How many solutions does -2(w+6)-6w=4(w+3) have???

Answers

Answer 1

Answer:

One solution

Step-by-step explanation:

Expanding the equation, we get

-2w-12-6w=4w+12

Subtracting 4w from both sides, we get

-12w-12=12

Now adding 12 to both sides,

-12w=24

Solving for w, we get

w=-2

So there is only one solution to the equation.


Related Questions

Write a function describing the relationship of the given variables.


A
varies directly with the square root of
r
and when
r
=
16
,
A
=
40



A
=

Answers

Answer:

The function is A = 10√r

Step-by-step explanation:

* Lets explain the meaning of direct variation

- The direct variation is a mathematical relationship between two

  variables that can be expressed by an equation in which one

  variable is equal to a constant times the other

- If Y is in direct variation with x (y ∝ x), then y = kx, where k is the

 constant of variation

* Now lets solve the problem

# A is varies directly with the square root of r

- Change the statement above to a mathematical relation

∴ A ∝ √r

- Chang the relation to a function by using a constant k

∴ A = k√r

- To find the value of the constant of variation k substitute A and r

 by the given values

∵ r = 16 when A = 40

∵ A = k√r

∴ 40 = k√16 ⇒ simplify the square root

∴ 40 = 4k ⇒ divide both sides by 4 to find the value of k

∴ 10 = k

- The value of the constant of variation is 10

∴ The function describing the relationship of A and r is A = 10√r

Answer:

A = 10[tex]\sqrt{r}[/tex]

Step-by-step explanation:

Given A varies directly with the square root of r then the equation relating them is

A = k[tex]\sqrt{r}[/tex] ← k is the constant of variation

To find k use the condition r = 16 , A = 40

k = [tex]\frac{A}{\sqrt{r} }[/tex] = [tex]\frac{40}{\sqrt{16} }[/tex] = [tex]\frac{40}{4}[/tex] = 10

A = 10[tex]\sqrt{r}[/tex] ← equation of variation

A circle is centered at N (-6 -2) The point E (-1, 1) is on the circle. Where does the point H (-10, -7) lie?

Answers

so we know the point E is on the circle, thus the distance NE is really the radius of the circle hmmm what would that be?

[tex]\bf ~~~~~~~~~~~~\textit{distance between 2 points} \\\\ N(\stackrel{x_1}{-6}~,~\stackrel{y_1}{-2})\qquad E(\stackrel{x_2}{-1}~,~\stackrel{y_2}{1})\qquad \qquad d = \sqrt{( x_2- x_1)^2 + ( y_2- y_1)^2} \\\\\\ \stackrel{radius}{r}=\sqrt{[-1-(-6)]^2+[1-(-2)]^2}\implies r=\sqrt{(-1+6)^2+(1+2)^2} \\\\\\ r=\sqrt{5^2+3^2}\implies r=\sqrt{34}\implies r\approx 5.83 \\\\[-0.35em] ~\dotfill[/tex]

[tex]\bf ~~~~~~~~~~~~\textit{distance between 2 points} \\\\ N(\stackrel{x_1}{-6}~,~\stackrel{y_1}{-2})\qquad H(\stackrel{x_2}{-10}~,~\stackrel{y_2}{-7})\qquad \qquad d = \sqrt{( x_2- x_1)^2 + ( y_2- y_1)^2} \\\\\\ NH=\sqrt{[-10-(-6)]^2+[-7-(-2)]^2} \\\\\\ NH=\sqrt{(-10+6)^2+(-7+2)^2}\implies NH=\sqrt{(-4)^2+(-5)^2} \\\\\\ NH=\sqrt{41}\implies NH\approx 6.4\impliedby \begin{array}{llll} \textit{units away from the center}\\ \textit{is outside the circle} \end{array}[/tex]

recall the radius is about 5.83, anything shorter than that is inside the circle, anything longer than that is outside it.

Answer:

outside the circle

Step-by-step explanation:

trust me. i did it on khan academy

The Transitive Property of Congruence allows you to say that if ∠PQR ≅ ∠RQS, and ∠RQS ≅ ∠SQT, then _____.


1.) ∠RQS ≅ ∠PQR


2.) ∠PQR ≅ ∠SQT


3.) ∠PQR ≅ ∠RQS


4.) ∠RQS ≅ ∠RQP

Answers

The answer would be 2. Angle PQR = Angle SQT

Hope it helps :)

Answer is 2 for sure Goodluck.

in a triangle, a 32° angle is between two sides of 6 feet and 8 feet. what is the length of the thrid side, in feet?​

Answers

Answer:

4.3 feet

Step-by-step explanation:

Which statement best describes the association between variable X and variable Y?

P.S: Not actually asking. Whole K12 test on Association and the Correlation Coefficient.

Answers

Not all heroes wear capes. Anyways thank you!

Answer:

thanks for this! <3

Step-by-step explanation:

I need help please. Quick.

Answers

It would be A.

All of the others include “Natural Numbers” -5 is not a natural number. A natural number is a counting number like 1,2,3,4,5.

Answer: I believe your answer is A.

hope you get 100%! ^.^

find the value of k for which one root of the quadratic equation kx2 14x 8 = 0 is 6 times the other

Answers

Answer:

k = 3.

Step-by-step explanation:

If the 2 roots are A and B we have the relations:

AB = 8/k and A+B = -14/k.

We are given that A = 6B so

6B^2 = 8/k

B^2 = 8/6k = 4/3k

B = 2 /√(3k) ......(1)

Now A + B = -14/k so

6B + B = 7B = -14/k

B = -2/k..........(2)

Eliminating B from equations (1) and (2):

2 /√(3k) = -2/k

Cross multiply:

2k = -2√(3k)

Squaring both sides:

4k^2 = 4 * 3k

4k^2 = 12k

k^2 = 3k

k = 3.

Final answer:

To find the value of k, we first define the roots as p and 6p. We then use the properties of the sum and product of roots in a quadratic equation to form two equations. We can solve these equations to get the value of k.

Explanation:

The given quadratic equation is kx2 + 14x + 8 = 0. We are looking for the value of k for which one root of the equation is six times the other. Let's denote the roots by p and 6p (since one is 6 times the other).

For a quadratic equation ax2 + bx + c = 0, the sum of the roots is given by -b/a and the product of the roots is c/a. In this case, -b/a or -14/k is equal to the sum of the roots (p + 6p). The product of the roots, c/a or 8/k, is equal to p*6p.

From the sum of the roots equation, we can determine p = -14/7k and by substitifying p in the other equation we can solve for k.

Learn more about Quadratic Equations here:

https://brainly.com/question/34196754

find the equation of the line using the slope formula. Write the final equation using the slope-intercept form. the x- intercept is 1, and (x,y) = ( -2, 12) is a point on the line​

Answers

Answer:

[tex]y=- 4x + 4[/tex]

Step-by-step explanation:

The slope formula for a straight line is:

[tex]y=mx+b[/tex]

Where, 'm' is the slope and 'b' is the y-intercept.

To find the x-intercept of a line, we need to equal 'y' to zero, and then solve for 'x'. In this case we know that the x-intercept is 1, so we have the point (x1, y1)=(1,0). We are given a second point which is: (x0, y0)=(-2, 12).

To find the slope, we use the following formula:

[tex]m = \frac{y1-y0}{x1-x0} = \frac{0-12}{1-(-2)} = -4 [/tex]

Now, The equation of the line is: y - y0 = m(x-x0). Then, substituting the values of 'm', 'x0' and 'y0' we have that:

[tex]y - 12 = -4(x+2) ⇒ y = -4x-8 + 12 ⇒ y=- 4x + 4[/tex]

The equation of the line using the slope-intercept form is:

[tex]y=- 4x + 4[/tex]

which is the best name for the quadrilateral with vertices at (2,2) (5,-2) (1,-5) (-2,-1)

Answers

Answer:

  square

Step-by-step explanation:

A graph reveals all side lengths are the same and sides are perpendicular. The quadrilateral is a square.

Select the correct answer.
Nathan had an infection, and his doctor wanted him to take penicillin. Because Nathan’s father and paternal grandfather were allergic to penicillin, Nathan had a 75% chance of having the same allergy. The doctor performed a skin test to see whether Nathan would react to it. The test is 98% accurate. What is the probability that Nathan is allergic to penicillin and the test predicts it?

Answers

Answer:

[tex]P=0.735[/tex]

Step-by-step explanation:

Call A to the event in which Nathan is allergic to penicillin

So

[tex]P (A) = 0.75[/tex]

[tex]P (A') = 1-P (A) = 0.25[/tex]

Call B the event in which the skin test predicts correctly.

So:

[tex]P (B) = 0.98\\P (B ') = 1-P (B) = 0.02[/tex]

We look for the probability that Nathan is allergic to penicillin and the test predicts it.

This is [tex]P (A\ and\ B)[/tex].

[tex]P (A\ and\ B) = P (A)*P (B)\\\\P (A\ and\ B) = 0.75 * 0.98\\\\P (A\ and\ B) = 0.735[/tex]

Convert 32 ounces to pounds

Answers

Answer: 2 pounds

Step-by-step explanation: There are 16 ounces in one pound. So when you divide 32 by 16, you get 2. Therefore your answer would be 2 pounds!

For this case we must make a conversion.

We know, by definition, that 1 ounce is equivalent to 0.0625 pounds.

We make a rule of three to determine how many pounds are 32 ounces.

1oz ---------------> 0.0625lb

32oz -------------> x

DOnde "x" represents the number of pounds

[tex]x = \frac {32 * 0.0625} {1}\\x = 2[/tex]

So, 32 ounces equals 2 pounds

Answer:

2 pounds

Elimination method
2x-7y=0
4x+9y=0

Answers

Answer:

The answer to the question

The cost of renting a car is 35/we plus $0.25/mi traveled during that week. An equation to represent the cost would be y= 35+0.25x, where x is the number of miles traveled. Suppose you have a maximum of $100 to spend for the car rental. What would be the maximum number of miles you could travel?

Answers

ANSWER

260 miles

EXPLANATION

The equation that models the cost is

[tex]y = 35 + 0.25x[/tex]

If you have a maximum of $100 to spend for the car rental, then we can equation the cost function to

$100 to determine the maximum number of miles you could travel.

[tex]35 + 0.25x = 100[/tex]

[tex]0.25x = 100 - 35[/tex]

[tex]0.25x = 65[/tex]

[tex]x = \frac{65}{0.25} [/tex]

[tex]x = 260mi[/tex]

Therefore the maximum number of miles you can travel is 260 miles

Basically what that person said you can travel a max of 260 miles

Please help me for this homework

Answers

Answer:

None

Step-by-step explanation:

Follow me To get The Answer

Answer:

123. [tex]A=lw[/tex], [tex]A=72[/tex]

124. B) 20 square feet

125. C) [tex]\frac{1}{6}[/tex]

126. A) 24 + 12, B) (4*6)+(4*3)

127. 30, 36, 44

Step-by-step explanation:

123. Area = length*width

Substitute '9' for [tex]l[/tex] and '8' for [tex]w[/tex].

[tex]A=(9)(8)[/tex] or [tex]A=(9*8)[/tex]

[tex]9*8=72[/tex], so [tex]A=72[/tex].

124. Using the formula [tex]A=lw[/tex], substitute '5' for [tex]l[/tex] and '4' for [tex]w[/tex].

[tex]A=(5)(4)[/tex] or [tex]A=(5*4)[/tex]

[tex]5*4=20[/tex], so [tex]A=20[/tex].

125. The hexagon was divided into 6 triangles, so each of the triangles is one out of six, one sixth ([tex]\frac{1}{6}[/tex].

126. The lighter rectangle's area is 24 and the darker's is 12 because (4*6) = 24 and (4*3) = 12.

127. For these shapes, I am using the 'subtraction' method (find the area of the shape as if it were a larger rectangle, then subtract the 'blank' spaces).

A(larger rectangle) = [tex]6*7=42[/tex]

A('blank' space) = [tex]3*4=12[/tex]

A(larger rectangle - 'blank' space) = [tex]42-12=30[/tex]

A(larger rectangle) = [tex]8*7=56[/tex]

A('blank' space) = [tex]5*4=20[/tex]

A(larger rectangle - 'blank' space) = [tex]56-20=36[/tex]

A(larger rectangle) = [tex]8*6=48[/tex]

A('blank' space) = [tex]2*1=2[/tex]  (there are two of them (both equal), so add them both together) 2 + 2 = 4.

A(larger rectangle - 'blank' space) = [tex]48-4=44[/tex]

find the value of 9!/(9-32)

Answers

Step-by-step explanation:

[tex]n!=1\cdot2\cdot3\cdot...\cdot n\\\\\dfrac{9!}{9-32}=\dfrac{1\cdot2\cdot3\cdot4\cdot5\cdot6\cdot7\cdot8\cdot9}{-23}=-\dfrac{362880}{23}[/tex]

Subtract (8x-2) -(5x-7)

Answers

Answer:

[tex]3x+5[/tex]

Step-by-step explanation:

we have

[tex](8x-2)-(5x-7)[/tex]

step 1

Eliminate the parenthesis

[tex](8x-2)-(5x-7)=8x-2-5x+7[/tex]

step 2

Groupe terms that contain the same variable

[tex]8x-5x-2+7[/tex]

step 3

Combine like terms

[tex]3x+5[/tex]

The simplified expression  of  (8x-2) -(5x-7) is said to be 3x + 5.

What is the Subtraction?

To subtract the expression (8x - 2) - (5x - 7), we can use the distributive property to remove the parentheses. Here's the step-by-step solution:

(8x - 2) - (5x - 7)

Do, Remove the parentheses:

8x - 2 - 5x + 7

Combine like terms:

(8x - 5x) + (-2 + 7)

Hence:

3x + 5

Therefore, the simplified expression is 3x + 5.

Read more about  Subtraction here:

https://brainly.com/question/13378503

#SPJ6

What is the volume of right rectangular prism with a height of 15 feet length of 24 inches and width of 6 feet

Answers

Answer:

2,160 [tex]ft^{3}[/tex]

Step-by-step explanation:

The formula is V = lhw

15 x 24 x 6 = V

15 x 24 = 360

360 x 6 = 2,160

2,160[tex]ft^{3}[/tex]

Answer: 180 ft³

Step-by-step explanation:

You can calculate the volume of a right rectangular prism with this formula:

[tex]V=lwh[/tex]

Where "l" is the length and "w" is the width.

You know that the height of that this right rectangular prism is 15 feet, its length is 24 inches and its width is 6 feet.

Then, you need to make the conversion from 24 inches to feet (1 feet=12 inches):

[tex]l=(24in)(\frac{1ft}{12in})= 2ft[/tex]

Then, susbtituting values, you get:

[tex]V=(2ft)(6ft)(15ft)=180ft^3[/tex]

Solve the Equation
3x+2y=17
-2x-y=-12

Answers

Answer:

(7,-2)

Step-by-step explanation:

3x+2y=17

-2x-y=-12

Multiply the second equation by 2 so we can eliminate y

2( -2x-y=-12)   becomes -4x-2y = -24

Add this to the first equation

3x+2y=17

-4x-2y=-24

----------------

-x = -7

Multiply each side by -1

x = 7

Substitute back into the first equation to find y

3(7) +2y = 17

21 +2y = 17

Subtract 21 from each side

21-21 +2y = 17-21

2y = -4

Divide each side by 2

2y/2 = -4/2

y =-2

(7,-2)

Answer:

x = 7, y = -2

Step-by-step explanation:

[tex]\left\{\begin{array}{ccc}3x+2y=17&(1)\\-2x-y=-12&(2)\end{array}\right\\\\(2)\\-2x-y=-12\qquad\text{add 2x to both sides}\\-y=2x-12\qquad\text{change the signs}\\y=-2x+12\qquad\text{substitute it to (1):}\\\\3x+2(-2x+12)=17\qquad\text{use the distributive property}\ a(b+c)=ab+ac\\3x+(2)(-2x)+(2)(12)=17\\3x-4x+24=17\qquad\text{subtract 24 from both sides}\\-x=-7\qquad\text{change the signs}\\\boxed{x=7}\\\\\text{Put the value of x to (2):}\\\\y=-2(7)+12\\y=-14+12\\\boxed{y=-2}[/tex]

{(-3, 7.5) , (-2, 10) , (-1, 12.5)} arithmetic or geomatic

Answers

Answer:

arithmetic

Step-by-step explanation:

The points fall on a straight line. They won't do that for a geometric sequence.

___

Normally the terms of either sort of sequence are numbered with counting numbers: 1, 2, 3, .... Your x-values are negative, so are obviously not term numbers of a sequence. The differences of x-values are 1, and the differences of y-values are 2.5, so we know the x- and y-values are linearly related. That relationship can be expressed in point-slope form by ...

y = 2.5(x +1) +12.5

which can be simplified to

y = 2.5x +15

__

The arithmetic sequence with first term 17.5 and common difference 2.5 would be described by this same equation.

what is the center of the circle given by the equation x^2+y^2-14y-15=0

Answers

Answer:

(0, 7)

Step-by-step explanation:

The equation of a circle in the standard form:

[tex](a-h)^2+(y-k)^2=r^2[/tex]

(h, k) - center

r - radius

We have the equation:

[tex]x^2+y^2-12y-15=0[/tex]

Convert into a standard form using

[tex](a-b)^2=a^2-2ab+b^2\qquad(*)[/tex]

[tex]x^2+\underbrace{y^2-2(y)(7)+7^2}_{(*)}-7^2-15=0\\\\(x-0)^2+(y-7)^2-49-15=0[/tex]

[tex](x-0)^2+(y-7)^2-64=0[/tex]           add 64 to both sides

[tex](x-0)^2+(y-7)^2=64[/tex]

The center (0, 7)

The radius: r = √64 = 8

PLZZ HELP BASIC ALGEBRA
Solve the equation
8+2z=3(2-z)

Answers

Answer:

z = [tex]-\frac{2}{5}[/tex] or - 0.4

Step-by-step explanation:

8+2z = 6 - 3z

2z = 6 - 8 - 3z

2z + 3z = - 2

5z = -2

z = [tex]-\frac{2}{5}[/tex] or - 0.4

Determine if the graph is symmetric about the x-axis, the y-axis, or the origin. r = -3 + 3 sin θ

Answers

Support your algebraic solution with a grapher. r=1−3sinθ. ... the graph is symmetric about the x-axis, the y-axis, or the origin.

Answer:

y-axis

Step-by-step explanation:

Match The following.
1. dilation
2. domain
3. radicand
4. translation

A.a shift of a graph
B.a stretching or shrinking of a graph
C.the set of input values for which a function is defined
D.the number (expression) inside a radical sign

Answers

1. B

2. C

3. D

4. A

Hope this helps!

Answer:

1. B

2. C

3. D

4. AStep-by-step explanation:

Plz help me with this

Answers

Answer:

4 n - 7

Step-by-step explanation:

- 3 , 1 , 5 , 9

The difference between the terms is 4, so our multiplier is 4 n

4 , 8 , 12 , 16 ( The 4 times tables )

-3 , 1 , 5 , 9 ( The original sequence )

What are we doing to get from the 4 times tables to get to the original sequence?

4 - - 3 = 7

8 - 1 = 7

12 - 5 = 7

16 - 9 = 7

We are subtracting 7 so our complete general term is 4 n -7

On a map with a scale of 1 inch= 12 miles, the distance between two cities is 4
inches. What is the actual distance between the two cities?

Answers

48 miles. If 1 inch means 12 miles you can multiply both sides by 4 to get "4 inches = 48 miles"

Please I need help!!! Mr. weber ran 5 miles in 33 min. How fast can he run 26.2 miles?

Answers

Answer:

172.92 minutes

Step-by-step explanation:

Step 1: Write a proportion

33/5 = X/26.2

Step 2: Solve your proportion

X = 172.92

Find the rate for the number of minutes per mile. (# of minutes/mile)

33 minutes/5 miles = 6.6 minutes/mile

It takes him 6.6 minutes to run a mile, so you can multiply 26.2 miles by 6.6 minutes to find how long it takes him to run 26.2 miles.

26.2(6.6) = 172.92 minutes

Abc is a rectangle find m angle AEB

Answers

Check the picture below.

Answer:

The correct answer is last option.

m<AEB = 140

Step-by-step explanation:

From the figure we can see  rectangle.

It is given that, m<ADE = 70°

To find the value of m<AEB

From the figure we get Triangle ADE is isosceles triangle

<DAE = 70°

Therefore m<AED = 180 - (70 + 70) = 40°

<AED and <AEB  are linear pairs

Therefore m<AEB = 180 - m<AED

 = 180 - 40 = 140

The correct answer is last option

140

Probability and Statistics
Suppose the x-axis of a density graph represents someone's height in inches. If the area under the density curve from 60 inches to 70 inches is 0.65, what is the probability of someone's height being anywhere from 60 inches to 70 inches?
A. 70%
B. 65%
C. 75%
D. 60%

Answers

Answer:

b

Step-by-step explanation:

Also got B if you it’s not right let me know send me a comment and I will try to help with the best of my ability

Find the sum of 14+20+26+...+1244

Answers

The sum of the series 14+20+26+...+1244 is 129,045.

The question is to find the sum of the sequence 14+20+26+...+1244. This is an arithmetic series where the common difference (d) is 6, since each term is 6 more than the previous term. The first term (a1) is 14.

To find the sum of the series, we need to determine the number of terms (n). The nth term of an arithmetic series is given by an = a1 + (n-1)d. We will set an to 1244, the last term, and solve for n:

1244 = 14 + (n-1) × 6

n = (1244 - 14)/6 + 1

n = 205

Now that we have the number of terms, we can use the sum formula for an arithmetic series which is S = n/2  × (a1 + an). Thus:

S = 205/2 × (14 + 1244)

S = 102.5 × 1258

S = 129,045

So, the sum of the series 14+20+26+...+1244 is 129,045.

Which of the following is least able to transfer electrons?

Answers

Option D. an isulator

Is the right answer i guess...

As The transfer of electrons increases The cunductivity also increases...

Hope it helps...

Regards,

Leukonov/Olegion.

Answer:

Insulator

Step-by-step explanation:

As insulators are meant to prevent the conduction of electricity.

Other Questions
Plz help, its for my CFE in physical science honors.Glen is explaining the relationship between the wavelength and frequency of electromagnetic radiation to his friend, Harold. Which of the following would be a correct explanation of this relationship?A. All electromagnetic waves have the same frequency, but different wavelengthsB. If a wave has a long wavelength, it will have a low frequency. C. If a wave has a low frequency, it will have an equally low wavelength. D. The frequency of a wave is not related to its wavelength. Which statement best explains why women's rights activist were dissatisfied with the fifteenth amendment ? Lucky Jack wins the lottery! He deposits $100,000 in an account that earns 4% interest compounded continuously. How much money is in the account at the end of 5 years?A)$120,357B)$122,140C)$125,620D)$225,820 In the diagram, the radius of the outer circle is 2x cm andthe radius of the inside circle is 6 cm. The area of theshaded region is 200cm.What is the value of x? If the mean of six numbers is 41 and if one is removed the mean will be 46 what is the number being removed analyze the foot of the following phrase. pushy peoplenumber of feet: 4,2,1,3type of feet: anapestic, dactylic, trochaic, iambic Which table represents exponential growth? Which of the following statements are true? Check all that apply. View Available Hint(s) Check all that apply. The average speed of gas molecules decreases with decreasing temperature. The kinetic energy of a molecule cannot determine its speed. All the gas molecules in a sample cannot have the same kinetic energy. The average kinetic energy of gas molecules decreases with decreasing temperature. There are gas molecules that move slower than the average. Consider the chemical equations shown here.P4(s) + 3O2(g) P4O6(s) H1 = -1,640.1 kJP4O10(s) P4(s) + 5O2(g) H2 = 2,940.1 kJWhat is the overall enthalpy of reaction for the equation shown below?Round the answer to the nearest whole number.P4O6(s) + 2O2(g) --> P4O10(s) You need to determine the total distance each hiker will hike.And Determine the number off gallons of water each hiker will bring.ExplainUse picture PLEASE HELP ASAP!!! CORRECT ANSWER ONLY PLEASE!!!A politician wants to see what people in her district think about tax cuts. Which procedure would be a good way of conducting a survey? 15. A geologist discovers a sample of fine-grained rock made up of very small crystals. Based on its physical appearance, what can the geologist conclude about the rock? The Interstate Highway System influenced all of the following except the location ofA)IndustryB)The number of fast-food restaurantsC)The cost of carsD)The health of cities solve this equation for x 0.95 = log x Of all the baseball caps in a store. 2/3 of the caps are blue. Of all the blue baseball caps. 4/7 are on sale. What fraction of the baseball caps in the store are blue and on sale Evaluate -3x3-4x for x= -1.17-1 Need help with this circumference question Select the functions that have a value of 0. sin270 cos90tan0csc(-180)cos(-90) cot270 the end points of AB are A(2,3) and B(8,1). The perpendicular bisector of AB is CD, and point C lies on AB. The length of CD is square root of 10 units. the coordinates of point C are? the slope of CD is? the possible coordinates of point D are ____ and ? The relationship of width to height for a picture is called Steam Workshop Downloader