If 3 tons of flower bed mulch cost $480, what is the price per pound?

Answers

Answer 1
1 ton = 2,000 pounds 
3 tons = 6,000 pounds
$480/6,000 = 0.08 
per pound is $0.08

Related Questions

A bag contains 90 marbles some red and some transparent the ratio of red marbles to transparent ones is 1:4. how many red marbles are there? andwer

Answers

18 red marbles because add the ratio togather which is 5 and divide 90 by 5=18 for 1

There are 5 slots, each containing the letters w, r, l, d or o. one letter is picked at random from each slot. what are the odds that the letters stored in these slots read the word world?

Answers

In the first slot lets calculate the chance of getting a w: 1/5

In the second slot calculate the chance of getting a o: 1/4 (notice how it's 4 not 5 because you already have one letter in the first slot so you have 4 left to choose from.)

In third slot, chance of getting a r: 1/3

In fourth slot, chance of getting a l: 1/2

In the fifth slot, if you got all the first four letters right, than you would be left with one letter, so your chances are 1/1 (100%) for the fifth slot



To calculate probability multiply all the fractions we got above: 1/5 x 1/4 x 1/3 x 1/2 x 1/1

We will then get: 1/(5x4x3x2x1) = 1/120

1/120 is the probability of the 5 slots showing the word "world"
Final answer:

The probability of the 5 letter slots randomly making the word 'world' is calculated by finding the product of the probability of choosing each letter correctly, which for this problem, is (1/3125).

Explanation:

To calculate the probability of picking the letters 'w', 'o', 'r', 'l', 'd' in that order, we understand that we are dealing with a probability problem regarding independent events. This scenario means that the outcome of each selection does not affect the others.

Here, each slot contains 5 distinct letters. The probability of picking a specific letter correctly is 1/5 (1 way to pick a correct letter divided by 5 total letters). So, the probability of picking each letter correctly and in the order of 'world' is the product of the probabilities of choosing each letter correctly i.e P(choosing all five correct letters) = P(choosing 1st correctly) X P(choosing 2nd correctly) X P(choosing 3rd correctly) X P(choosing 4th correctly) X P(choosing 5th correctly) = (1/5) X (1/5) X (1/5) X (1/5) X (1/5) = (1/3125).

Learn more about Probability here:

https://brainly.com/question/32117953

#SPJ12

Emily bought a video game console and some games for $350. The video game console cost $200. Each game cost $25. How many games did Emily purchase?

Answers

300-200=150
25x6=150
so the answer is she bought 6 games

Solve for x.

2/5≤x−4

Answers

x >=(22)/(5) Is the answer
   
2/5 ≤ x - 4

Add 4 to both sides.

2/5 + 4 ≤ x 

Simplify.

4 2/5 ≤ x

AND 

x ≥ 4 2/5

~Hope I helped!~

Charlie's father is 41 years old. His age is two years more than three times Charlie's age. What is Charlie's age?

Answers

41 - 2 is 39
39 divided by 3 is 13
Charlie is 13 years old

Final answer:

By setting up a linear equation, it is determined that Charlie is 13 years old based on the given information that his father is two years more than three times Charlie's age and is 41 years old.

Explanation:

The problem presented is a classic example of a linear equation in the subject of mathematics. We are given that Charlie's father is 41 years old, and his age is two years more than three times Charlie's age.

To determine Charlie's age, we can set up the equation as follows: Let x represent Charlie's age. The father's age is then described by the expression 3x + 2.

Since we know the father is 41 years old, we have:

3x + 2 = 41

Subtract 2 from both sides of the equation to isolate the terms with x:

3x = 39

Now, divide both sides by 3 to solve for x:

x = 39 / 3

x = 13

Therefore, Charlie is 13 years old.

The width of a rectangle is equal to m cm, but its length is five times greater than the width. Find the area of the rectangle.

Answers

width= m
length= 5m

Area= l×w
Area= 5m×m
Area=5m^2
(^=exponent)

The area will be 5m^2

Your Bank account balance was $235 and 24. After two checks were cashed (each for the same amount) your balance is now -45.58. What was the amount of each of those checks?

Answers

235.24 + 45.58 = 280.82

280.82/2 = 140.41

each check was for $140.41

How to find the width of a rectangular prim
n when the length is 6 cm height is 8 cm and surface area is 208 cm²

Answers

Sent a pic of the solution (s).

A carpenter has a 6-foot long board. He wants to cut the board into pieces that are 4/5 foot long. How many pieces of length 4/5 foot can the carpenter cut from the board? What length of the original board will be left after the carpenter has cut all the pieces that are 4/5 foot long?

Answers

Ok so take 6 divided by 4/5 or 6 x 5/4 = 7.5 but you don't want .5 of a board so you will have 7 boards and 0.4 feet of board left over because half of 4/5 is 0.4

Answer:

Number of pieces=7

Length of board remaining=[tex]\frac{2}{5}[/tex]

Step-by-step explanation:

We are given that a carpenter has board of length=6 foot

Length of each piece of board=[tex]\frac{4}{5}[/tex] foot

We have to find the number pieces of given length of piece can be made from given board.

In order to find the number of pieces we will divide the total length of board by the length of each piece.

Therefore, number of pieces =[tex]\frac{6}{\frac{4}{5}}[/tex]

Number of pieces=[tex]7\frac{1}{2}[/tex]

Length of each piece =[tex]\frac{4}{5}[/tex]

Therefore, number of pieces=7

Length used in 7 pieces =[tex]7\times\frac{4}{5}=\frac{28}{5}[/tex]

Length of board remaining=[tex]6-\frac{28}{5}=\frac{2}{5}[/tex]

At a​ school, 126 students play at least one sport. This is 40​% of the students at the school. How many students are at the​ school?

Answers

126 + 60% (76) = 202 students
There are 315 students at the school. You can solve this multiple ways, but I made a proportion.   40%              100%
                                 ----      x         ------
                                126                  x

Find the dimensions of the rectangle with area 120 square inches and smallest possible perimeter

Answers

Here, A = L*W and P=2L+2W.  Maximize P.  Subst. L = A/W for L in the 2nd equation:

P=2(A/W) + 2W.  This is to be minimized.

dP/dW = 2[-A/(W^2)) + 2W.  But A = 120 sq in:

dP/dW = 2[-120/(W^2)) + 2W   set this equal to 0 and solve for W.
Once you have W, find L:  L=120/W

Let 2[-120/(W^2)) + W] = 0.  Then   [-120/(W^2)) + W] = 0

Multiplying all terms by W^2 gives us -120 + W^3 = 0.

w^3 = 120 cubic inches.  Find the cube root to find W.  

W = cube root of 120 = 4.93 inches.  L = 120/W, or L = 120/4.93 inches

Summary:  W = 4.93 inches and L = 24.33 inches   (answer)

suppose someone tells you that she has a triangle with sides having lengths 2.6,8.1 and 8.6. Is this a right triangle? why or why not? Is there an angle in the triangle larger than 90 degree?

Answers

If you're only provided with the lengths of a triangle, and you're asked to determine whether or not the triangle is right or not, you'll need to rely on the Pythagorean Theorem to help you out. In case you're rusty on it, the Pythagorean Theorem defines a relationship between the legs of a right triangle and its hypotenuse, the side opposite its right angle. That relationship is a² + b² = c², where a and b are the legs of the triangle, and c is its hypotenuse. To see if our triangle fits that requirement, we'll have to substitute its lengths into the equation.

How do we determine which length is the hypotenuse, though? Knowledge that the hypotenuse is always the longest length of a right triangle helps here, as we can clearly observe that 8.6 is the longest we've been given for this problem. The order we pick the legs in doesn't matter, since addition is commutative, and we'll get the same result regardless of the order we're adding a and b.

So, substituting our values in, we have:

(2.6)² + (8.1)² = (8.6)²

Performing the necessary calculations, we have:

6.76 + 65.61 = 73.96
72.37 ≠ 73.96

Failing this, we know that our triangle cannot be right, but we do know that 72.37 < 73.96, which tells us something about what kind of triangle it is. Imagine taking a regular right triangle and stretching its hypotenuse, keeping the legs a and b the same length. This has the fact of increasing the angle between a and b. Since the angle was already 90°, and it's only increased since then, we know that the triangle has to be obtuse, which is to say: yes, there's an angle in it larger than 90°.

All real numbers at least 3 units from -2

Answers

yes the are real 3 -2
Such numbers are divided into two sets.
The first set is (-infinity, -5].  All numbers in this set are 3 or more units from -2.
The second set is [1, infinity).  Same reasoning.
Drawing a diagram might help you understand this problem better.

a girl scout has (5x-12) boxes of cookies and sells (3x+18) of them. Write an expression to represent the amount of boxes she has left. Also can you show me the work that gets this answer not just the answer

Answers

You have to subtract 3x + 18 from 5x - 12:

=> 5x - 12 - ( 3x + 18) = 5x - 12 - 3x - 18 = 5x - 3x - 12 - 18 = 2x - 30

The first step was to apply distributive property to supress the parenthesis, after that the terms were arranged and the like terms combined.

Answer: 2x - 30

You are building a new house on a cartesian plane whose units are measured in miles. Your house is to be located at the point (2,0) . Unfortunately, the existing gas line follows the curve y= √(16 x^2 +5x+16). It costs 400 dollars per mile to install new pipe connecting your house to the existing line. What is the least amount of money you could pay to get hooked up to the system?

Answers

find the derivative of the equation to find its critical points. And the compute the distance from the house to the critical point (local minimum).However, I'm unable to compute the derivative. Kindly help with explanation.

9x-5y=-32 in slope intercept form

Answers

The slope intercept form of a linear equation has the following form where the equation is solved for y in terms of x:

y = a + bxb  is the slopea  is a constant term. It is the y intercept, the place where the line crosses the y axis.

 

Example 1

y = -13 + 7x

This equation is in slope intercept form. The y intercept is (0,-13) and the slope is 7.

Example 2

4x + 3y = 12

Rewrite this equation in slope intercept form.

3y = 12 - 4x

The equation is now in slope intercept form. The y intercept is (0,4) and the slope is
-4/3.

 

Example 3

5x - 3y - 15 = 0

Rewrite this equation in slope intercept form.

3y = -15 + 5x

The equation is now in slope intercept form. The y intercept is (0,-5) and the slope is 
5/3.

Example 4

The equation is now in slope intercept form. The y intercept is (0,-7.5) and the slope is 
1.5.

The time at which the mailman delivers the mail to ace bike shop follows a normal distribution with mean 2:00 pm and standard deviation of 15 minutes.

Answers

There are three questions related to this problem.


First, the probability of the mail will arrive after 2:30 PM


Find the z-score of 2:30 which is 30 minutes after 2:00.


z(2:30) = (2:30 – 2:00)/15 = -30/15 = -2


P(x < 2:30) = P(z<-2) = 0.0228


Second, the probability of the mail will arrive at 1:36 PM

Find the z-score of 1:36 which is 24 minutes before 2:00.


z(1:36) = (1:36 – 2:00)/15 = -24/15 = -1.6


P(x < 1:36) = P(z<-1.6) = 0.0548

 

Lastly, the probability of the mail will arrive between 1:48 PM and 2:09 PM


Find the z-score of 1:46 and 2:09 PM which will result to a z value of 0.034599


P(1:48 < x < 2:09) = P(z<0.034599) = 0.5138

Divide.
3 5/9 ÷ -2 2/3
Enter your answer as a mixed number, in simplified form, in the box.

Answers

-1 and 1/3 because you convert to a regular fraction and get (32/9)/(-8/3), then you flip the fraction and multiply

How did you calculate the price of each nickel to begin with? Thanks

Answers

Mike had a jar of nickels that had five more nickels than he originally thought. If the total amount of nickels was $4.35, how many nickels did Mike think he had originally?


The nickels in the jar are worth $4.35.
A nickel is worth $0.05.
To find the number of nickels in the jar, we divide $4.35 by $0.05.
$4.35/$0/05 = 87
There are 87 nickels in the jar.

He thought there were 5 nickels fewer.
87 - 5 = 82
He though there were 82 nickels.

If ( f ∘ g)(x) = x2 - 6x + 8 and g(x) = x - 3, what is f(x)?

Answers

[tex]\bf \begin{cases} (f\circ g)(x)=x^2-6x+8\\\\ (f\circ g)(x)=f(~~g(x)~~)\\\\ g(x)=x-3\\ \end{cases} \\\\\\ \textit{now, one probability is }x^2-1 \\\\\\ f(x)=x^2-1\implies f(~~g(x)~~)=(x-3)^2-1 \\\\\\ f(~~g(x)~~)=(x^2-6x+9)-1\implies f(~~g(x)~~)=x^2-6x+8[/tex]

Jessica is measuring two line segments. The first line segment is 30 cm long. The second line segment is 500 mm long. How long are the two line segments together? (answer in cm)

Answers

convert mm to cm

1mm = 0.1 cm

500 * 0.1 = 50cm

50 +30 = 80cm total length

chris has a bag of sweets. there are more than 20 sweets in the bag he shares his sweets equally between six people chris says, "the number of sweets in the packet was prime." is he correct? circle: yes or no, explain your answer below.

Answers

no, this is because a prime number is an uneven number. So it can not be prime.

Leo has 421 prize tickets. He can get 1 prize for every 100 tickets. How many prizes can Leo get? How many tickets will he have left over?

Answers

He can get 4 prizes and he will have 21 tickets left over.

421 / 100 = 4.21

 so he will win 4 prizes and have 21 tickets left over.

At one university, the students are given z-scores at the end of the each semester, rather than the traditional gpas. the mean and standard deviation of all students' cumulative gpas, on which the z-scores are based, are 2.7 and 0.5, respectively

Answers

The students with z-scores below -1.6 would be put on probation, and the corresponding probationary GPA is 1.9.

Given data:

To translate z-scores to corresponding GPAs, you can use the formula:

GPA = (z * standard deviation) + mean

Given:

Mean (μ) = 2.7

Standard Deviation (σ) = 0.5

Let's calculate the corresponding GPAs for the given z-scores:

For z = 2.0:

GPA = (2.0 * 0.5) + 2.7

= 1.0 + 2.7

= 3.7

For z = -1.0:

GPA = (-1.0 * 0.5) + 2.7

= -0.5 + 2.7

= 2.2

For z = 0.5:

GPA = (0.5 * 0.5) + 2.7

= 0.25 + 2.7

= 2.95

For z = -2.5:

GPA = (-2.5 * 0.5) + 2.7

= -1.25 + 2.7

= 1.45

Now, to determine the corresponding probationary GPA for z = -1.6:

GPA = (-1.6 * 0.5) + 2.7

= -0.8 + 2.7

= 1.9

Hence, students with z-scores below -1.6 would be put on probation, and the corresponding probationary GPA is approximately 1.9.

To learn more about z-score, refer:

https://brainly.com/question/15016913

#SPJ12

The complete question is attached below:

At one university, the students are given z-scores at the end of each semester rather than the traditional GPAs. The mean and standard deviation of all students’ cumulative GPAs, on which the z-scores are based, are 2.7 and .5, respectively.

- translate each of the following z-scores to corresponding GPA: z=2.0, z=-1.0, z=.5, z =-2.5.

- Students with z-scores below -1.6 are put on probation. What is the corresponding probationary GPA?

Brandon bought a gallon of paint that covers 160 square feet. He wants to paint a wall that is 10 ft. high and 12 ft. wide. Explain whether he will need more than one gallon of paint. A. No, he won't need more paint. Brandon has enough paint to cover the 22-square-foot wall. B. Yes, he will need more paint. Brandon needs another gallon to cover the 240-square-foot wall. C. No, he won't need more paint. Brandon has enough paint to cover the 120-square-foot wall. D. Yes, he will need more paint. Brandon needs enough paint to cover the 1,200-square-foot wall.

Answers

C. Brandon has enough paint to cover the 120 square-foot wall.

The soccer team voted on what they wanted to eat. There are 20 members on the team. Six members voted for pizza, 10 voted for chicken, and the rest voted for hot dogs. Which ratio represents the number of votes for hot dogs to chicken? 1/5 2/5 3/5 5/2

Answers

3/5 i believe :D (hope this helps)

The answer is 2/5 because hot dogs to chicken is 2/5


Show that for the same shear angle, there are two rake angles that give the same cutting ratio.

Answers

the answer to this question is a equilater triangule

What is the quotient?
-5 1/4 ÷ 2 3/4
Enter your answer as a mixed number, in simplified form, in the box.

Answers

- 5 1/4 ÷ 2 3/4 =

= - 21/4 ÷ 11/4

= - 21/4 * 4/11

= - 21/11

= - 1 10/11
Final answer:

To divide -5 1/4 by 2 3/4, convert both numbers to improper fractions, multiply the first fraction by the reciprocal of the second fraction, and simplify the result. The quotient is -1 10/11.

Explanation:

To divide -5 1/4 by 2 3/4, first convert both mixed numbers to improper fractions. -5 1/4 can be written as -21/4, and 2 3/4 can be written as 11/4. Next, divide -21/4 by 11/4. To divide fractions, multiply the first fraction by the reciprocal of the second fraction. So, (-21/4) * (4/11) = -21/11. This quotient can be written in mixed number form as -1 10/11, which is the simplified answer.

Learn more about Division of Mixed Numbers here:

https://brainly.com/question/17540081

#SPJ2

Is the expression 3x+2x−4 in simplest form

Answers

No, because you would have to simplify like terms. Which the simplest form would be
5x-4

3x+2x-4 is not in simplest form.

What is Expression?

An Expression is Combination of variables, numbers and operators.

The given expression is three x plus two x minus 4

i.e 3x+2x-4

It is not in simplest form because we have to add like terms.

In the above expression we have two terms of same variable.

We have to add 3x and 2x which gives 5x.

So 5x-4 is the simplest form.

Hence  3x+2x-4 is not in simplest form.

To learn more on Expressions click:

https://brainly.com/question/14083225

#SPJ2

△RST is mapped to △R′S′T′ using the rule (x, y)→(x, −y) followed by (x, y)→(3x, 3y) .

Which statement correctly describes the relationship between △RST and △R′S′T′ ?

△RST is congruent to △R′S′T′ because the rules represent a reflection followed by a rotation, which is a sequence of rigid motions.

△RST is congruent to △R′S′T′ because the rules represent a reflection followed by a translation, which is a sequence of rigid motions.

△RST is congruent to △R′S′T′ because the rules represent a rotation followed by a translation, which is a sequence of rigid motions.

△RST is not congruent to △R′S′T′ because the rules do not represent a sequence of rigid motions.

By the way, this question DOES NOT include a picture, so don't ask please.

Answers

The rule (x,y) --> (x,-y) reflects the triangle over the x axis. So far the triangle has not changed size at all. So the triangles are congruent.

However, when we use (x,y) --> (3x,3y), the triangle will get larger. Now the triangle is no longer congruent to the original.

So the answer is choice D. 

When they mention "rigid motions" they mean reflections and translations (aka vertical/horizontal shifts). Dilations are not rigid motions. They do not preserve size. 

Answer:

△RST is not congruent to △R′S′T′ because the rules do not represent a sequence of rigid motions.

Step-by-step explanation:

Other Questions
Unlike the kings and queens of England, monarchs in France Explain how a story about a dog might be an ideal way to explore the theme of how laws work. Include specific examples of dogs' traits and behaviors. Your answer should be at least one hundred and fifty words.What does it by saying the theme of laws? I need to understand that is all. Round 977.259856871 to 3 decimal places Amongst the Mayan peoples, painters were a part of the ____________.a.working classc.ruling classb.slave classd.lower classPlease select the best answer from the choices providedABCD Please Help Me. Use an identity to find the exact value of each expression: Note: You are not allowed to use decimals in your answer. sin(96)cos(264)+cos(96)sin(264)= and sin(258)cos(33)cos(258)sin(33)= Inner-city schools in american continue to have tremendous problems. approximately _____ of the high schools in the united states produce _____ of the country's dropouts. For 15 points The region or area you live today looks nothing like it did when first created. For years man has built new structures or modified the world around us in some way. Choose something around you or somewhere in the world and describe what man has done to modify the area and the change it has brought. (PLEASE HELP!!!)(47 POINTS!!!!!)in one to three paragraphs, compare and contrast the Amy Tan story, Two Kinds and Collier's "Marigolds". Discuss two differences and two similarities. Support your analysis with text evidence and MLA formatting for in text citations. Make one text to self connection about either story. Discuss the major functions of the lymphatic system City of pasadena in california in known for? A train leaves little rock, arkansas, and travels north at 70 kilometers per hour. another train leaves at the same time and travels south at 55 kilometers per hour. how long will it take before they are 375 kilometers apart? Identify the participle in the sentence.The idling engine sound fine to me now._______Is there a business future in manufactured houses, Dad?A: FutureB: IsC: housesD: DadPaying for the flute, Tammy smiled happily and skipped all the way home.A: none of the above B: smiled happilyC: all the way home D: Paying for the flute What specific nutrition guidelines has your school district put in place?Name at least three. Select the correct statement to describe when a sample of liquid water vaporizes into water vapor.A. Temperature decreases and molecular motion increases while shape becomes less defined.B. Temperature decreases and molecular motion decreases while shape becomes more defined.C. Temperature increases and molecular motion decreases while shape becomes more defined.D. Temperature increases and molecular motion increases while shape becomes less defined. Write an equation to represent: four-fifths of z added to six equals eightA) 4/5 z + 6 = 8 B) 4/5 + 6z = 8 C) 4/5 (6)(z) = 8 D) 4/5 (6) + z = 8 A fruit juice container holds 16 servings. If the servings size in 6 ounces, how many ounces does the container hold in all? How does the graph of g(x)=x+7 differ from the graph of f(x)=x?The graph of g(x)=x+7 is the graph of f(x)=x shifted right 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted up 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted left 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted down 7 units. who were the first hominids to walk upright? A. homo erectus B. homo habilis c. Australopithecus d. neanderthals In a cross-country race with a 35 participants, the mean finish time was 21 minutes . Which statement must be true ? Find the total capacity of twenty five containers of cranberry juice if each bottle holds 5 quarts 1 pint 6 oz A) 142 pints 6 oz B) 140 pints 6 oz C) 142 pints 9 oz D) 142 pints 1 pint 6 oz E) None Steam Workshop Downloader