By graphing both sides of the equation, determine whether the following is an identity:
1+sec^2x= tan^2 x

By Graphing Both Sides Of The Equation, Determine Whether The Following Is An Identity:1+sec^2x= Tan^2

Answers

Answer 1

Graphing is overkill... Let [tex]x=0[/tex]. Then [tex]\sec0=1[/tex], while [tex]\tan0=0[/tex]. But [tex]1+1=2\neq0[/tex], so this is not an identity.

Answer 2

Answer:

It is not an identity

Step-by-step explanation:

If you graphic the two equations (left and right) separately, if they are an identity, they will be the same graphic, which is not true in this case.

Another way in order to know if an equation is an identity, you can replace some values ​​at x, for example 2 values:

X=30

X=60

And now we substitute in the equation, like this:

[tex]1+sec^2(30)=tan^2(30)[/tex]

2,33=0,33 this is not equal on both sides

[tex]1+sec^2(60)=tan^2(60)[/tex]

5=3 this is not equal on both sides

And if the results for each number x are the same on both sides of the equation, it is an identity. In this case they are different.


Related Questions

Max can mow a lawn in 45 minutes. Jan takes twice as long to mow the same lawn. If they work together, how long will it take them to mow the lawn?
a.15.0 minutes
b.22.5 minutes
c.30.0 minutes
d.120.0 minutes

Answers

Answer:

  c.  30.0 minutes

Step-by-step explanation:

Max mows 1/45 lawns per minute.

Jan takes twice as long (90 minutes per lawn), so mows 1/90 lawns per minute.

Working together, they mow ...

  (1/45 + 1/90) lawns per minute = (2/90 +1/90) lawn/min = 3/90 lawn/min

  = 1/30 lawn/min

Then for one lawn, it takes ...

  (1 lawn)/(1/30 lawn/min) = 30 min

Answer:

A

Step-by-step explanation:

30 min

are cartoonist is painting on a canvas that is 15 cm wide how wide is the canvas in inches​

Answers

Answer:

you don't know the answer?! Come on folk you tweaking.

Step-by-step explanation:

Answer:

5.90551

Step-by-step explanation:

1cm in inches - 0.3937008in

30cm in inches - 11.81102in = approx. 1 foot (1 ft = 12")

what is the surface area of the rectangular prism below?
A. 423 units squared
B. 630 units squared
C. 1260 units squared
D. 846 units squared

Answers

Answer: D. 846 units squared

Step-by-step explanation:

12x9=108

108x2=216

15x9=135

135x2=270

12x15=180

180x2=360

360+270+216=846 units squared

The surface area of the rectangular prism is 846 sq.units

What is a rectangular Prism ?

A rectangular prism is a three dimensional figure with rectangle at its base. It can also be called as a Cuboid .

A rectangular prism is given with

length 12 units

Width 15 units

Height 9 units

The surface area of the rectangular prism is given by

A = 2 * l * w + 2 * l * h + 2 * w * h

A = 2 * 12 * 15 + 2 * 9 * 12 + 2 * 15 * 9

A = 360 +  216 + 270

A = 846 sq.units

Therefore the surface area of the rectangular prism is 846 sq.units

To know more about Rectangular Prism

https://brainly.com/question/21308574

#SPJ2

what is the slope,y intercept ,are the lines the same intersecting ,or parallel? What are the number of solutions? Classification ,Consistent-dependent,Consistent-independent,or Inconsistent? use y = mx + b ,m = slope ,b = y-int for y = 2x + 3, 2x - y = 5 and 3x - y = 5 ,2x + y = -3 and y = x + 4 ,y = x + 4. Ive tried posting this question a few times but cannot get the right wording plz help me


Answers

Answer:

For equation:  y = 2x + 3 , 2x - y = 5 There is no solution to this system of equations.For equation: y = 2x + 3 ,  2x - y = 5 There is one solution to the system of equations.For equation: y  = x + 4 , y  = x + 4 There are infinite solutions to the system.

Step-by-step explanation:

The equation of straight line is written as y = m x + c where 'm' is slope. y - intercept of line is value which intersect the point on y-axis.To find y -intercept , put x = 0 in equation.If slope of two lines are equal then lines are parallel.If the lines are not parallel, they will always intersect

For equation:  y = 2x + 3 , 2x - y = 5

Compare equation y = 2x + 3 with y = m x + c then we get slope 'm' is 2.

Now, put x = 0 in y = 2x + 3 to get y-intercept

y = 2(0)+ 3

y = 0 + 3

y =  3

so, the y-intercept is 3 .

Re-write this equation 2x - y = 5 in the slope intercept form;

Subtract 2x from both the sides of 2x - y = 5

2x - y - 2x = 5 - 2x

- y = - 2x + 5

Multiply both the sides by '-1'

y = 2x - 5

so, when we compare above equation with y = m x + c then we get slope 'm' is 2 .

Now, put x = 0 in y = 2x - 5 to get y-intercept

y = 2(0) - 5

y = 0 - 5

y =  - 5

so, the y-intercept is - 5 .

Equation y = 2x + 3 and  2x - y = 5 are parallel (since there slope are equal 'm = 2').

There is no solution to this system of equations.

For equation:  3x - y = 5 , 2x + y = -3

Re-write this equation 3x - y = 5 in the slope intercept form;

Subtract 3x from both the sides of 3x - y = 5

3x - y - 3x = 5 - 3x

- y = - 3x + 5

Multiply both the sides by '-1'

y = 3x - 5

so, when we compare above equation with y = m x + c then we get slope 'm' is 3 .

Now, put x = 0 in y = 3x - 5 to get y-intercept

y = 3(0) - 5

y = 0 - 5

y =  - 5

so, the y-intercept is - 5 .

Re-write this equation 2x + y = -3 in the slope intercept form;

Subtract 2x from both the sides of 2x + y = -3

2x - y - 2x = -3 - 2x

- y = - 2x - 3

Multiply both the sides by '-1'

y = 2x + 3

so, when we compare above equation with y = m x + c then we get slope 'm' is 2 .

Now, put x = 0 in y = 2x + 3 to get y-intercept

y = 2(0) + 3

y = 0 + 3

y =  3

so, the y-intercept is 3 .

Equation 3x - y = 5 and 2x + y = -3 are intersecting lines (since their slope are not equal).

There is one solution to the system of equations (since the lines are intersect).

For equation:   y  = x + 4 , y  = x + 4

Compare equation y = x + 4 with y = m x + c then we get slope 'm' is 1.

Now, put x = 0 in y = x + 4 to get y-intercept

y = 0+ 4

y =  4

so, the y-intercept is 4 .

since equation of line are same therefore slopes are also equal

Equation  y  = x + 4 and y  = x + 4 are parallel lines.

There are infinite solutions to the system. ( Since equivalent equation)

Choose all the examples that require measuring the area.

Answer options:


A.the space the bottom of a tent takes up

B.the distance around the outside of a tent

C.the measure from the top to the bottom of a tent

D.the measure from the top to the bottom of a flat sleeping bag

E.the space a flat sleeping bag takes up

F.the distance around the outside of a flat sleeping bag

Answers

Answer:

A and E

Explanation:

A.the space the bottom of a tent takes up- Area

B.the distance around the outside of a tent- Perimeter

C.the measure from the top to the bottom of a tent- Height

D.the measure from the top to the bottom of a flat sleeping bag-length

E.the space a flat sleeping bag takes up-area

F.the distance around the outside of a flat sleeping bag- perimeter

QUICK!

what is the probability that George will draw a blue marble from a container that contains 6 red, 4 blue, 3 yellow and 5 green marbles?

1/3

1/6

2/9

5/18

Answers

Answer is 2/9.

You have 18 marbles in total. You also have 4 blue marbles. 4/18 divided by 2 is 2/9. Therefore 2/9 is the correct answer.

Your answer is C) 2/9

Hope this helps chu fellow kpop fan XD

☆ Dont forget to mark brainliest ☆

About 34% of people are expected to be infected by the flu this season. What is the risk that a randomly selected person will be infected by the flu?'a) 34 b) 0.34 c) 0.66 d) 66 e) 1 divided by the population size

Answers

Answer:

B 0.34

Step-by-step explanation:

If 34% of all people are expected to get the flu, then that means 34% of any sample size should also expect to be infected.  If they choose 1 person at random from either the population or a preselected random sample, then that person has a 34% chance of getting the flu.  0.34 is the decimal corresponding to 34%. So the probability is 0.34

Convert the percentage to a decimal. The answer is 0.34.

Convert 34% to a decimal, which is 0.34.The correct answer is b) 0.34.

which answer choice best describes f(x)=x-12

Answers

The relationship does not show a direct linear variation best describes f(x)=x−12. Option D is the correct choice.

A function is a specific mathematical relationship with a predefined domain and range, where each value in the domain corresponds to one value in the range.

In the given function, f(x) = x - 12, the slope of the line represents how much 'y' increases as 'x' increases.

A constant slope means that the increase in 'y' is uniform across the entire line. In this case, the slope (m) is 1.

However, this function doesn't exhibit a direct linear variation, as it also has a y-intercept of -12.

The presence of the y-intercept at -12 indicates that the line does not pass through the origin, and therefore, it doesn't show a direct linear variation.

Hence, the linear function f(x) = x - 12 does not display a direct linear variation, making option (D) the correct choice.

For similar question on direct linear variatio

https://brainly.com/question/972052

#SPJ3

Question:-

Which answer choice best describes f(x)=x−12?

A. The relationship shows a direct linear variation with a constant of variation of −12 .

B. The relationship shows a direct linear variation with a constant of variation of 1.

C. The relationship shows a direct linear variation with a constant of variation of 12.

D. The relationship does not show a direct linear variation

The area of a rectangular patio is 5 5/8 square yards, and its length is 1 1/2. What is the patio width, in yards

Answers

The width is 3 3/4. you just have to divide 5 5/8 by 1 1/2.

let's firstly convert those mixed fractions to improper fractions and then proceed.

[tex]\bf \stackrel{mixed}{5\frac{5}{8}}\implies \cfrac{5\cdot 8+5}{8}\implies \stackrel{improper}{\cfrac{45}{8}}~\hfill \stackrel{mixed}{1\frac{1}{2}}\implies \cfrac{1\cdot 2+1}{2}\implies \stackrel{improper}{\cfrac{3}{2}} \\\\[-0.35em] ~\dotfill[/tex]

[tex]\bf \textit{area of a rectangle}\\\\ A=Lw~~ \begin{cases} L=length\\ w=width\\ \cline{1-1} L=\frac{3}{2}\\ A=\frac{45}{8} \end{cases}\implies \cfrac{45}{8}=\cfrac{3}{2}w\implies \cfrac{45}{8}=\cfrac{3w}{2}\implies 90=24w \\\\\\ \cfrac{90}{24}=w\implies \cfrac{15}{4}=w\implies 3\frac{3}{4}=w[/tex]

if k=[-4 | 2, 6 | -3] and m=[2 | 8, -2 | 5] what is x when 2x -k = m

Answers

Answer:

  x = [-1 | 5, 2 | 1]

Step-by-step explanation:

We assume your notation is used to describe 2×2 matrices.

Solve for x:

  2x -k = m

  2x = m + k . . . . add k

  x = (1/2)(m +k) . . . . multiply by 1/2

Fill in the values:

  x = 1/2[2+(-4) | 8 +2, -2+6 | 5+(-3)]

  x = [-1 | 5, 2 | 1]

The correct answer is B, or the graph attached.

Just got it right on edge 2020, hope this helps!! :)

What is the sum of the first 100 terms of the sequence 4,9,14,19, ...?

Answers

Answer:

25150

Step-by-step explanation:

First, we have to see that this is an arithmetic sequence... since to get the next element we add 5 to it.  (a geometric sequence would be a multiplication, not an addition)

So, we have a, the first term (a = 4), and we have the difference between each term (d = 5), and we want to find the SUM of the first 100 terms.

To do this without spending hours writing them down, we can use this formula:

[tex]S = \frac{n}{2} * (2a + (n - 1) * d)[/tex]

If we plug in our values, we have:

[tex]S = \frac{100}{2} * (2 * 4 + (100 - 1) * 5) = 50 * (8 + 99 * 5)[/tex]

S = 50 * (8 + 495) = 50 * 503 = 25150

Answer:

Sum of 100 terms = 25150

Step-by-step explanation:

Formula:-

Sum of n terms of an AP

Sₙ = n/2[2a + (n - 1)d]

Where n - number of terms

a - first term and d - common difference

To find the sum of 100 terms

here, n = 100, a = 4 and d = 5

S₁₀₀ =  n/2[2a + (n - 1)d]

       = 100/2[2*4 + (100 - 1)5]

       = 50[8 + 99*5]

       = 25150

Patti went swimming for 1hour 15minutes on monday. On Tuesday she swam twice as long as she swam on Monday. On Wednesday she swam 50minutes less than the time she swam on Tuesday. How much time did she spend swimming during that three day period

Answers

Final answer:

Patti swam a total of 5 hours and 25 minutes over the three days—1 hour and 15 minutes on Monday, 2 hours and 30 minutes on Tuesday, and 1 hour and 40 minutes on Wednesday.

Explanation:

Patti went swimming for 1 hour and 15 minutes on Monday. To find out how long she swam over the three days, we need to calculate the time for each day and then sum them up.

On Tuesday, she swam twice as long as she did on Monday, which means she swam 2 * (1 hour and 15 minutes) = 2 hours and 30 minutes.

On Wednesday, she swam 50 minutes less than the time she swam on Tuesday, which means she swam (2 hours and 30 minutes) - 50 minutes = 1 hour and 40 minutes.

To find the total time Patti spent swimming during the three days, we add up Monday's, Tuesday's, and Wednesday's swimming times:

Monday: 1 hour and 15 minutesTuesday: 2 hours and 30 minutesWednesday: 1 hour and 40 minutes

The total is 5 hours and 25 minutes.

PLEASE HELP!!

For the following questions, use Euler's Formula to find the missing number.

1. Faces: 25
Vertices: 17
Edges: ?

43
41
39
40

2. Vertices: 11
Edges: 34
Faces: ?

25
28
26
24

3. Edges: 36
Faces: 22
Vertices ?

19
15
16
17

Answers

Answer:

see explanation

Step-by-step explanation:

Using Euler's formula for Polyhedra, that is

F + V - E = 2

where F is faces, V is vertices and E is edges

1

Rearrange formula for E

F + V - E = 2 ( add E to both sides )

F + V = 2 + E ( subtract 2 from both sides )

E = F + V - 2

  = 25 + 17 - 2 = 40

-------------------------------------------------

2

Rearrange formula for F

F + V - E = 2 ( add E to both sides )

F + V = 2 + E ( subtract V from both sides ) F = 2 + E - V, so

F = 2 + 34 - 11 = 25

-----------------------------------------------------

3

Rearrange formula for V

F + V - E = 2 ( add E and subtract F from both sides )

V = 2 + E - F

  = 2 + 36 - 22 = 16

Answer:

1. use Euler's formula to find the missing number f=25 vertices=17 Edges=?

40

2. Mario's company makes gemstones Faces=12 vertices=? edges=20

10 vertices

3. Pierre built the model shown in the diagram for a social studies project

pentagon

4. A jewelry store buys small boxes find the surface area of the box to the nearest whole number

266 cm^2

5. Find the lateral area of the prism below Round your answer to the nearest whole number

322 m^2

6. Find the surface area of the cylinder in terms of pi

350pi cm^2

7. Allison is planning to cover the lateral surface of a large cylindrical can diameter 3 feet height 3.5 feet

33. ft^2

8. Find the surface area of the regular pyramid shown to the nearest whole number

740 m^2

9. is the figure below drawn in one point or 2 point perspective

Janice swims 450 meters in 5 minutes. Find her swimming speed in meters per minute

Answers

90 speed in meters

:explenation step by step

1. 5× =450

2. 450÷5=90

3.5×90=450

Final answer:

Janice's swimming speed is calculated by dividing the distance she swims, 450 meters, by the time it takes, 5 minutes, resulting in a speed of 90 meters per minute.

Explanation:

To calculate Janice's swimming speed in meters per minute, you divide the distance she swims by the time it takes her to swim that distance. Janice swims 450 meters in 5 minutes.

Swimming speed = Distance ÷ Time.

Swimming speed = 450 meters ÷ 5 minutes = 90 meters per minute.

Therefore, Janice's swimming speed is 90 meters per minute.

Can someone help please

Answers

Answer:

  740

Step-by-step explanation:

If x and y represent the numbers of cans Cannon and Haslyn collected, respectively, then the expression x+y represents the total number of cans the two of them collected. The problem statement tells you that, together, they collected 740 cans. The value of x+y is 740. The first equation gives that value the name "A", which means ...

  A = 740

Which answer describes this type of series 240+144+86.4+51.84

Answers

Well this series is neither arithmetic or geometric as said in the other solution but since there are addition signs I will find the sum

The sum is 522.24

PLEASE HELP ASAP!!! CORRECT ANSWER ONLY PLEASE!!!

The results of a survey indicate that between 76% and 84% of the season ticket holders are satisfied with their seat locations.

What is the survey’s margin of error?

Answers

Answer:

4%

Step-by-step explanation:

Answer:

+/- 4%.

Step-by-step explanation:

That would be +/- (84-76)/2

= +/- 8/2

= +/-4%.

A washer and a dryer cost $696 combined. The washer costs $46 more than the dryer. What is the cost of the dryer?

Answers

You're buying two items, we can represent them as X. First you set one of the X's to be the dryer, and since we know that the washer costs 46 more than the dryer, that can be represented as X + 46. The equation can be written as follows:

x + (x + 46) = 696

2x + 46 = 696

2x = 650

x = 325

Therefore, the dryer costs $325, and the washer costs $371

The cost of the dryer is found by setting up an equation where x represents the dryer's cost and solving for x. The calculation steps reveal that the dryer costs $325.

The student is asking how to find the cost of a dryer when given the combined cost of a washer and dryer, and that the washer costs $46 more than the dryer. To solve this, we first let the cost of the dryer be x dollars. Therefore, the cost of the washer would be x + $46. We are told that combined they cost $696.

Setting up the equation: x + (x + $46) = $696.

Combine like terms: 2x + $46 = $696.

Subtract $46 from both sides: 2x = $696 - $46.

Calculate the remaining balance: 2x = $650.

Divide both sides by 2 to find the cost of the dryer: x = $325.

Therefore, the cost of the dryer is $325.

PLEASE HELP ASAP!!! CORRECT ANSWER ONLY PLEASE!!!

The results of a survey indicate that between 76% and 84% of the season ticket holders are satisfied with their seat locations.

What is the survey’s margin of error?

Answers

As far as I can tell, the definition of margin of error involves more than you're given in this exercise (for example, you should know how many people were surveyed, the standard deviation, etc etc).

So, I assume that you're looking for a "simplified" interpretation of the margin of error: the estimate are around 80%, with a margin of 4% up or down.

So, you would be claiming that 80% of people is satisfied, with a margin of uncertainty of 4% (so it can be a minimum of 80-4=76 and a maximum of 80+4=84)

What should be done to solve the following equation?

d - 8 = 9

Subtract 8 from both sides of the equation.
Add 8 to both sides of the equation.
Add 9 to both sides of the equation.
Subtract 9 from both sides of the equation.

Answers

To solve this equation, you need to isolate/get the variable (d) by itself, to do so, you should add 8 on both sides

d - 8 = 9

d - 8 + 8 = 9 + 8

d = 17       The 2nd option is your answer

Convert 6cis (5pi)/6 to rectangular form.


A. 3 Square root of 3 + 3i


B. -3 Square root of 3 +3i


C. 3 Square root of 3 - 3i


D. -3 Square root of 3 - 3i


E. 3 - 3 Square root of 3 i

Answers

Answer:

B

Step-by-step explanation:

I love these!  Ok, the expanded formula you need for this is

[tex]6(cos\frac{5\pi }{6}+sin\frac{5\pi }{6}i)[/tex]

From the unit circle we get the cos and sin of that angle and fill them in:

[tex]6(-\frac{\sqrt{3} }{2}+\frac{1}{2}i)[/tex]

Distributing through the parenthesis gives you

[tex]-\frac{6\sqrt{3} }{2}+\frac{6}{2}i[/tex]

which simplifies to

[tex]-3\sqrt{3}+3i[/tex]

Final answer:

To convert 6cis (5pi)/6 from polar form to rectangular form, use the formula r*cos(theta) + r*sin(theta)*i. The magnitude (r) is 6 and the angle (theta) is 5pi/6. The rectangular form results to be B. -3 Square root of 3 +3i.

Explanation:

The student is asked to convert the complex number 6cis (5pi)/6 from polar form to rectangle form. In polar form, a complex number can be represented as rcis(theta), where r is the magnitude and theta is the angle. To convert this to rectangular form, we use the formula r*cos(theta) + r*sin(theta)*i. In this case, r=6 and theta=5pi/6. Therefore, the rectangular form of the given number is (6*cos(5pi/6)) + (6*sin(5pi/6))*i which equals -3 +

3 square root

of 3*i. Hence, the correct answer is B. -3 Square root of 3 +3i.

Learn more about Conversion from polar to rectangular form here:

https://brainly.com/question/36052460

#SPJ2

Can someone please explain this problem step by step? Thank you sooooooooooooo much!

Answers

Explanation:

Use the Pythagorean identity, cancel common factors, and divide numerator and denominator by cos(x). Equivalently, multiply numerator and denominator by sec(x).

[tex]\dfrac{\sin^2{x}+2\cos{x}-1}{\sin^2{x}+3\cos{x}-3}=\dfrac{1-\cos^2{x}+2\cos{x}-1}{1-\cos^2{x}+3\cos{x}-3} \qquad\text{replace $\sin^2$ with $1-\cos^2$}\\\\=\dfrac{\cos{x}(2-\cos{x})}{(\cos{x}-1)(2-\cos{x})}=\dfrac{\cos{x}}{\cos{x}-1}=\dfrac{1}{\dfrac{\cos{x}}{\cos{x}}-\dfrac{1}{\cos{x}}}=\dfrac{1}{1-\sec{x}}[/tex]


Solve for x.



A. 12
B. 11
C. 10
D. 9

Answers

Answer:

  C.  10

Step-by-step explanation:

The values on the left are proportional to the values on the right. You can write the ratios different ways, but the one I chose is ...

  6/15 = x/25

  6·25/15 = x = 150/15 = 10

The value of x is 10.

A wheel with a dot on its edge rolls on the ground. The radius of the wheel is 15 inches. When the dot is at the position shown below, at an angle of 112°, what is the distance of the dot above the ground, to the nearest tenth of an inch?​

Answers

Answer:

The distance of the dot above the ground is 28.9 in

Step-by-step explanation:

see the attached figure with letters to better understand the problem

we know that

The triangle ABC is an isosceles triangle

CA=CB=15 in ------> is the radius of the circle

∠ACD+112°=180° ---> because the diameter divide the circle into two equal parts

∠ACD=180° -112°=68°

In the right triangle ACD

Find AD we have sin(68°)=AD/AC AD=AC*sin(68°) substitute the value AD=15*sin(68°)=13.9 in

Find the distance AB

AB=2*AD AB=2*13.9=27.8 in

The diameter is equal to

2*15=30 in

The distance of the dot above the ground is equal to

AB+(30-27.8)/2

27.8+1.1=28.9 in

Plz help meehhh :(((

A bus travels two different routes: the Green Route and the Blue Route. The routes are different lengths.

• On Monday the bus traveled the Green Route 6 times and the Blue Route 5 times, traveling a total of 52 miles.

• On Tuesday the bus traveled the Green Route 12 times and the Blue Route 13 times, traveling a total of 119 miles.


What is the length of the Green Route in miles?
A) 4.4 mi
B) 4.5 mi
C) 6.4 mi
D) 6.8 mi

Answers

Answer:

B

Step-by-step explanation:

Let length of Green Route be g and length of Blue Route be b

From 1st bullet point we can write the equation:

6g+5b = 52

From 2nd bullet, we can write:

12g + 13 b = 119

We can solve for b of the 1st equation as:

[tex]6g+5b = 52\\5b=52-6g\\b=\frac{52-6g}{5}[/tex]

Now we can put this value of b into 2nd equation and solve for g (as shown below):

[tex]12g+13b=119\\12g+13(\frac{52-6g}{5})=119\\12g+\frac{676-78g}{5}=119\\\frac{60g+676-78g}{5}=119\\60g+676-78g=5*119\\60g+676-78g=595\\-18g=-81\\g=\frac{-81}{-18}=4.5[/tex]

Hence, the green route is 4.5 miles, B is right.

A circle has its center at (-1, 2) and a radius of 3 units. What is the equation of the circle? (1 point) (x - 1)2 + (y + 2)2 = 3 (x + 1)2 + (y - 2)2 = 3 (x + 1)2 + (y + 2)2 = 9 (x + 1)2 + (y - 2)2 = 9

Answers

Answer:

(x + 1)^2 + (y - 2)^2 = 3^2 = 9

Step-by-step explanation:

The standard equation of a circle with center at (h, k) and radius r is

(x - h)^2 + (y - k)^2 = r^2.

Here, h = -1, k = 2 and r = 3, so the equation of this particular circle is

(x + 1)^2 + (y - 2)^2 = 3^2 = 9.

Katie has a job planting shrubs beside the highway. She needs to plant 500 shrubs in a week. So far, She has planted this many: Monday 84 Tuesday 92 Wednesday 87 Thursday 104 How many shrubs does Katie need to plant on Friday?

Answers

ANSWER: Katie Must Plant 133 Shrubs On Friday.

First, We Know That Katie Needs To Plant 500 Shrubs In A Week. So Then, We Add Up 104+87+92+84 And When We Add Those Numbers Up, We Get How Many Shrubs She Has Planted On Monday Tuesday Wednesday And Thursday. To Find Out How Many Plants She Needs To Plant On Friday, Subtract 367 From 500 And You Get 133.

Prudence is creating a garden in her backyard. She wants it to be the shape of an equilateral triangle with sides of length 20 feet. What will be the area of this triangular garden? Round your answer to the nearest whole foot.

Answers

Answer:

The area of the triangular garden is [tex]173\ ft^{2}[/tex]  

Step-by-step explanation:

we know that

The equilateral triangle has three equal sides and three equal internal angles (the measure of each internal angle is 60 degrees)

The area of a triangle applying the law of sines is equal to

[tex]A=\frac{1}{2}(a)(b)sin(C)[/tex]

In this problem we have a equilateral triangle

therefore

[tex]a=b=20\ ft[/tex]

[tex]C=60\°[/tex]

substitute

[tex]A=\frac{1}{2}(20)(20)sin(60\°)[/tex]

[tex]A=\frac{1}{2}(20)(20)\frac{\sqrt{3}}{2} \\ \\A=100\sqrt{3}\ ft^{2}\\ \\A=173\ ft^{2}[/tex]

(4x-5x)(x-3) use foil to multiply the binomial

Answers

Answer:

-x^2+3x

Step-by-step explanation:

{PLEASE HELP ASAP}
I dont know how to do these very well at all, please help me!

Answers

the answer for this question is all are not polynomials

Answer:

The first, second, and last ones are polynomials, the others are not.

Step-by-step explanation:

Other Questions
The volume of a cube is 1953.1 25 cm find the length of the side round your answer to the nearest 10th I NEED ANSWER BY TODAY1. (1) I stood offstage. (2) I felt nervous. (3) I was prepared for the audition. (4) Still, I felt nervous. (5) I always do. (6) It doesn't matter whether the part is large or small, whether I know the director or not, or whether I am having a good day or a bad one. (7) I always feel nervous before I go onstage. (8) Then I actually step onstage, and I relax. Which sentence in the paragraph uses parallel structure?a. sentence 1b. sentence 3c. sentence 5d. sentence 62. Use your understanding of the Latin root -aud- to choose the meaning of the phrase an audible sigh.a. a sigh that shows sad feelingsb. a sigh showing fear or anxietyc. an easily heard sighd. a sigh that hides other emotions3. udging from the meaning of the Latin root -script-, choose the place where you would most likely find a postscript.a. in the stage directions of the written version of a dramatic playb. at the end of a letter, after the body and signaturec. in a sidebar of warnings about how to operate heavy machineryd. as part of the instructions in a computer manual The perimeter of a basketball court is 84 meters and the length is 6 meters longer than twice the width. what are the length and width? Find the perimeter of a triangle with sides measuring 5 centimeters , 9 centimeter, and 11 centimeters Freddy does not know why his wife seems so angry and upset. he decides not to say anything to her, according to rebt, freddy express 45 minutes as a fraction of 1 hour Simplify dont show your work got it Which of the following is csc(-166) equal to?csc(14)-csc(14)-csc(-14)csc(166) What is the approximate measure of this angle? Why was the Tennis Court Oath a significant event of the French Revolution? In which way is biomass similar to fossil fuels? Which figure shows how a shape can be rotated about an axis to form a hemisphere? What is Wiesel's primary purpose in "The Perils of Indifference"?A. To tell the story of Wiesel's experiences in the concentration camps B. To thank the president for inviting Wiesel to speak at the White HouseC. To ask people to do something when they see human sufferingD. To ask people to remember what happened during the Holocaust how can personal biases and points of view influence historians when they are studying evidence What is the 6th value in the sequence with the explicit formula an= 2n14? If a media message shows favoritism it is considered to be Pacific Islanders today are working to improve their economies through all of the following areas except ___________.agriculturecomputer technologytourismfishing The sea labeled with the number 7 on the map above is the __________ Sea.A.Baltic SeaB.Bering SeaC.Sea of JapanD.Sea of Okhotsk What was Pizarros strategy for conquering the Inca?A. Create a peace agreement with AtahualpaB. Launch a surprise attack on the Inca capitalC. Allow the Inca to continue to rule themselves name this song if you take to long to hit me back i cant promise you how i will react