve for x

[tex]-0.67x+2.28=-1.5x+3.275[/tex]

[tex]1.5x-0.67x=3.275-2.28[/tex]

[tex]0.83x=0.995[/tex]

[tex]x=1.19[/tex]

Find the value of y

Substitute the value of x in the equation A

[tex]y=-1.5(1.19)+3.275=1.49[/tex]

therefore

The cost  per can of grape juice is [tex]\$1.19[/tex]

The cost per can of apple juice is [tex]\$1.49[/tex]

Part 3) Solve the system by graphing

we have

[tex]y=-1.5x+3.275[/tex] -----> equation A

[tex]y=-(4/6)x+13.70/6[/tex] -----> equation B

Remember that

The solution of the system of equations is equal to the intersection point both lines

The solution is the point [tex](1.19,1.49)[/tex]

see the attached figure

therefore

The cost  per can of grape juice is [tex]\$1.19[/tex]

The cost per can of apple juice is [tex]\$1.49[/tex]

Which comparison is NOT correct?

2 > -3
-7 < -5
-9 < 1
0 < -4

Answers

2 > -3     (2 is greater than -3, this is true)

-7 < -5    (-7 is less than -5, this is true because -7 is more negative than -5)

-9 < 1       (-9 is less than 1, this is true)

0 < -4      (0 is less than -4, this is false because 0 is greater than -4)

Among the comparisons given, "0 < -4" is incorrect.

The student is asking which comparison is not correct. After evaluating each comparison, it becomes clear that 0 < -4 is not correct because 0 is not less than -4; in fact, 0 is greater. Other comparisons such as 2 > -3, -7 < -5, and -9 < 1 are all correct, as in each case, the number on the left side of the inequality is indeed larger (or smaller, for negative numbers) than the number on the right side as the symbol indicates.

To understand why 0 < -4 is incorrect, consider the number line where any number to the right is greater than the number to the left. Zero (0) lies to the right of any negative number, including -4, which means it is greater, not less.

when you save, you earn interest on your savings and even earn interest in the previous years interest what is the name for this type of interest brainly

Answers

Answer:

A

Step-by-step explanation:

The type of interest where you earn interest on your savings and even earn interest in the previous years interest is compound interest.

What is compound interest?

Compound interest is when both the amount saved and the interest already accured earn interest at the next date interest is being paid. Simple interest rate is the interest that is paid only on the amount saved.

To learn more about compound interest, please check: https://brainly.com/question/26367706

At a local company, the ages of all new employees hired during the last 10 years are normally distributed. The mean age is 31 years old, with a standard deviation of 10 years. If you were to take a sampling of 10 employees, what is the probability your mean age will be at least 28? Round to the nearest percent.

Answers

Answer:

The probability your mean age will be at least 28 is 83%

Step-by-step explanation:

Let X denote the ages of all new employees hired during the last 10 years , then X is normally distributed with;

a mean of 31

a standard deviation of 10.

The sample size obtained is 10 employees. This implies that the sampling distribution of the sample mean will be normal with;

a mean of 31

a standard deviation of [tex]\sqrt{10}[/tex]

The sample mean is a statistic and thus has its own distribution. Its mean is equal to the population mean, 31 and its standard deviation is equal to [tex]\frac{sigma}{\sqrt{n} }[/tex]

where sigma is the population standard deviation, 10 and n the sample size which in this case is 10. [tex]\frac{10}{\sqrt{10} }=\sqrt{10}[/tex]

We are required to find the probability that this sample mean age will be at least 28;

P(sample mean ≥ 28)

Since we know the distribution of the sample mean we simply standardize it to obtain the z-score associated with it;

P(sample mean ≥ 28)

= [tex]P(Z\geq \frac{28-31}{\sqrt{10} } )=P(Z\geq -0.9487)[/tex]

=0.8286

As a percentage this is equivalent to, 83%

A basketball player makes half of his 3 throws. What are the chances he will make his next free throw?

Answers

I think it would be 50%

What is the solution for the following system of linear equations? Give your answer in the form of an ordered pair.

3x + 2y = 5
4x − 9y = −5

Giving brainliest + 30 points!

Answers

Answer:

(1,1)

Step-by-step explanation:

3x + 2y = 5

4x − 9y = −5

Multiply the first equation by 4 and the second equation by -3 so we can eliminate x

4(3x + 2y) = 5 *4

Distribute

12x +8y = 20

-3(4x − 9y) = −5*-3

-12x +27y = 15

Add the two new equations together

12x +8y = 20

-12x +27y = 15

------------------------

35y = 35

Divide by 35

35y/35 = 35/35

y=1

Now we can find x

3x+2y =5

3x+2(1) =5

3x +2 =5

Subtract 2 from each side

3x+2-2=5-2

3x=3

Divide by 3

3x/3 = 3/3

x=1

(1,1)

Please help!!!

Use the equation below to find y, if m=8,x=4, and b=6
Equation: y=mx-b

Answers

Answer:

y=26

Step-by-step explanation:

We just subsitiute.

y=8(4)-6

8*4=32

y=32-6

y=26

Help needed !!! Use synthetic division to find the quotient and remainder!!!

Answers

For this case we must build a quotient that multiplied by the divisor, is eliminating the terms of the dividend until you reach the remainder of the division. It must be fulfilled that:

Dividend = Quotient * Divider + Remainder

Answer:

See attached image

Option D

Given: Ray BC bisects angle ABD.

Which pair of angles must be congruent?
A) ∠ABD & ∠EBD
B) ∠ABC & ∠DBE
C) ∠ABC & ∠DBC
D) ∠ABD & ∠CBDill mark brainliest if correct and give 50 pts.

Answers

Congruent is the same size and same shape. When a ray bisects an angle, the two newly created angles will be congruent, since the ray went right in the middle of the first angle (so in this case, ABC and DBC will be congruent)

Answer: C) ∠ABC & ∠DBC

Step-by-step explanation:

When a ray bisect an angle , then it divided the original angle into two congruent angles.

We are given that Ray BC bisects angle ABD.

Then, Ray BC divides ∠ABD into two congruent angles.

From the picture, The angle formed by it : ∠ABC & ∠DBC

So  ∠ABC & ∠DBC must be congruent.

Hence, the pair of angles must be congruent : ∠ABC & ∠DBC

Other Questions
I NEED ANSWER BY TODAY1. (1) I stood offstage. (2) I felt nervous. (3) I was prepared for the audition. (4) Still, I felt nervous. (5) I always do. (6) It doesn't matter whether the part is large or small, whether I know the director or not, or whether I am having a good day or a bad one. (7) I always feel nervous before I go onstage. (8) Then I actually step onstage, and I relax. Which sentence in the paragraph uses parallel structure?a. sentence 1b. sentence 3c. sentence 5d. sentence 62. Use your understanding of the Latin root -aud- to choose the meaning of the phrase an audible sigh.a. a sigh that shows sad feelingsb. a sigh showing fear or anxietyc. an easily heard sighd. a sigh that hides other emotions3. udging from the meaning of the Latin root -script-, choose the place where you would most likely find a postscript.a. in the stage directions of the written version of a dramatic playb. at the end of a letter, after the body and signaturec. in a sidebar of warnings about how to operate heavy machineryd. as part of the instructions in a computer manual The perimeter of a basketball court is 84 meters and the length is 6 meters longer than twice the width. what are the length and width? Find the perimeter of a triangle with sides measuring 5 centimeters , 9 centimeter, and 11 centimeters Freddy does not know why his wife seems so angry and upset. he decides not to say anything to her, according to rebt, freddy express 45 minutes as a fraction of 1 hour Simplify dont show your work got it Which of the following is csc(-166) equal to?csc(14)-csc(14)-csc(-14)csc(166) What is the approximate measure of this angle? Why was the Tennis Court Oath a significant event of the French Revolution? In which way is biomass similar to fossil fuels? Which figure shows how a shape can be rotated about an axis to form a hemisphere? What is Wiesel's primary purpose in "The Perils of Indifference"?A. To tell the story of Wiesel's experiences in the concentration camps B. To thank the president for inviting Wiesel to speak at the White HouseC. To ask people to do something when they see human sufferingD. To ask people to remember what happened during the Holocaust how can personal biases and points of view influence historians when they are studying evidence What is the 6th value in the sequence with the explicit formula an= 2n14? If a media message shows favoritism it is considered to be Pacific Islanders today are working to improve their economies through all of the following areas except ___________.agriculturecomputer technologytourismfishing The sea labeled with the number 7 on the map above is the __________ Sea.A.Baltic SeaB.Bering SeaC.Sea of JapanD.Sea of Okhotsk What was Pizarros strategy for conquering the Inca?A. Create a peace agreement with AtahualpaB. Launch a surprise attack on the Inca capitalC. Allow the Inca to continue to rule themselves name this song if you take to long to hit me back i cant promise you how i will react Joe ran 3 miles yesterday and wanted to run at least 12 miles this week. Write an inequality that can be used to determine the additional number of days joe must run this week if each run is 3 miles. Then solve the inequality .