Answer:
At the bottom of the sequence
Explanation:
According to the "principle of superposition of strata", the oldest rocks are formed at the bottom of sedimentary rock sequences.
The oldest rock layer would contain the the oldest fossil. Weathering, erosion, transportation and deposition would bring all sediments which includes rock materials and remains of living organisms to the basin where they would be lithified to form sedimentary rocks. This makes the oldest fossil to be at the bottom of the sequence. As time progresses, the fossil sequence would continue to accumulate and young upwards as the strata becomes relatively younger. Also, we know that fossils succeed one another in a definite manner.
This why relative dating of rocks can be possible.
explain the concept of conservation of natural resources
Answer:
The Earth's natural resources include air, water, soil, minerals, fuels, plants, and animals. Conservation is the practice of caring for these resources so all living things can benefit from them now and in the future.
Answer:
he or she is right
Explanation:
Waianapanapa Beach in Hawaii is a black-sand beach that was formed by
waves crashing against volcanic rock. The sand can be very hot on sunny
days. Which statement best explains why?
O
A. The black sand has no heat capacity.
B. The black sand absorbs no radiation.
O
C. The black sand is immune to insolation.
D. The black sand has a low albedo.
Answer:
The black sand has a low albedo.- D.
Answer:
d
Explanation:
good luck
which is an example of a decomposer?
A. Bear
B.Algae
C.Grass
D.Bacteria
Answer: D Bacteria
Answer:
D.Bacteria
Explanation:
A & B are primary producers
D is a secondary consumer
The answer is D. Bacteria.
Bacteria breaks down dead organisms, keeping our planet from being buried in dead organisms. Thus, bacteria bear and important task in being a decomposer.
Hope this helps!
This is the amino acid cysteine. Circle the amine group, put a box around
the carboxylic acid group and use a different colored pencil/pen to circle the side
chain (R group).
H O
| ||
NH2— C- C-OH
|
CH2
|
SH
The amine group in cysteine is NH₂ found on the left side of the molecule. The carboxylic acid group is COOH found on the right side of the molecule. The R group or side chain in cysteine is CH₂-SH.
Explanation:The amine group in an amino acid is the part of the molecule that contains nitrogen (NH₂). In the case of cysteine, this would be on the left side of the molecule. You can circle this part. The carboxylic acid group is the part of the molecule that contains a carbon atom double-bonded to an oxygen atom and also bonded to a hydroxyl group (C-OH). In cysteine, this would be towards the right side of the central carbon. You can put a box around this. The R group, or side chain, is different for each different amino acid. For cysteine, this is composed of a carbon atom bonded to a sulfhydryl group (CH₂-SH). You can use a different color to circle this part.
Learn more about Amino acid groups here:https://brainly.com/question/33427968
#SPJ2
Halogens are destructive to ozone because they are highly reactive with oxygen. Please select the best answer from the choices provided T F
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Which is a function of nucleic acids
Answer:
Nucleic acids are important because they make up genetic information in living things. There are two types of nucleic acid and they are DNA and RNA. DNA is the basic instructions for living things. It is passed down from parent to offspring and is found in the nucleus of the cell.
Explanation:
Answer:
store genetic information
Explanation:
Which step of the scientific method relies more heavily on newly collected data than on creativity and innovation?
drawing a conclusion
designing an experiment
solving a problem
formulating a question
Answer:
The best possible answer is: Drawing a conclusion.
Explanation:
in orde to write a conclusion report on an experiment you need the data collected from the experiment. Designing the experiment requires too much trial and error. formulating the question is purely a made up idea until tested. However, solving a problem depends on wether it is after the experiment or during. If it is after than you are most likely using information from the experiment, in this case it could be the right answser. If it is during then the it is about what you can do to fix something that went wrong in the experiment. I hope this helps you!
What is the most likely explanation for how speciation occurs
Answer:
when populations of a species that share the same habitat become reproductively isolated from each other.
Explanation:
Answer:
Natural selection is one explanation how speciation occurs.Explanation:
Natural selection is a key mechanism of evolution, in which survival and reproduction differences affects the evolution process.
It's important to say that Natural Selection is related with only phenotype's act, because it's due to environmental changes, adapting to those variables in order to survive.
ext ©
Introduction to Biology: Mastery Test
How is a scientific law different from a scientific theory?
OA.
A theory becomes a law after a long period of time has passed.
OB.
A theory is used for biology and chemistry and a law is used for physics.
HEEGES
U
C.
A theory is why something happens and a law is how something happens.
Co
Island
SA
BO
D.
A theory cannot be disproved but a law can be disproved.
nit
ES
A scientific law describes a generalized pattern in nature and is often expressed as a mathematical equation, while a scientific theory provides a comprehensive explanation for a group of related phenomena. Scientific laws describe what happens, and theories explain why and how it happens.
Explanation:The difference between a scientific law and a scientific theory is a fundamental aspect of scientific knowledge. A scientific law uses concise language to describe a generalized pattern in nature that is supported by scientific evidence and repeated experiments, often expressed in the form of a mathematical equation. In contrast, a scientific theory is a well-supported explanation of observations; it is more complex and dynamic, explaining a group of related phenomena rather than describing a single action. For instance, Newton's second law of motion, which can be summarized by the equation F = ma, is an example of a scientific law, while the Theory of Evolution is an example of a scientific theory.
Therefore, option C, stating that a theory is why something happens and a law is how something happens, accurately reflects the difference between a scientific law and a scientific theory. Scientific laws describe what happens under certain conditions in nature, often mathematically, while theories provide the explanation behind these observations, elaborating on why and how the phenomena occur.
Which organelles are found only in plant cells?
Answer:
c) cell wall , vacuole
Explanation:
An organism’s allele combination is called the
Answer:genotype
Explanation:
Answer:
Genotype
Explanation:
Got it correct on ck12
A graph______________.
check all that apply
is a visual representation of any differences or changes among groups
helps the reader understand statistic/results
is a type of statistic
is rarely based on actual data
is just a picture, and does not convey information regarding data
Answer:
your answer is the 1st & 2nd choice.
Explanation:
A graph is meant to illustrate the differences between 2 mediums. It could involve company sales, customer satisfaction between different years of production.
The Graph could be a visual representation of any differences or changes among groups that helps the reader understand statistics/results and sort of statistics.
The correct statement that defines the graph is the visual representation and kind of statistics.
Graph-
A diagram (such as a series of 1 or more points, lines, line segments, curves, or areas) that represents the variation of a variable as compared thereupon of 1 or more other variables.
The definition of a graph may be a diagram showing the relationships between two or more things.
An example of a graph could be a chart (mathematics) A diagram displaying data, particularly one showing the connection between two or more variables; specifically, for a function, the set of all tuples.
Thus, options A and B define the graph that is the visual representation of any differences or changes among groups and a type of statistics.
Learn more about the graph:
https://brainly.com/question/14375099
which of the following is the most likely outcome of global warming
Answer:
Ongoing effects include rising sea levels due to thermal expansion and melting of glaciers and ice sheets, and warming of the ocean surface, leading to increased temperature stratification. Other possible effects include large-scale changes in ocean circulation.
Explanation:
Match the following items
1. Rr
2. rr
3. Identical alleles
4. Unlike alleles
5. RR
()homozygous, recessive
()homozygous definition
()heterozygous, dominant cell
()heterozygous definition
() homozygous, dominant cell
Answer:
2. homozygous, recessive
3. homozygous definition
1. heterozygous, dominant cell
4. heterozygous definition
5. homozygous, dominant cell
Explanation:
What causes upwelling?
Explanation:
Upwelling is a oceanographic phenomenon. It is a process which results in the replacement of warm and nutrient less water with the cold and nutrient enriched water at the surface of oceans, seas, etc. As a result of this process, the surface water rises. The phenomenon behind this process is that the high intensity winds move the cold water from the middle of the ocean or sea towards the surface of the ocean or sea replacing the warm water which was present there. Due to this process, the nutrient enriched water reaches the surface of the oceans and seas.
(Wind) should be your answer
(APEX)
What might geneticists learn about genes by studying rna.
by studying RNA, geneticists could learn about where genes begin and end on a chromosome. they could also learn about where genes are active in different types of the cells.
By studying RNA, geneticists can learn about gene expression patterns, how changes in RNA can affect these patterns, and gain insights into the complex genetic code that defines each protein sequence. RNA's roles in transcribing DNA and translating it into proteins are also significant areas of understanding.
Explanation:Geneticists can gain a wealth of knowledge about genes by studying RNA, particularly regarding gene expression. RNA stands for ribonucleic acid, a molecule that plays a crucial role in the process of transcribing the genetic instructions inscribed on DNA and translating them into proteins. Each protein sequence is determined by a three-nucleotide sequence in RNA called the triplet codon, effectively forming a genetic code.
By studying RNA, geneticists can discern patterns in gene expression and even predict how changes in specific DNA or RNA sequences could potentially alter this expression. For instance, the Human Immunodeficiency Virus (HIV) is an RNA virus that uses its RNA as a template to create DNA, demonstrating a deviation from the standard genetic flow of information. This highlights the importance of RNA in the realm of genetics and why its study is so vital to understanding the complex interplay of genetic expressions in living organisms.
Learn more about RNA here:https://brainly.com/question/25979866
#SPJ3
Match the following. 1. the process involving the division of the nucleus in a reproductive cell; responsible for genetic recombination meiosis 2. the process involving the division of the nucleus of a body cell ovum 3. the condition of having oogametes—gametes of different sizes and shapes; usually have eggs and sperm sexual reproduction 4. (pl. ova) the egg cell; a female gamete oogamy 5. the form of production of new individuals by two parents in which the offspring obtains half of its hereditary information from each parent mitosis 6. a small, flagellated male gamete that swims to the egg to fertilize it sperm
Answer:
1. Meiosis: The process involving the division of the nucleus in a reproductive cell...
2. Mitosis: the process involving the division of the nucleus of a body cell
3. Oogamy: the condition of having oogametes...
4. Ovum: the egg cell...
5. Sexual Reproduction: the form of production of new individuals by two parents....
6. Sperm: a small flagellated male gamete...
Explanation:
1. Meiosis is a type of cell division that produces gametes, or reproductive cells. The process produces haploids, which have half the number of chromosomes as the parent. Genetic recombination occurs in meiosis, where there is an exchange of genetic information between the chromosomes, which bring about genetic diversity.
2. Mitosis is also a type of cell division, but unlike in meiosis, they produce clones of the parent cell. They produce diploids and this occurs in body cells. The purpose of mitosis is for growth, repair and asexual reproduction.
3. Oogamy is a form of sexual reproduction. What you would observe with oogamy is that one sex cell or "gamete" is bigger than the other gamete and the bigger gamete is non-motile or it can't move, while the other can. The egg cell for example is larger than the sperm cell, but it cannot move, while the sperm cell can.
4. The female gamete is called the ovum, plural form would be ova. This is also known as the egg cell. It is non-motile, so that means it cannot move. It's main purpose is to be fertilized by the sperm cell.
5. Sexual reproduction is the fusion of two gametes, which produces a fertilized egg, or a zygote. These gametes are haploid cells, which are produced in meiosis, and they each have half the genetic information of their parent cell. Thus the offspring produced will be genetically different from their parents.
6. The sperm cell is the male gamete. It has a flagella, which is like a tail that helps it move. It's main purpose is to fertilize an egg cell.
1.Meiosis
2.Mitosis
3.Oogamy
4.Ovum
5.Sexual Repoduction
6.Sperm
Question 8 (5 points)
Radioactive elements comprise a majority of the____
actinides
halogens
lanthanides
noble gases
Radioactive elements comprise a majority of the "ACTINIDES"
These are elements in the bottom row of the periodic table.
Answer: Option A. actinides
Explanation:
Radioactive element is an element whose nucleus degenerate spontaneously due to the emission of alpha and beta particles, or gamma rays.
Radioactive elements are majorly comprise of Actinides.
Actinides also called actinoids, all are radioactive elements and release energy on radioactive decay. Uranium and thorium are naturally occurring whereas plutonium are synthetic actinides which are most abundant actinides on Earth.
Hence, the correct option is A.
Which three steps describe how an animal obtains and uses energy for growth?
First, an animal eats another organism. Then, food is built into larger molecules. Next, the animal's cells use molecules to
make new cells.
First, food is built into larger molecules. Then, the animal eats another organism. Next, the animal's cells use molecules to
make new cells.
First, an animal eats another organism. Then, food is broken down into smaller molecules. Next, the animal's cells use
molecules to make new cells.
First, food is broken down into smaller molecules. Then, the animal eats another organism. Next, the animal's cells use
molecules to make new cells.
Answer:
Your answer will be : option (C)
First, an animal eats another organism. Then, food is broken down into smaller molecules. Next, the animal’s cells use molecules to make new cells.
Explanation:
Growth can be defined as the increase in the size and change in shape of a developing organism that directly depends upon the increase in the number and size of the cells that makes up an organism.
First, an animal eats another organism. Then, food is broken down into smaller molecules. Next, the animal’s cells use molecules to make new cells are three steps which describes how animals obtains and uses energy for growth because it directly related to the definition of growth in an organism.
Answer:
Explanation:
First an animal eats another organism;
its body digests the nutrients and the mollecules;
the mollecules are used by the body to generate energy to grow
Genes that come together with different alleles are called______.
heterozygous.
homozygous.
genotype.
segregated.
Answer:
Genes that come together with different alleles are called heterozygous. ( first choice)
When listing the levels of organization in organisms from smallest to most complex, which level is just below organs in
complexity?
Answer:
tissues
Explanation:
I hope this helps you.
Which statement about the pancreas is not true?
A. It is an endocrine organ in the abdomen.
B. It release chemicals into the digestive system.
C. It releases insulin to increase glucose levels.
D. It release hormones into the bloodstream.
The incorrect statement is C, stating that insulin is released to increase glucose levels. Insulin actually helps to lower blood glucose levels by encouraging cells to absorb glucose.
Explanation:The statement about the pancreas that is not true is: C. It releases insulin to increase glucose levels. The pancreas indeed functions as both an endocrine and exocrine gland. As an endocrine gland, it releases hormones like insulin and glucagon into the bloodstream. Insulin's role is to decrease blood glucose levels by facilitating the uptake of glucose into cells. Conversely, glucagon works to increase blood glucose levels by stimulating the liver to convert glycogen to glucose.
As an exocrine gland, the pancreas secretes digestive enzymes into ducts that lead to the gastrointestinal tract, aiding in the digestion of food. Moreover, the pancreas produces bicarbonate to neutralize the acidity of the contents entering the small intestine from the stomach.
New generations are better suited to their environment than the first generation. What is this called?
Answer:
Descent with modification
Explanation:
We define evolution as descent with modification from a common ancestor.
Evolution only occurs when there is a change in gene frequency within a population over time. These genetic differences are hereditary and can be passed on to the next generation - which is what really matters in evolution: long-term change. In this process, the new generations are better suited to their environment than the first generation because of descent with genetic modification.
Final answer:
New generations are better suited to their environment than the first generation due to evolution by natural selection. Individuals with advantageous traits tend to survive, reproduce, and pass these traits to their offspring, leading to better adapted future generations.
Explanation:
The phenomenon where new generations are better suited to their environment than the first generation is known as evolution by natural selection. This process occurs because the members of a population have genetic variability, which results in some individuals having traits that give them a biological advantage in specific environmental conditions. These individuals are more likely to survive and reproduce, passing on these advantageous traits to their offspring. Over time, these traits become more common within the population, making future generations progressively better adapted to their environment.
what effects would el nino most likely have on organisms?
El Niño would lead to the death of organisms or populations, El Niño would cause organisms to move in search of food and better conditions.
Hello. This question is incomplete. The full question is:
"What effects would el niño most likely have on organisms? check all that apply :
el niño would lead to the extinction of a species. el niño would lead to the death of organisms or populations. el niño would cause changes in the genetic makeup of organisms, el niño would cause continents to move to different parts of the planet. el niño would cause organisms to move in search of food and better conditions."
Answer:
El Niño would lead to the death of organisms or populations. El Niño would cause organisms to move in search of food and better conditions.Explanation:
El Niño is a climatic phenomenon that has many effects on nature. Basically, this phenomenon is characterized by the promotion of trade bliss from the east towards the west. When this occurs, the result is an accumulation of hot water in the upper layer of the Pacific oceans. With the increase in water temperature, evaporation becomes much higher than normal, forming large clouds laden with water vapor in this region, which will result in a strong rainy season.
El niño can affect the fauna of this region in a great way, some examples that can happen are:
El Niño would lead to the death of organisms or populations. El Niño would cause organisms to move in search of food and better conditions.why does competiton happen?
A: Different organisms have different needs
B: There are limited resources in an ecosystem
C: There are no predators in an ecosystem
D: Organisms do not need the same resources
(I think it's B but I'm not sure)
Which part of a cell carries the genetic material? Cell membrane Cell wall Chloroplast Nucleus
Answer:
nucleus carries the genetic material
What is the typical source of well water?
A. A holding tank
B. A discharge zone
C. A geyser
D. An aquifer
Answer:
an aquifer
Explanation:
Select the words that correctly complete the statement.
_____ is an example of optimal health. To gain optimal health, the first step is to ______
1 ) the absence of disease
1) a high protein diet
1) sufficient sleep
1) taking a variety of vitamins and mineral supplements
1) the perfect body
2) eat healthy
2) establish practical goals
2) establish priorities
2) establish realistic goals
2) improve intellectual health
The absence of disease is an example of optimal health. To gain optimal health, the first step is to eat healthy.
According to the question;
We are required to select the words that correctly complete the statement.For the first blank space;
A very good indicator of optimal health is; The absence of disease.For the second blank space:
To gain optimal health, it is pertinent that one eats healthy.Read more:
https://brainly.com/question/20519649
where do the respiratory and circulatory systems meet?
Answer:
B
Explanation:
why a red blood cell burst when placed in water yet an onion epidermal cell does not?
Answer:
Hope it helps
Explanation:
The oncotic pressure inside the cell will be greater than the pressure outside. Thus causing the cell membrane to rupture. If red blood cells are placed in pure water, water enters into the red blood cells by osmosis and the red blood cells swell up and burst while the onion cells would absorb water due to osmosis, swell and become turgid.The cell sap move conc. than surrounding water gate into the cell by osmosis; the cell swells/becomes turgid; but does not burst due to the cell wall.